Index of /mirror/parabola.nu/pool/community

[ICO]NameLast modifiedSize

[PARENTDIR]Parent Directory  -
[PGP]pcp-pmda-snmp-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 94
[PGP]benchmark-1.5.2-1-x86_64.pkg.tar.zst.sig2020-09-19 06:13 95
[PGP]camlp4-4.10-1-x86_64.pkg.tar.zst.sig2020-09-06 03:13 95
[PGP]camlp5-7.12-11-x86_64.pkg.tar.zst.sig2020-09-06 03:13 95
[PGP]cmucl-21d-1-x86_64.pkg.tar.xz.sig2019-05-28 06:14 95
[PGP]cockpit-234-2-x86_64.pkg.tar.zst.sig2020-12-18 05:13 95
[PGP]cockpit-242-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 95
[PGP]cockpit-machines-234-2-x86_64.pkg.tar.zst.sig2020-12-18 05:13 95
[PGP]cockpit-machines-243-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 95
[PGP]cockpit-pcp-234-2-x86_64.pkg.tar.zst.sig2020-12-18 05:13 95
[PGP]cockpit-pcp-242-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 95
[PGP]cockpit-podman-26-1-x86_64.pkg.tar.zst.sig2020-12-17 05:13 95
[PGP]cockpit-podman-30-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 95
[PGP]dbeaver-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-06 06:13 95
[PGP]dbeaver-plugin-apache-poi-4.1.1-2-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]dbeaver-plugin-batik-1.9.1-6-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]dbeaver-plugin-bouncycastle-1.60.0-1-any.pkg.tar.xz.sig2019-01-14 05:18 95
[PGP]dbeaver-plugin-bouncycastle-1.64.0.v20191109.0815-2-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]dbeaver-plugin-office-1.1.56.201910061950-1-any.pkg.tar.xz.sig2019-10-20 22:41 95
[PGP]dbeaver-plugin-office-1.1.85.202012201616-1-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]dbeaver-plugin-sshj-1.0.39.201910061950-1-any.pkg.tar.xz.sig2019-10-20 22:41 95
[PGP]dbeaver-plugin-sshj-1.0.68.202012201616-1-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]dbeaver-plugin-sshj-lib-0.27.1-1-any.pkg.tar.xz.sig2019-07-26 06:16 95
[PGP]dbeaver-plugin-sshj-lib-0.27.3-2-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]dbeaver-plugin-svg-format-1.0.54.201910061950-1-any.pkg.tar.xz.sig2019-10-20 22:41 95
[PGP]dbeaver-plugin-svg-format-1.0.83.202012201616-1-any.pkg.tar.zst.sig2020-12-26 05:13 95
[PGP]earlyoom-1.6.2-1-x86_64.pkg.tar.zst.sig2020-10-15 06:13 95
[PGP]elasticsearch-6.7.0-1-any.pkg.tar.xz.sig2019-03-29 05:13 95
[PGP]elasticsearch-7.10.1-1-x86_64.pkg.tar.zst.sig2020-12-29 05:14 95
[PGP]fabric-2.6.0-1-any.pkg.tar.zst.sig2021-01-27 05:13 95
[PGP]geoip2-database-20191203-1-any.pkg.tar.xz.sig2019-12-11 05:13 95
[PGP]geoipupdate-4.6.0-2-x86_64.pkg.tar.zst.sig2021-02-24 05:13 95
[PGP]grpc-1.36.4-1-x86_64.pkg.tar.zst.sig2021-03-20 05:14 95
[PGP]grpc-cli-1.36.4-1-x86_64.pkg.tar.zst.sig2021-03-20 05:14 95
[PGP]gscan2pdf-2.5.7-1-any.pkg.tar.xz.sig2019-10-20 22:41 95
[PGP]gscan2pdf-2.12.0-1-any.pkg.tar.zst.sig2021-04-19 06:13 95
[PGP]jitterentropy-3.0.1-1-x86_64.pkg.tar.zst.sig2021-01-22 05:13 95
[PGP]kibana-7.10.1-1-any.pkg.tar.zst.sig2020-12-29 05:15 95
[PGP]libdwarf-20201201-1-x86_64.pkg.tar.zst.sig2020-12-08 05:14 95
[PGP]libimagequant-2.14.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:15 95
[PGP]libmaxminddb-1.5.2-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 95
[PGP]libp11-0.4.11-1-x86_64.pkg.tar.zst.sig2020-10-15 06:13 95
[PGP]libvarlink-22-1-x86_64.pkg.tar.zst.sig2021-03-03 05:15 95
[PGP]libvirt-dbus-1.4.0-1-x86_64.pkg.tar.zst.sig2020-09-12 06:13 95
[PGP]logstash-7.10.1-1-x86_64.pkg.tar.zst.sig2020-12-29 05:16 95
[PGP]maxima-ecl-5.44.0-2-x86_64.pkg.tar.zst.sig2020-06-22 06:13 95
[PGP]mmdblookup-1.5.2-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 95
[PGP]mod_passenger-6.0.8-2-x86_64.pkg.tar.zst.sig2021-04-03 06:14 95
[PGP]nginx-mod-auth-pam-1.5.2-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 95
[PGP]nginx-mod-brotli-1:1.0.0rc-1-x86_64.pkg.tar.zst.sig2020-07-14 06:13 95
[PGP]nginx-mod-cache_purge-2.5.1-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 95
[PGP]nginx-mod-naxsi-1.3-1-x86_64.pkg.tar.zst.sig2020-11-19 05:13 95
[PGP]nginx-mod-njs-0.5.3-1-x86_64.pkg.tar.zst.sig2021-04-03 06:13 95
[PGP]nginx-mod-passenger-6.0.8-2-x86_64.pkg.tar.zst.sig2021-04-03 06:14 95
[PGP]nginx-mod-srcache-0.32-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 95
[PGP]nodejs-less-3.11.2-1-any.pkg.tar.zst.sig2020-06-07 21:39 95
[PGP]ocaml-lablgl-1.06-8-x86_64.pkg.tar.zst.sig2020-09-13 06:13 95
[PGP]oniguruma-6.9.7.1-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 95
[PGP]openfire-4.6.2-1-any.pkg.tar.zst.sig2021-02-07 05:14 95
[PGP]pacmanlogviewer-1.4.3-1-x86_64.pkg.tar.zst.sig2021-03-22 05:19 95
[PGP]passenger-6.0.8-2-x86_64.pkg.tar.zst.sig2021-04-03 06:14 95
[PGP]pcp-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-gui-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-activemq-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-bcc-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-bind2-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-bpftrace-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-libvirt-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-mysql-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-nginx-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-nutcracker-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-openmetrics-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-podman-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]pcp-pmda-postgresql-5.3.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 95
[PGP]percona-toolkit-3.3.0-2-x86_64.pkg.tar.zst.sig2021-02-24 05:14 95
[PGP]perl-carp-always-0.16-1-any.pkg.tar.zst.sig2020-11-22 05:14 95
[PGP]perl-gtk3-0.035-1-any.pkg.tar.xz.sig2019-07-08 06:14 95
[PGP]perl-gtk3-0.037-1-any.pkg.tar.zst.sig2020-03-30 06:13 95
[PGP]perl-gtk3-imageview-6-1-any.pkg.tar.zst.sig2020-11-22 05:14 95
[PGP]perl-padwalker-2.5-1-x86_64.pkg.tar.zst.sig2020-10-04 06:13 95
[PGP]perl-pdf-api2-2.037-1-any.pkg.tar.zst.sig2020-06-29 06:13 95
[PGP]perl-pdf-builder-3.019-1-any.pkg.tar.zst.sig2020-11-22 05:14 95
[PGP]php-grpc-1.36.4-1-x86_64.pkg.tar.zst.sig2021-03-20 05:14 95
[PGP]php7-grpc-1.36.4-1-x86_64.pkg.tar.zst.sig2021-03-20 05:14 95
[PGP]pngquant-2.14.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:16 95
[PGP]python-grpcio-1.36.4-1-x86_64.pkg.tar.zst.sig2021-03-20 05:15 95
[PGP]python-iso8601-0.1.14-1-any.pkg.tar.zst.sig2021-02-07 05:14 95
[PGP]python-rsa-4.7.2-1-any.pkg.tar.zst.sig2021-03-03 05:16 95
[PGP]python-setproctitle-1.2.2-1-x86_64.pkg.tar.zst.sig2021-01-26 05:13 95
[PGP]python-ujson-4.0.2-1-x86_64.pkg.tar.zst.sig2021-02-03 05:14 95
[PGP]python2-cloudpickle-1.2.1-1-any.pkg.tar.xz.sig2019-07-08 06:14 95
[PGP]python2-qtawesome-0.5.7-1-any.pkg.tar.xz.sig2019-04-27 06:13 95
[PGP]python2-qtpy-1.8.0-1-any.pkg.tar.xz.sig2019-07-08 06:14 95
[PGP]python2-spyder-kernels-0.2.6-1-any.pkg.tar.xz.sig2018-10-08 20:15 95
[PGP]python2-spyder-kernels-0.4.4-1-any.pkg.tar.xz.sig2019-04-27 06:13 95
[PGP]rng-tools-6.12-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 95
[PGP]snapper-0.9.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 95
[PGP]softhsm-2.6.1-2-x86_64.pkg.tar.zst.sig2020-10-21 06:13 95
[PGP]sparsehash-2.0.4-1-any.pkg.tar.zst.sig2020-09-12 06:13 95
[PGP]spyder2-3.3.1-1-any.pkg.tar.xz.sig2018-10-08 20:15 95
[PGP]spyder2-3.3.5-1-any.pkg.tar.xz.sig2019-07-08 06:14 95
[PGP]spyder3-3.3.1-1-any.pkg.tar.xz.sig2018-10-08 20:15 95
[PGP]spyder3-3.3.5-1-any.pkg.tar.xz.sig2019-07-08 06:14 95
[PGP]ssdeep-2.14.1-2-x86_64.pkg.tar.zst.sig2020-05-09 06:13 95
[PGP]sssd-2.4.2-1-x86_64.pkg.tar.zst.sig2021-02-21 05:14 95
[PGP]supervisor-4.2.2-1-any.pkg.tar.zst.sig2021-03-03 05:16 95
[PGP]sweethome3d-6.5-2-x86_64.pkg.tar.zst.sig2021-04-16 06:14 95
[PGP]xca-2.3.0-1-x86_64.pkg.tar.zst.sig2020-05-02 06:13 95
[PGP]xtrabackup-8.0.23_16-1-x86_64.pkg.tar.zst.sig2021-03-24 05:21 95
[PGP]buildbot-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 118
[PGP]critest-1.20.0-2-x86_64.pkg.tar.zst.sig2021-03-26 05:13 118
[PGP]gxplugins.lv2-0.8-1-x86_64.pkg.tar.zst.sig2020-06-07 21:38 118
[PGP]lib32-cmocka-1.1.5-1-x86_64.pkg.tar.zst.sig2020-02-22 05:13 118
[PGP]python-click-help-colors-0.9-1-any.pkg.tar.zst.sig2020-12-07 05:13 118
[PGP]python-pytest-html-3.1.1-1-any.pkg.tar.zst.sig2020-12-15 05:18 118
[PGP]rtosc-0.2.0-3-x86_64.pkg.tar.zst.sig2020-09-10 06:13 118
[PGP]a2jmidid-9-3-x86_64.pkg.tar.zst.sig2020-11-30 05:13 119
[PGP]abduco-0.6-6-x86_64.pkg.tar.zst.sig2020-12-31 05:13 119
[PGP]abletonlink-3.0.3-1-x86_64.pkg.tar.zst.sig2020-12-17 05:13 119
[PGP]absl-py-0.12.0-1-any.pkg.tar.zst.sig2021-03-16 05:13 119
[PGP]adljack-1.2.0-2-x86_64.pkg.tar.xz.sig2019-11-23 05:13 119
[PGP]aeolus-0.9.9-1-x86_64.pkg.tar.zst.sig2020-06-21 06:13 119
[PGP]agordejo-0.2.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:37 119
[PGP]alsa-tools-1.2.2-1-x86_64.pkg.tar.zst.sig2020-02-22 05:13 119
[PGP]ambix-0.2.10-3-x86_64.pkg.tar.zst.sig2020-11-24 05:13 119
[PGP]ams-2.2.0-1-x86_64.pkg.tar.zst.sig2021-03-05 05:13 119
[PGP]amsynth-1.12.2-1-x86_64.pkg.tar.zst.sig2020-11-21 05:13 119
[PGP]antlr4-4.8-1-any.pkg.tar.zst.sig2021-01-21 05:13 119
[PGP]antlr4-4.9.2-1-any.pkg.tar.zst.sig2021-03-19 05:15 119
[PGP]antlr4-runtime-4.9.2-1-x86_64.pkg.tar.zst.sig2021-03-19 05:15 119
[PGP]anything-sync-daemon-5.85-3-any.pkg.tar.zst.sig2020-02-16 05:13 119
[PGP]ardour-6.6-1-x86_64.pkg.tar.zst.sig2021-02-25 05:16 119
[PGP]ardour-6.6-2-x86_64.pkg.tar.zst.sig2021-04-17 06:16 119
[PGP]artyfx-1.3.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:37 119
[PGP]atftp-0.7.4-1-x86_64.pkg.tar.zst.sig2021-02-03 05:13 119
[PGP]audacity-1:2.4.1-4-x86_64.pkg.tar.zst.sig2020-05-28 06:13 119
[PGP]auto-multiple-choice-1.4.0-10-x86_64.pkg.tar.zst.sig2020-12-23 05:13 119
[PGP]autorandr-1.11-2-any.pkg.tar.zst.sig2020-11-18 05:14 119
[PGP]avldrums.lv2-0.4.2-1-x86_64.pkg.tar.zst.sig2021-01-17 02:37 119
[PGP]babeld-1.9.2-2-x86_64.pkg.tar.zst.sig2021-01-17 02:37 119
[PGP]bchoppr-1.10.6-1-x86_64.pkg.tar.zst.sig2021-04-07 06:13 119
[PGP]bin86-0.16.21-3-x86_64.pkg.tar.zst.sig2020-04-17 06:13 119
[PGP]blop-0.2.8-4-x86_64.pkg.tar.zst.sig2020-04-01 06:13 119
[PGP]bsequencer-1.8.8-1-x86_64.pkg.tar.zst.sig2021-03-17 05:14 119
[PGP]bshapr-0.12-1-x86_64.pkg.tar.zst.sig2021-03-18 05:13 119
[PGP]bslizr-1.2.14-1-x86_64.pkg.tar.zst.sig2021-04-07 06:13 119
[PGP]buildbot-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]buildbot-common-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]buildbot-common-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]buildbot-docs-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]buildbot-docs-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]buildbot-worker-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]buildbot-worker-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]cacti-1.2.16-3-any.pkg.tar.zst.sig2021-02-28 05:16 119
[PGP]cadence-0.9.1-4-x86_64.pkg.tar.zst.sig2021-01-17 02:56 119
[PGP]cage-0.1.3-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]canto-daemon-0.9.8-1-any.pkg.tar.zst.sig2020-12-08 05:13 119
[PGP]capitaine-cursors-4-1-any.pkg.tar.zst.sig2020-02-21 05:13 119
[PGP]capnproto-0.8.0-1-x86_64.pkg.tar.zst.sig2020-04-24 06:14 119
[PGP]carla-2.3.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 119
[PGP]ccid-1.4.34-1-x86_64.pkg.tar.zst.sig2021-02-01 05:13 119
[PGP]cgit-1.2.3-3-x86_64.pkg.tar.zst.sig2021-03-16 05:13 119
[PGP]cgit-archweb-1.2.3-1-x86_64.pkg.tar.zst.sig2020-03-17 05:13 119
[PGP]cgit-aurweb-1.2.3-1-x86_64.pkg.tar.zst.sig2020-03-17 05:13 119
[PGP]chewing-editor-0.1.1-8-x86_64.pkg.tar.zst.sig2021-03-28 06:13 119
[PGP]chrono-date-3.0.0-2-x86_64.pkg.tar.zst.sig2020-08-07 06:13 119
[PGP]confuse-3.3-3-x86_64.pkg.tar.zst.sig2021-01-17 02:37 119
[PGP]containers-common-0.36.0-1-any.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]coq-8.13.1-1-x86_64.pkg.tar.zst.sig2021-03-05 05:13 119
[PGP]coq-doc-8.13.1-1-x86_64.pkg.tar.zst.sig2021-03-05 05:13 119
[PGP]coqide-8.13.1-1-x86_64.pkg.tar.zst.sig2021-03-05 05:13 119
[PGP]cpptoml-0.1.1-2-any.pkg.tar.zst.sig2020-07-20 06:13 119
[PGP]cri-o-1.20.2-1-x86_64.pkg.tar.zst.sig2021-03-26 05:13 119
[PGP]cri-o-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]crictl-1.20.0-2-x86_64.pkg.tar.zst.sig2021-03-26 05:13 119
[PGP]crictl-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:13 119
[PGP]critest-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:13 119
[PGP]csound-6.15.0-3-x86_64.pkg.tar.zst.sig2021-04-11 06:13 119
[PGP]csound-6.15.0-4-x86_64.pkg.tar.zst.sig2021-04-17 06:16 119
[PGP]csound-doc-6.15.0-3-x86_64.pkg.tar.zst.sig2021-04-11 06:13 119
[PGP]csound-doc-6.15.0-4-x86_64.pkg.tar.zst.sig2021-04-17 06:16 119
[PGP]csoundqt-1:0.9.8.1-1-x86_64.pkg.tar.zst.sig2020-07-09 09:39 119
[PGP]ctemplate-2.4-1-x86_64.pkg.tar.zst.sig2020-03-09 05:13 119
[PGP]darkhttpd-1.13-1-x86_64.pkg.tar.zst.sig2021-03-01 05:13 119
[PGP]dbus-c++-0.9.0-9-x86_64.pkg.tar.xz.sig2019-11-25 05:13 119
[PGP]deepin-qt5integration-5.1.11-2-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]deteriorate-lv2-1.0.7-2-x86_64.pkg.tar.zst.sig2020-06-24 06:13 119
[PGP]dev86-0.16.21-4-x86_64.pkg.tar.zst.sig2020-02-21 05:13 119
[PGP]devilspie-0.23-4-x86_64.pkg.tar.zst.sig2020-10-29 05:13 119
[PGP]din-50.2-1-x86_64.pkg.tar.zst.sig2021-04-18 06:13 119
[PGP]distrho-ports-2021.03.15-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 119
[PGP]dnscrypt-proxy-2.0.45-2-x86_64.pkg.tar.zst.sig2021-03-26 05:13 119
[PGP]dnsperf-2.5.2-2-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]dpf-plugins-1.4-1-x86_64.pkg.tar.zst.sig2021-01-17 02:40 119
[PGP]dragonfly-reverb-3.2.5-1-x86_64.pkg.tar.zst.sig2021-03-06 05:13 119
[PGP]drumgizmo-0.9.19-1-x86_64.pkg.tar.zst.sig2020-11-23 05:13 119
[PGP]drumkv1-0.9.21-2-x86_64.pkg.tar.zst.sig2021-03-17 05:14 119
[PGP]drumstick-2.1.1-1-x86_64.pkg.tar.zst.sig2021-04-02 06:13 119
[PGP]element-0.42.0-2-x86_64.pkg.tar.xz.sig2019-12-19 05:13 119
[PGP]element-0.46.0-2-x86_64.pkg.tar.zst.sig2021-04-02 06:13 119
[PGP]etckeeper-1.18.15-2-any.pkg.tar.zst.sig2020-11-24 05:13 119
[PGP]etckeeper-1.18.16-2-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]eteroj.lv2-0.10.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]fabla-1.3.2-3-x86_64.pkg.tar.zst.sig2020-05-22 06:13 119
[PGP]fastd-21-2-x86_64.pkg.tar.zst.sig2021-01-17 02:40 119
[PGP]faust-2.30.5-2-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]fcitx-chewing-0.2.3-4-x86_64.pkg.tar.zst.sig2020-05-11 06:13 119
[PGP]fig2dev-3.2.8.a-1-x86_64.pkg.tar.zst.sig2021-04-06 06:13 119
[PGP]fltk-1.3.5-4-x86_64.pkg.tar.zst.sig2020-10-03 06:13 119
[PGP]fltk-docs-1.3.5-4-x86_64.pkg.tar.zst.sig2020-10-03 06:13 119
[PGP]fltk-examples-1.3.5-4-x86_64.pkg.tar.zst.sig2020-10-03 06:13 119
[PGP]fluajho-1.6.2-2-x86_64.pkg.tar.zst.sig2021-02-09 05:16 119
[PGP]flyspray-1.0rc9-4-any.pkg.tar.zst.sig2021-02-28 05:16 119
[PGP]flyspray-1.0rc9-5-any.pkg.tar.zst.sig2021-03-01 05:13 119
[PGP]freepats-general-midi-20210329-1-any.pkg.tar.zst.sig2021-03-31 06:14 119
[PGP]gammastep-2.0.7-1-x86_64.pkg.tar.zst.sig2021-01-17 02:41 119
[PGP]ganv-1.8.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:41 119
[PGP]gcin-2.9.0-3-x86_64.pkg.tar.zst.sig2020-12-31 05:13 119
[PGP]geonkick-2.8.0-1-x86_64.pkg.tar.zst.sig2021-04-07 06:13 119
[PGP]gephi-0.9.2-3-any.pkg.tar.zst.sig2021-03-25 05:14 119
[PGP]giada-0.17.0-1-x86_64.pkg.tar.zst.sig2020-11-21 05:14 119
[PGP]gitolite-3.6.12-1-any.pkg.tar.zst.sig2020-08-08 06:13 119
[PGP]gmm-5.4-1-any.pkg.tar.zst.sig2020-04-26 06:13 119
[PGP]gmsynth.lv2-0.5.0-1-x86_64.pkg.tar.zst.sig2020-07-15 06:13 119
[PGP]gobby-1:0.6.0-1-x86_64.pkg.tar.zst.sig2021-02-16 05:13 119
[PGP]gtk-layer-shell-0.6.0-1-x86_64.pkg.tar.zst.sig2021-03-04 05:14 119
[PGP]gtkimageview-1.6.4-7-x86_64.pkg.tar.zst.sig2020-12-31 05:13 119
[PGP]guitarix-0.42.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:44 119
[PGP]haproxy-2.3.9-1-x86_64.pkg.tar.zst.sig2021-03-31 06:15 119
[PGP]haskell-tidal-1.7.3-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]helm-synth-0.9.0-9-x86_64.pkg.tar.zst.sig2020-04-06 06:13 119
[PGP]hepmc-3.2.3-1-x86_64.pkg.tar.zst.sig2021-02-01 05:13 119
[PGP]hepmc-docs-3.2.3-1-x86_64.pkg.tar.zst.sig2021-02-01 05:13 119
[PGP]hevea-2.35-1-x86_64.pkg.tar.zst.sig2021-01-19 05:14 119
[PGP]hexter-1.1.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:44 119
[PGP]hidapi-0.10.1-1-x86_64.pkg.tar.zst.sig2020-11-29 05:13 119
[PGP]hyperkitty-1.3.4-1-any.pkg.tar.zst.sig2021-02-26 05:16 119
[PGP]ibus-chewing-1.6.1+12+gc1e7f0d-3-x86_64.pkg.tar.zst.sig2021-02-08 05:13 119
[PGP]icecast-2.4.4-4-x86_64.pkg.tar.zst.sig2020-09-14 06:13 119
[PGP]iempluginsuite-1.11.1-1-x86_64.pkg.tar.zst.sig2020-04-04 06:13 119
[PGP]infamousplugins-0.3.0-3-x86_64.pkg.tar.zst.sig2020-04-29 06:13 119
[PGP]interception-caps2esc-0.3.2-1-x86_64.pkg.tar.zst.sig2021-01-17 02:46 119
[PGP]interception-dual-function-keys-1.3.0-1-x86_64.pkg.tar.zst.sig2020-12-29 05:15 119
[PGP]interception-dual-function-keys-1.4.0-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 119
[PGP]interception-tools-0.6.4-2-x86_64.pkg.tar.zst.sig2021-01-17 05:13 119
[PGP]ipv6calc-2.2.0-2-x86_64.pkg.tar.zst.sig2020-09-06 03:15 119
[PGP]ir.lv2-1.3.4-2-x86_64.pkg.tar.zst.sig2020-04-29 06:13 119
[PGP]irker-2.19-1-any.pkg.tar.zst.sig2020-07-09 09:40 119
[PGP]jack-stdio-1.6-1-x86_64.pkg.tar.zst.sig2020-08-10 06:14 119
[PGP]jack2-1.9.17-2-x86_64.pkg.tar.zst.sig2021-01-25 05:14 119
[PGP]jack2-1.9.18-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]jack2-dbus-1.9.17-2-x86_64.pkg.tar.zst.sig2021-01-25 05:14 119
[PGP]jack2-dbus-1.9.18-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]jack_delay-0.4.2-1-x86_64.pkg.tar.xz.sig2019-11-17 05:13 119
[PGP]jack_mixer-16-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]jack_utils-0.0.1-1-x86_64.pkg.tar.zst.sig2020-04-13 06:13 119
[PGP]jackmeter-0.4-2-x86_64.pkg.tar.xz.sig2019-11-22 05:13 119
[PGP]jackminimix-0.2.1-2-x86_64.pkg.tar.xz.sig2019-11-22 05:13 119
[PGP]jacktrip-1.3.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:46 119
[PGP]jalv-1.6.6-1-x86_64.pkg.tar.zst.sig2021-01-17 02:46 119
[PGP]juce-5.4.7-1-x86_64.pkg.tar.zst.sig2020-02-11 05:13 119
[PGP]jwm-2.3.7-3-x86_64.pkg.tar.zst.sig2020-11-21 05:14 119
[PGP]kanshi-1.1.0-1-x86_64.pkg.tar.zst.sig2020-04-05 06:13 119
[PGP]kea-1.9.6-1-x86_64.pkg.tar.zst.sig2021-04-08 06:13 119
[PGP]keepalived-2.2.2-1-x86_64.pkg.tar.zst.sig2021-03-06 05:14 119
[PGP]kernelshark-1.3-1-x86_64.pkg.tar.zst.sig2021-03-29 06:22 119
[PGP]kube-apiserver-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kube-apiserver-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:13 119
[PGP]kube-controller-manager-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kube-controller-manager-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]kube-proxy-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kube-proxy-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]kube-scheduler-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kube-scheduler-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]kubeadm-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kubeadm-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]kubectl-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kubectl-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]kubelet-1.20.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 119
[PGP]kubelet-1.21.0-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]kxstudio-lv2-extensions-2020.08.08-1-any.pkg.tar.zst.sig2020-08-09 06:13 119
[PGP]lablgtk3-3.1.1-2-x86_64.pkg.tar.zst.sig2021-01-19 05:14 119
[PGP]lib32-acl-2.3.1-1-x86_64.pkg.tar.zst.sig2021-03-17 05:17 119
[PGP]lib32-alsa-lib-1.2.4-2-x86_64.pkg.tar.zst.sig2020-10-22 06:13 119
[PGP]lib32-alsa-oss-1.1.8-2-x86_64.pkg.tar.zst.sig2020-02-22 05:13 119
[PGP]lib32-alsa-plugins-1.2.2-1-x86_64.pkg.tar.zst.sig2020-02-22 05:13 119
[PGP]lib32-attr-2.5.1-1-x86_64.pkg.tar.zst.sig2021-03-17 05:17 119
[PGP]lib32-curl-7.76.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:16 119
[PGP]lib32-expat-2.3.0-2-x86_64.pkg.tar.zst.sig2021-04-08 06:14 119
[PGP]lib32-fluidsynth-2.1.8-1-x86_64.pkg.tar.zst.sig2021-03-17 05:17 119
[PGP]lib32-jack-0.125.0-3-x86_64.pkg.tar.zst.sig2020-04-07 06:13 119
[PGP]lib32-jack2-1.9.18-1-x86_64.pkg.tar.zst.sig2021-04-17 06:16 119
[PGP]lib32-keyutils-1.6.3-1-x86_64.pkg.tar.zst.sig2020-07-10 06:13 119
[PGP]lib32-libao-1.2.2-3-x86_64.pkg.tar.zst.sig2020-09-06 03:17 119
[PGP]lib32-libavtp-0.1.0-2-x86_64.pkg.tar.zst.sig2020-02-22 05:13 119
[PGP]lib32-libcap-2.49-1-x86_64.pkg.tar.zst.sig2021-03-16 05:19 119
[PGP]lib32-libcurl-compat-7.76.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:16 119
[PGP]lib32-libcurl-gnutls-7.76.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:16 119
[PGP]lib32-libelf-0.183-3-x86_64.pkg.tar.zst.sig2021-02-13 05:16 119
[PGP]lib32-libinstpatch-1.1.6-1-x86_64.pkg.tar.zst.sig2021-01-27 05:14 119
[PGP]lib32-libjpeg-turbo-2.0.6-1-x86_64.pkg.tar.zst.sig2020-11-21 05:16 119
[PGP]lib32-libnsl-1.3.0-2-x86_64.pkg.tar.zst.sig2021-04-13 06:14 119
[PGP]lib32-libpcap-1.10.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 119
[PGP]lib32-libpng-1.6.37-3-x86_64.pkg.tar.zst.sig2020-07-09 09:44 119
[PGP]lib32-libsamplerate-0.2.1-1-x86_64.pkg.tar.zst.sig2021-02-05 05:15 119
[PGP]lib32-libsndfile-1.0.31-1-x86_64.pkg.tar.zst.sig2021-02-05 05:15 119
[PGP]lib32-libusb-1.0.24-1-x86_64.pkg.tar.zst.sig2020-12-12 05:15 119
[PGP]lib32-libxcrypt-4.4.19-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 119
[PGP]lib32-portaudio-1:19.7.0-1-x86_64.pkg.tar.zst.sig2021-04-07 06:15 119
[PGP]lib32-sdl_image-1.2.12-7-x86_64.pkg.tar.zst.sig2020-11-21 05:16 119
[PGP]lib32-systemd-248-1-x86_64.pkg.tar.zst.sig2021-03-31 06:15 119
[PGP]lib32-util-linux-2.36.2-1-x86_64.pkg.tar.zst.sig2021-02-13 05:16 119
[PGP]libck-0.7.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]libcurl-compat-7.76.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:15 119
[PGP]libcurl-gnutls-7.76.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:15 119
[PGP]libdnet-1.12-13-x86_64.pkg.tar.zst.sig2020-12-31 05:14 119
[PGP]libfm-qt-0.17.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]libiodbc-3.52.14-1-x86_64.pkg.tar.zst.sig2021-03-30 06:17 119
[PGP]liblo-1:0.31-1-x86_64.pkg.tar.zst.sig2020-03-03 05:14 119
[PGP]liblxqt-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]liblxqt-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]libmupdf-1.18.0-2-x86_64.pkg.tar.zst.sig2021-03-19 05:17 119
[PGP]libmusicxml-3.18-1-x86_64.pkg.tar.zst.sig2020-01-17 05:13 119
[PGP]libopenshot-audio-0.2.0-1-x86_64.pkg.tar.zst.sig2020-03-05 05:13 119
[PGP]libpackagekit-glib-1.1.13-1-x86_64.pkg.tar.zst.sig2020-01-12 05:14 119
[PGP]libqtxdg-3.7.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]libsysstat-0.4.4-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]libsysstat-0.4.5-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]libtermkey-0.22-2-x86_64.pkg.tar.zst.sig2020-06-08 06:13 119
[PGP]lilv-0.24.12-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 119
[PGP]lilypond-2.22.0-2-x86_64.pkg.tar.zst.sig2021-01-17 02:49 119
[PGP]link-3.0.2-2-x86_64.pkg.tar.zst.sig2020-03-22 05:13 119
[PGP]liquidsfz-0.2.3-1-x86_64.pkg.tar.zst.sig2021-01-28 05:16 119
[PGP]livecd-sounds-1.0-1-any.pkg.tar.zst.sig2020-10-07 06:14 119
[PGP]lldpd-1.0.10-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 119
[PGP]lsp-plugins-1.1.30-1-x86_64.pkg.tar.zst.sig2021-04-02 06:13 119
[PGP]lv2-1.18.2-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 119
[PGP]lv2lint-0.12.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]lvtk-1.2.0-2-x86_64.pkg.tar.xz.sig2019-11-26 05:13 119
[PGP]lximage-qt-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lximage-qt-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-about-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-about-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-admin-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-admin-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-archiver-0.3.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-archiver-0.4.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-build-tools-0.8.0-1-any.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-build-tools-0.9.0-1-any.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-config-0.16.1-1-x86_64.pkg.tar.zst.sig2020-11-15 05:13 119
[PGP]lxqt-config-0.17.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-globalkeys-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-globalkeys-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-notificationd-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-notificationd-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-openssh-askpass-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-openssh-askpass-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-panel-0.16.1-2-x86_64.pkg.tar.zst.sig2021-04-11 06:15 119
[PGP]lxqt-panel-0.17.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-policykit-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-policykit-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-powermanagement-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-powermanagement-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-qtplugin-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-qtplugin-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-runner-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-runner-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-session-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-session-0.17.1-1-x86_64.pkg.tar.zst.sig2021-04-18 06:16 119
[PGP]lxqt-sudo-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-sudo-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]lxqt-themes-0.16.0-1-any.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]lxqt-themes-0.17.0-1-any.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]magma-2.5.4-3-x86_64.pkg.tar.zst.sig2021-04-18 06:14 119
[PGP]mailman3-3.3.3-1-any.pkg.tar.zst.sig2021-02-26 05:16 119
[PGP]mailman3-3.3.4-1-any.pkg.tar.zst.sig2021-03-23 05:13 119
[PGP]mako-1.4.1-2-x86_64.pkg.tar.zst.sig2020-09-06 03:15 119
[PGP]marsyas-0.5.0-8-x86_64.pkg.tar.zst.sig2021-03-02 05:13 119
[PGP]matrix-appservice-irc-0.25.0-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]mda.lv2-1.2.6-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 119
[PGP]mediathekview-13.7.1-1-any.pkg.tar.zst.sig2021-02-05 05:14 119
[PGP]mephisto.lv2-0.16.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]mftrace-1.2.20-3-x86_64.pkg.tar.zst.sig2021-02-11 05:13 119
[PGP]midi_matrix.lv2-0.24.0-1-x86_64.pkg.tar.zst.sig2020-04-14 06:13 119
[PGP]midi_matrix.lv2-0.28.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:50 119
[PGP]midimsg-lv2-0.0.5-1-x86_64.pkg.tar.xz.sig2019-12-29 05:13 119
[PGP]mkinitcpio-systemd-tool-36-1-any.pkg.tar.zst.sig2020-05-11 06:13 119
[PGP]molecule-3.3.0-1-any.pkg.tar.zst.sig2021-03-27 05:16 119
[PGP]moony.lv2-0.38.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]mpv-1:0.33.1-1-x86_64.pkg.tar.zst.sig2021-04-06 06:14 119
[PGP]msgpack-c-3.3.0-2-x86_64.pkg.tar.zst.sig2021-01-17 02:50 119
[PGP]multipath-tools-0.8.5-3-x86_64.pkg.tar.zst.sig2021-02-03 05:16 119
[PGP]mupdf-1.18.0-2-x86_64.pkg.tar.zst.sig2021-03-19 05:19 119
[PGP]mupdf-gl-1.18.0-2-x86_64.pkg.tar.zst.sig2021-03-19 05:20 119
[PGP]mupdf-tools-1.18.0-2-x86_64.pkg.tar.zst.sig2021-03-19 05:21 119
[PGP]mxml-3.2-1-x86_64.pkg.tar.zst.sig2020-10-11 06:13 119
[PGP]mysql-workbench-8.0.23-3-x86_64.pkg.tar.zst.sig2021-03-19 05:21 119
[PGP]mysql-workbench-8.0.23-4-x86_64.pkg.tar.zst.sig2021-04-20 06:14 119
[PGP]mysql-workbench-8.0.24-1-x86_64.pkg.tar.zst.sig2021-04-21 06:13 119
[PGP]mysql-workbench-8.0.24-2-x86_64.pkg.tar.zst.sig2021-04-21 06:14 119
[PGP]nbd-3.21-1-x86_64.pkg.tar.zst.sig2021-01-18 05:14 119
[PGP]nccl-2.9.6-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 119
[PGP]new-session-manager-1.5.1-1-x86_64.pkg.tar.zst.sig2021-03-20 05:14 119
[PGP]nextcloud-21.0.0-8-any.pkg.tar.zst.sig2021-02-24 05:15 119
[PGP]nextcloud-21.0.1-1-any.pkg.tar.zst.sig2021-04-10 06:13 119
[PGP]nextcloud-app-deck-1:1.4.0-1-any.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]nextcloud-app-news-15.3.2-1-any.pkg.tar.zst.sig2021-02-12 05:15 119
[PGP]nextcloud-app-spreed-1:11.2.0-1-any.pkg.tar.zst.sig2021-04-13 06:13 119
[PGP]nextcloud-client-cloudproviders-3.1.3-1-x86_64.pkg.tar.zst.sig2021-02-21 05:14 119
[PGP]nextcloud-client-cloudproviders-3.2.0-1-x86_64.pkg.tar.zst.sig2021-04-18 06:16 119
[PGP]nikola-8.1.2-2-any.pkg.tar.zst.sig2020-11-18 05:14 119
[PGP]nikola-8.1.3-1-any.pkg.tar.zst.sig2021-02-17 05:15 119
[PGP]ninjas2-0.2.0-2-x86_64.pkg.tar.zst.sig2020-10-18 06:13 119
[PGP]nlohmann-json-3.9.1-1-any.pkg.tar.zst.sig2020-08-07 06:13 119
[PGP]noise-repellent-0.1.5-2-x86_64.pkg.tar.xz.sig2020-01-04 05:13 119
[PGP]non-mixer-1.2.0-4-x86_64.pkg.tar.zst.sig2020-07-15 06:13 119
[PGP]non-sequencer-1.9.5-3-x86_64.pkg.tar.xz.sig2019-12-28 05:13 119
[PGP]non-timeline-1.2.0-4-x86_64.pkg.tar.zst.sig2020-07-15 06:13 119
[PGP]ntk-1.3.1000-5-x86_64.pkg.tar.xz.sig2019-12-28 05:13 119
[PGP]nuitka-0.6.9.6-4-any.pkg.tar.zst.sig2020-11-14 05:14 119
[PGP]nuitka-0.6.14.1-1-any.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]nvchecker-2.3-1-any.pkg.tar.zst.sig2021-03-20 05:14 119
[PGP]obconf-qt-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]obconf-qt-0.16.1-1-x86_64.pkg.tar.zst.sig2021-04-18 06:16 119
[PGP]ocaml-cairo-0.6.2-1-x86_64.pkg.tar.zst.sig2021-01-19 05:14 119
[PGP]ocaml-csexp-1.3.2-1-x86_64.pkg.tar.zst.sig2020-10-03 06:13 119
[PGP]ocaml-zarith-1.11-1-x86_64.pkg.tar.zst.sig2021-01-19 05:14 119
[PGP]open-iscsi-2.1.4-1-x86_64.pkg.tar.zst.sig2021-03-13 05:14 119
[PGP]open-isns-0.101-1-x86_64.pkg.tar.zst.sig2021-02-02 05:28 119
[PGP]openapi-generator-5.1.0-1-any.pkg.tar.zst.sig2021-03-23 05:14 119
[PGP]openbox-3.6.1-7-x86_64.pkg.tar.zst.sig2020-05-24 06:13 119
[PGP]oscpack-1.1.0-2-x86_64.pkg.tar.zst.sig2020-07-11 06:13 119
[PGP]osmid-0.8.0-1-x86_64.pkg.tar.zst.sig2020-09-23 06:13 119
[PGP]otf-cascadia-code-2102.25-1-any.pkg.tar.zst.sig2021-03-05 05:14 119
[PGP]packagekit-1.1.13-1-x86_64.pkg.tar.zst.sig2020-01-12 05:14 119
[PGP]pacredir-0.4.3-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]padthv1-0.9.21-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]patchage-1.0.4-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]patchmatrix-0.24.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]patroneo-2.1.0-1-x86_64.pkg.tar.zst.sig2021-02-17 05:15 119
[PGP]pavucontrol-qt-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]pavucontrol-qt-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]pcmanfm-qt-0.16.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]pcmanfm-qt-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]pcsclite-1.9.1-1-x86_64.pkg.tar.zst.sig2021-03-10 05:15 119
[PGP]pd-0.51.4-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]pd-lua-0.10.1-1-x86_64.pkg.tar.zst.sig2020-07-25 06:13 119
[PGP]perl-email-mime-contenttype-1.024-2-any.pkg.tar.zst.sig2020-10-11 06:13 119
[PGP]perl-text-unidecode-1.30-3-x86_64.pkg.tar.zst.sig2020-10-11 06:13 119
[PGP]pesign-113-1-x86_64.pkg.tar.zst.sig2020-05-19 06:13 119
[PGP]php-igbinary-3.2.1-2-x86_64.pkg.tar.zst.sig2021-01-17 02:57 119
[PGP]php-imagick-3.4.4.r66.g448c1cd-2-x86_64.pkg.tar.zst.sig2021-01-31 05:13 119
[PGP]php-redis-5.3.4-1-x86_64.pkg.tar.zst.sig2021-03-26 05:15 119
[PGP]php7-igbinary-3.2.1-2-x86_64.pkg.tar.zst.sig2021-01-17 02:57 119
[PGP]php7-imagick-3.4.4.r66.g448c1cd-2-x86_64.pkg.tar.zst.sig2021-01-31 05:13 119
[PGP]php7-redis-5.3.4-1-x86_64.pkg.tar.zst.sig2021-03-26 05:15 119
[PGP]picard-2.6.1-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]plowshare-2.1.7-6-any.pkg.tar.zst.sig2020-12-04 05:13 119
[PGP]polyphone-2.2.0-2-x86_64.pkg.tar.zst.sig2020-07-10 06:13 119
[PGP]postfixadmin-3.3.7-2-any.pkg.tar.zst.sig2021-02-28 05:16 119
[PGP]postfixadmin-3.3.8-1-any.pkg.tar.zst.sig2021-03-06 05:14 119
[PGP]postorius-1.3.4-1-any.pkg.tar.zst.sig2021-02-26 05:16 119
[PGP]profile-cleaner-2.41-1-any.pkg.tar.zst.sig2020-05-19 06:13 119
[PGP]profile-sync-daemon-6.44-1-any.pkg.tar.zst.sig2020-12-17 05:14 119
[PGP]pyenv-1.2.26-1-any.pkg.tar.zst.sig2021-04-07 06:14 119
[PGP]pythia8-8.3.04-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]python-aiobotocore-1.2.1-2-any.pkg.tar.zst.sig2021-03-01 05:14 119
[PGP]python-aiobotocore-1.3.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-aiosmtpd-1.4.2-1-any.pkg.tar.zst.sig2021-03-12 05:14 119
[PGP]python-antlr4-4.9.2-1-any.pkg.tar.zst.sig2021-03-16 05:14 119
[PGP]python-anyio-2.2.0-1-any.pkg.tar.zst.sig2021-02-28 05:15 119
[PGP]python-atpublic-2.3-1-any.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]python-autobahn-19.3.2-1-any.pkg.tar.xz.sig2019-03-23 05:14 119
[PGP]python-autobahn-21.3.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:16 119
[PGP]python-awkward-0.15.5-2-any.pkg.tar.zst.sig2021-03-11 05:14 119
[PGP]python-aws-sam-translator-1.31.0-2-any.pkg.tar.zst.sig2020-11-26 05:15 119
[PGP]python-aws-sam-translator-1.35.0-1-any.pkg.tar.zst.sig2021-03-16 05:14 119
[PGP]python-aws-xray-sdk-2.7.0-1-any.pkg.tar.zst.sig2021-03-27 05:16 119
[PGP]python-boost-histogram-0.12.0-2-x86_64.pkg.tar.zst.sig2021-02-16 05:17 119
[PGP]python-buildbot-badges-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]python-buildbot-badges-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-buildbot-console-view-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]python-buildbot-console-view-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-buildbot-grid-view-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]python-buildbot-grid-view-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-buildbot-pkg-2.6.0-1-any.pkg.tar.zst.sig2020-01-30 05:13 119
[PGP]python-buildbot-waterfall-view-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]python-buildbot-waterfall-view-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-buildbot-wsgi-dashboards-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]python-buildbot-wsgi-dashboards-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-buildbot-www-3.0.2-1-any.pkg.tar.zst.sig2021-03-18 05:17 119
[PGP]python-buildbot-www-3.1.0-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-cfn-lint-0.42.0-2-any.pkg.tar.zst.sig2020-11-26 05:15 119
[PGP]python-cfn-lint-0.48.3-1-any.pkg.tar.zst.sig2021-04-18 06:15 119
[PGP]python-cpplint-1.5.4-1-any.pkg.tar.zst.sig2020-09-27 06:13 119
[PGP]python-diff-cover-4.1.1-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-django-allauth-0.44.0-1-any.pkg.tar.zst.sig2020-11-29 05:13 119
[PGP]python-django-crispy-forms-1.10.0-2-any.pkg.tar.zst.sig2020-11-19 05:13 119
[PGP]python-django-crispy-forms-1.11.2-1-any.pkg.tar.zst.sig2021-03-23 05:14 119
[PGP]python-django-mailman3-1.3.5-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-django-rest-framework-3.12.4-1-any.pkg.tar.zst.sig2021-04-02 06:13 119
[PGP]python-enrich-1.2.6-1-any.pkg.tar.zst.sig2020-12-21 05:13 119
[PGP]python-fastnumbers-3.1.0-2-x86_64.pkg.tar.zst.sig2020-11-22 05:14 119
[PGP]python-fido2-0.9.1-1-any.pkg.tar.zst.sig2021-03-30 06:18 119
[PGP]python-flatbuffers-1.10.0-1-any.pkg.tar.xz.sig2019-03-31 06:13 119
[PGP]python-flufl-lock-5.0.5-1-any.pkg.tar.zst.sig2021-02-17 05:15 119
[PGP]python-flufl.bounce-3.0.2-1-any.pkg.tar.zst.sig2021-02-11 05:13 119
[PGP]python-flufl.i18n-3.1.5-1-any.pkg.tar.zst.sig2021-02-17 05:15 119
[PGP]python-furl-2.1.2-1-any.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]python-geopy-2.1.0-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-gilt-1.2.2-1-any.pkg.tar.zst.sig2020-03-19 05:13 119
[PGP]python-gitdb-1:4.0.7-1-any.pkg.tar.zst.sig2021-03-27 05:16 119
[PGP]python-gitpython-3.1.14-1-any.pkg.tar.zst.sig2021-03-01 05:14 119
[PGP]python-gnupg-0.4.7-1-any.pkg.tar.zst.sig2021-03-12 05:14 119
[PGP]python-histoprint-1.6.0-1-any.pkg.tar.zst.sig2021-02-11 05:14 119
[PGP]python-hsluv-5.0.2-1-any.pkg.tar.zst.sig2021-03-05 05:14 119
[PGP]python-identify-2.1.0-2-any.pkg.tar.zst.sig2021-03-05 05:17 119
[PGP]python-importlib_resources-5.1.2-1-any.pkg.tar.zst.sig2021-03-06 05:14 119
[PGP]python-inflect-5.0.2-2-any.pkg.tar.zst.sig2020-11-18 05:14 119
[PGP]python-inflect-5.3.0-1-any.pkg.tar.zst.sig2021-03-05 05:14 119
[PGP]python-ipy-1.01-1-any.pkg.tar.zst.sig2020-12-04 05:13 119
[PGP]python-jsondiff-1.2.0-6-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-keras-applications-1.0.8-6-any.pkg.tar.zst.sig2021-01-26 05:13 119
[PGP]python-keras-preprocessing-1.1.2-4-any.pkg.tar.zst.sig2021-01-26 05:13 119
[PGP]python-lazr.config-2.2.3-1-any.pkg.tar.zst.sig2021-01-27 05:13 119
[PGP]python-linux-procfs-0.6.3-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-ly-0.9.7-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-mailmanclient-3.3.2-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-micawber-0.5.3-1-any.pkg.tar.zst.sig2021-03-05 05:14 119
[PGP]python-moto-2.0.0-1-any.pkg.tar.zst.sig2021-02-28 05:16 119
[PGP]python-moto-2.0.5-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-natsort-7.1.0-2-any.pkg.tar.zst.sig2020-11-22 05:14 119
[PGP]python-natsort-7.1.1-1-any.pkg.tar.zst.sig2021-01-26 05:13 119
[PGP]python-nose2-0.10.0-1-any.pkg.tar.zst.sig2021-02-01 05:13 119
[PGP]python-orjson-3.5.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]python-pg8000-1.19.2-1-any.pkg.tar.zst.sig2021-04-12 06:13 119
[PGP]python-pproxy-2.4.6-2-any.pkg.tar.zst.sig2020-11-15 05:14 119
[PGP]python-pproxy-2.7.7-1-any.pkg.tar.zst.sig2021-03-27 05:16 119
[PGP]python-prctl-1.8.1-1-x86_64.pkg.tar.zst.sig2021-03-05 05:14 119
[PGP]python-pybtex-0.24.0-1-any.pkg.tar.zst.sig2021-01-26 05:13 119
[PGP]python-pybtex-docutils-1.0.0-1-any.pkg.tar.zst.sig2021-03-16 05:14 119
[PGP]python-pymediainfo-5.0.2-2-any.pkg.tar.zst.sig2020-11-21 05:16 119
[PGP]python-pymediainfo-5.0.3-1-any.pkg.tar.zst.sig2020-11-29 05:13 119
[PGP]python-pymediainfo-5.0.4-1-any.pkg.tar.zst.sig2021-04-13 06:13 119
[PGP]python-pymysql-1.0.2-1-any.pkg.tar.zst.sig2021-01-17 02:52 119
[PGP]python-pynamodb-5.0.0-1-any.pkg.tar.zst.sig2021-01-30 05:14 119
[PGP]python-pynamodb-5.0.3-1-any.pkg.tar.zst.sig2021-02-21 05:14 119
[PGP]python-pynitrokey-0.4.2-1-any.pkg.tar.zst.sig2021-03-02 05:14 119
[PGP]python-pyphen-0.10.0-1-any.pkg.tar.zst.sig2020-12-09 05:15 119
[PGP]python-pypugjs-5.9.6-2-any.pkg.tar.zst.sig2020-11-27 05:14 119
[PGP]python-pypugjs-5.9.9-1-any.pkg.tar.zst.sig2021-03-03 05:16 119
[PGP]python-pyscard-2.0.0-2-x86_64.pkg.tar.zst.sig2020-11-26 05:15 119
[PGP]python-pytest-metadata-1.11.0-1-any.pkg.tar.zst.sig2020-11-29 05:13 119
[PGP]python-pytest-subtesthack-0.1.2-1-any.pkg.tar.zst.sig2021-03-05 05:14 119
[PGP]python-pytest-testinfra-6.2.0-1-any.pkg.tar.zst.sig2021-03-20 05:15 119
[PGP]python-pythia8-8.3.04-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 119
[PGP]python-scramp-1.4.0-1-any.pkg.tar.zst.sig2021-03-30 06:18 119
[PGP]python-smmap-1:4.0.0-1-any.pkg.tar.zst.sig2021-02-03 05:14 119
[PGP]python-snappy-0.6.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:53 119
[PGP]python-sphinx-autoapi-1.8.0-1-any.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]python-sphinx-click-2.7.1-1-any.pkg.tar.zst.sig2021-03-23 05:15 119
[PGP]python-sphinxcontrib-bibtex-2.2.0-1-any.pkg.tar.zst.sig2021-03-16 05:15 119
[PGP]python-sshpubkeys-3.3.1-1-any.pkg.tar.zst.sig2021-02-06 05:14 119
[PGP]python-structlog-21.1.0-1-any.pkg.tar.zst.sig2021-02-21 05:14 119
[PGP]python-subprocess-tee-0.3.0-1-any.pkg.tar.zst.sig2021-04-13 06:13 119
[PGP]python-tabulate-0.8.9-1-any.pkg.tar.zst.sig2021-02-25 05:18 119
[PGP]python-testinfra-5.3.1-1-any.pkg.tar.zst.sig2020-09-06 03:16 119
[PGP]python-txaio-21.2.1-1-any.pkg.tar.zst.sig2021-03-03 05:16 119
[PGP]python-unidiff-0.6.0-3-any.pkg.tar.zst.sig2021-04-11 06:15 119
[PGP]python-uproot-3.14.4-1-any.pkg.tar.zst.sig2021-03-11 05:14 119
[PGP]python-uproot-docs-3.14.4-1-any.pkg.tar.zst.sig2021-03-11 05:14 119
[PGP]python-uproot-methods-0.10.0-1-any.pkg.tar.zst.sig2021-03-11 05:14 119
[PGP]python-utils-2.5.6-1-any.pkg.tar.zst.sig2021-02-05 05:14 119
[PGP]python-xxhash-2.0.2-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]python-zita-audiotools-1.0.0-8-x86_64.pkg.tar.zst.sig2021-02-19 05:15 119
[PGP]python-zita-jacktools-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-19 05:15 119
[PGP]python-zopfli-0.1.8-1-x86_64.pkg.tar.zst.sig2021-03-23 05:15 119
[PGP]python2-kitchen-1.2.5-3-any.pkg.tar.xz.sig2019-01-10 05:14 119
[PGP]python2-klein-17.10.0-2-any.pkg.tar.xz.sig2018-11-19 05:13 119
[PGP]qastools-0.23.0-1-x86_64.pkg.tar.zst.sig2020-06-19 06:13 119
[PGP]qjackctl-0.9.2-2-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]qmidiarp-0.6.5-5-x86_64.pkg.tar.zst.sig2021-02-05 05:14 119
[PGP]qmidictl-0.9.2-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]qmidinet-0.9.2-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]qsynth-0.9.2-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]qterminal-0.16.1-1-x86_64.pkg.tar.zst.sig2020-11-15 05:13 119
[PGP]qterminal-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]qtermwidget-0.17.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:16 119
[PGP]qtile-0.17.0-1-x86_64.pkg.tar.zst.sig2021-02-18 05:14 119
[PGP]qtractor-0.9.21-1-x86_64.pkg.tar.zst.sig2021-03-20 05:15 119
[PGP]qxgedit-0.9.2-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]radcli-1.2.12-1-x86_64.pkg.tar.zst.sig2020-10-03 06:13 119
[PGP]radeontop-1.3-2-x86_64.pkg.tar.zst.sig2021-01-29 05:15 119
[PGP]rawtherapee-1:5.8-1-x86_64.pkg.tar.zst.sig2020-02-06 05:13 119
[PGP]rbutil-1.4.1.r381.g94eb1df58b-1-x86_64.pkg.tar.zst.sig2020-10-18 06:13 119
[PGP]redkite-1.3.0-1-x86_64.pkg.tar.zst.sig2020-12-19 05:14 119
[PGP]root-6.24.00-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]rosegarden-20.12-1-x86_64.pkg.tar.zst.sig2020-12-10 05:14 119
[PGP]rt-tests-1.10-1-x86_64.pkg.tar.zst.sig2021-01-17 02:54 119
[PGP]rtaudio-5.1.0-3-x86_64.pkg.tar.xz.sig2019-12-25 05:13 119
[PGP]rtirq-20210329-1-any.pkg.tar.zst.sig2021-04-02 06:13 119
[PGP]rtmidi-4.0.0-2-x86_64.pkg.tar.xz.sig2019-11-23 05:13 119
[PGP]rubberband-1.9.1-1-x86_64.pkg.tar.zst.sig2021-03-13 05:14 119
[PGP]samplv1-0.9.21-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]sc3-plugins-3.11.1-1-x86_64.pkg.tar.zst.sig2020-11-18 05:13 119
[PGP]scdoc-1.11.1-2-x86_64.pkg.tar.zst.sig2021-03-21 05:14 119
[PGP]screengrab-2.1.0-1-x86_64.pkg.tar.zst.sig2020-11-06 05:14 119
[PGP]screengrab-2.2.0-1-x86_64.pkg.tar.zst.sig2021-04-17 06:16 119
[PGP]sdl_image-1.2.12-7-x86_64.pkg.tar.zst.sig2021-02-27 05:13 119
[PGP]serd-0.30.10-1-x86_64.pkg.tar.zst.sig2021-01-22 05:13 119
[PGP]setbfree-0.8.11-2-x86_64.pkg.tar.zst.sig2020-10-18 06:13 119
[PGP]sfizz-1.0.0-1-x86_64.pkg.tar.zst.sig2021-04-18 06:15 119
[PGP]sherlock.lv2-0.28.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]shim-15-5-any.pkg.tar.zst.sig2020-09-30 06:13 119
[PGP]smplayer-skins-1:20.11.0-1-any.pkg.tar.zst.sig2020-11-18 05:13 119
[PGP]snd-21.3-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]solaar-1.0.5-2-any.pkg.tar.zst.sig2021-03-01 05:14 119
[PGP]solr-8.4.1-1-any.pkg.tar.zst.sig2020-02-01 05:13 119
[PGP]solr-8.8.2-1-any.pkg.tar.zst.sig2021-04-14 06:15 119
[PGP]sonic-visualiser-4.3-2-x86_64.pkg.tar.zst.sig2021-03-13 05:14 119
[PGP]sorcer-1.1.3-3-x86_64.pkg.tar.zst.sig2020-05-22 06:13 119
[PGP]sord-0.16.8-1-x86_64.pkg.tar.zst.sig2021-01-17 02:55 119
[PGP]sox-14.4.2-7-x86_64.pkg.tar.zst.sig2020-08-20 06:13 119
[PGP]spdlog-1.3.1-3-any.pkg.tar.xz.sig2019-07-16 06:13 119
[PGP]spdlog-1.8.5-1-x86_64.pkg.tar.zst.sig2021-03-27 05:17 119
[PGP]spectmorph-0.5.2-1-x86_64.pkg.tar.zst.sig2020-09-22 06:13 119
[PGP]sratom-0.6.8-1-x86_64.pkg.tar.zst.sig2021-01-17 02:55 119
[PGP]stk-4.6.1-3-x86_64.pkg.tar.zst.sig2020-07-10 06:13 119
[PGP]suil-0.10.10-1-x86_64.pkg.tar.zst.sig2021-01-17 02:55 119
[PGP]surge-1.8.1-1-x86_64.pkg.tar.zst.sig2021-03-01 05:14 119
[PGP]swayidle-1.6-1-x86_64.pkg.tar.zst.sig2020-01-23 05:14 119
[PGP]swaylock-1.5-1-x86_64.pkg.tar.zst.sig2020-01-23 05:14 119
[PGP]synthv1-0.9.21-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 119
[PGP]t1utils-1.42-1-x86_64.pkg.tar.zst.sig2020-10-28 05:13 119
[PGP]tap-plugins-1.0.1-1-x86_64.pkg.tar.zst.sig2020-08-03 06:13 119
[PGP]tcplay-3.3-2-x86_64.pkg.tar.zst.sig2021-02-03 05:16 119
[PGP]tensorboard-2.4.1-1-x86_64.pkg.tar.zst.sig2021-01-26 05:13 119
[PGP]terminus-font-otb-4.49-2-any.pkg.tar.zst.sig2020-12-27 05:13 119
[PGP]terraform-provider-libvirt-0.6.3-3-x86_64.pkg.tar.zst.sig2021-03-26 05:15 119
[PGP]texlab-2.2.2-1-x86_64.pkg.tar.zst.sig2021-01-19 05:14 119
[PGP]tig-2.5.3-1-x86_64.pkg.tar.zst.sig2021-03-10 05:15 119
[PGP]timidity++-2.15.0-5-x86_64.pkg.tar.zst.sig2020-12-04 05:14 119
[PGP]tmate-2.4.0-2-x86_64.pkg.tar.zst.sig2020-12-31 05:14 119
[PGP]tmux-3.2-1-x86_64.pkg.tar.zst.sig2021-04-14 06:15 119
[PGP]tmuxp-1.6.3-2-any.pkg.tar.zst.sig2020-11-23 05:14 119
[PGP]tmuxp-1.7.2-1-any.pkg.tar.zst.sig2021-02-05 05:14 119
[PGP]ttf-arphic-ukai-0.2.20080216.2-1-any.pkg.tar.zst.sig2020-11-30 05:13 119
[PGP]ttf-arphic-uming-0.2.20080216.2-1-any.pkg.tar.zst.sig2020-11-30 05:13 119
[PGP]ttf-baekmuk-2.2-10-any.pkg.tar.xz.sig2019-03-29 05:16 119
[PGP]ttf-cascadia-code-2102.25-1-any.pkg.tar.zst.sig2021-03-05 05:16 119
[PGP]ttf-indic-otf-0.2-9-any.pkg.tar.xz.sig2019-01-15 05:13 119
[PGP]ttf-ionicons-5.5.1-1-any.pkg.tar.zst.sig2021-03-24 05:20 119
[PGP]ttf-khmer-5.0-6-any.pkg.tar.xz.sig2019-03-29 05:16 119
[PGP]ttf-sazanami-20040629-10-any.pkg.tar.xz.sig2019-03-29 05:16 119
[PGP]ttf-tibetan-machine-1.901-8-any.pkg.tar.xz.sig2019-03-29 05:16 119
[PGP]twolame-0.4.0-2-x86_64.pkg.tar.xz.sig2019-11-14 05:13 119
[PGP]udftools-2.3-1-x86_64.pkg.tar.zst.sig2021-01-17 02:55 119
[PGP]umurmur-0.2.20-1-x86_64.pkg.tar.zst.sig2021-03-23 05:16 119
[PGP]unbound-1.13.1-1-x86_64.pkg.tar.zst.sig2021-02-12 05:15 119
[PGP]unibilium-2.1.0-2-x86_64.pkg.tar.zst.sig2020-06-08 06:13 119
[PGP]uriparser-0.9.4-1-x86_64.pkg.tar.zst.sig2020-06-07 21:39 119
[PGP]vamp-plugin-sdk-2.10.0-1-x86_64.pkg.tar.zst.sig2020-05-19 06:13 119
[PGP]vico-1.2.2-2-x86_64.pkg.tar.zst.sig2021-02-09 05:19 119
[PGP]vim-ansible-3.0-1-any.pkg.tar.zst.sig2020-07-15 06:13 119
[PGP]vim-coverage-highlight-3.4-1-any.pkg.tar.zst.sig2021-04-07 06:14 119
[PGP]vim-csound-0.8.1-1-any.pkg.tar.zst.sig2020-03-03 05:14 119
[PGP]vim-editorconfig-1.1.1-1-any.pkg.tar.zst.sig2020-06-07 21:39 119
[PGP]vis-0.7-2-x86_64.pkg.tar.zst.sig2021-03-26 05:15 119
[PGP]vm.lv2-0.14.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 119
[PGP]vmpk-0.8.2-1-x86_64.pkg.tar.zst.sig2021-04-02 06:13 119
[PGP]vst3sdk-3.7.0_build_116-1-x86_64.pkg.tar.zst.sig2020-11-01 05:13 119
[PGP]vst3sdk-examples-3.7.0_build_116-1-x86_64.pkg.tar.zst.sig2020-11-01 05:13 119
[PGP]waf-2.0.22-1-any.pkg.tar.zst.sig2021-02-01 05:15 119
[PGP]wakatime-13.1.0-1-any.pkg.tar.zst.sig2021-03-16 05:16 119
[PGP]waylock-0.3.3-2-x86_64.pkg.tar.zst.sig2021-02-18 05:14 119
[PGP]web-ext-6.0.0-1-any.pkg.tar.zst.sig2021-03-12 05:14 119
[PGP]wf-recorder-0.2.1-1-x86_64.pkg.tar.zst.sig2020-06-19 06:13 119
[PGP]wiiuse-0.15.5-1-x86_64.pkg.tar.xz.sig2019-11-25 05:13 119
[PGP]wimlib-1.13.3-1-x86_64.pkg.tar.zst.sig2020-11-15 05:14 119
[PGP]wireplumber-0.3.0-1-x86_64.pkg.tar.zst.sig2020-07-20 06:13 119
[PGP]woff2-cascadia-code-2102.25-1-any.pkg.tar.zst.sig2021-03-05 05:16 119
[PGP]wolf-shaper-0.1.8-1-x86_64.pkg.tar.zst.sig2020-10-03 06:13 119
[PGP]x42-plugins-20210409-1-x86_64.pkg.tar.zst.sig2021-04-13 06:14 119
[PGP]xcur2png-0.7.1-7-x86_64.pkg.tar.zst.sig2020-06-07 21:39 119
[PGP]xcursor-comix-0.9.2-1-any.pkg.tar.zst.sig2020-06-20 06:15 119
[PGP]xfce4-whiskermenu-plugin-2.5.3-1-x86_64.pkg.tar.zst.sig2021-01-25 05:14 119
[PGP]xjadeo-0.8.10-1-x86_64.pkg.tar.zst.sig2021-01-17 02:56 119
[PGP]xmonk.lv2-0.4-1-x86_64.pkg.tar.xz.sig2019-12-04 05:13 119
[PGP]xonotic-0.8.2-6-x86_64.pkg.tar.zst.sig2020-11-21 05:14 119
[PGP]xrootd-5.1.1-1-x86_64.pkg.tar.zst.sig2021-03-16 05:16 119
[PGP]xrootd4-4.12.6-1-x86_64.pkg.tar.zst.sig2021-02-01 05:15 119
[PGP]xwax-1.7-2-x86_64.pkg.tar.xz.sig2019-11-24 05:13 119
[PGP]yad-9.3-1-x86_64.pkg.tar.zst.sig2021-04-14 06:15 119
[PGP]yaml-cpp-0.6.3-2-x86_64.pkg.tar.zst.sig2020-01-19 05:13 119
[PGP]yodl-4.02.02-2-x86_64.pkg.tar.zst.sig2021-01-17 02:56 119
[PGP]yoshimi-2.0-1-x86_64.pkg.tar.zst.sig2021-03-02 05:14 119
[PGP]yubico-c-client-2.15-5-x86_64.pkg.tar.zst.sig2020-04-16 06:13 119
[PGP]yubikey-personalization-gui-3.1.25-2-x86_64.pkg.tar.zst.sig2020-01-12 05:15 119
[PGP]zam-plugins-3.14-1-x86_64.pkg.tar.zst.sig2020-12-21 05:15 119
[PGP]zita-ajbridge-0.8.4-1-x86_64.pkg.tar.zst.sig2020-04-07 06:13 119
[PGP]zita-convolver-4.0.3-2-x86_64.pkg.tar.xz.sig2019-12-16 05:13 119
[PGP]zita-jclient-0.4.2-3-x86_64.pkg.tar.zst.sig2021-02-19 05:15 119
[PGP]zita-njbridge-0.4.8-1-x86_64.pkg.tar.zst.sig2021-04-17 06:15 119
[PGP]zopfli-1.0.3-2-x86_64.pkg.tar.zst.sig2021-03-16 05:16 119
[PGP]zsh-autosuggestions-0.6.4-1-any.pkg.tar.zst.sig2020-01-12 05:15 119
[PGP]zsh-history-substring-search-1.0.2-1-any.pkg.tar.xz.sig2019-10-28 05:13 119
[PGP]arp-scan-1.9.7-1-x86_64.pkg.tar.xz.sig2019-11-12 05:13 127
[PGP]percona-toolkit-3.0.13-1-any.pkg.tar.xz.sig2019-02-19 05:13 128
[PGP]python2-augeas-0.5.0-2-any.pkg.tar.xz.sig2018-05-31 10:21 128
[PGP]qpress-1.1-3-x86_64.pkg.tar.xz.sig2018-05-31 10:20 128
[PGP]xfmpc-0.3.0-4-x86_64.pkg.tar.zst.sig2020-11-29 05:13 134
[PGP]adobe-source-han-serif-cn-fonts-1.001-4-any.pkg.tar.zst.sig2021-03-29 06:17 141
[PGP]adobe-source-han-serif-jp-fonts-1.001-4-any.pkg.tar.zst.sig2021-03-29 06:18 141
[PGP]adobe-source-han-serif-kr-fonts-1.001-4-any.pkg.tar.zst.sig2021-03-29 06:18 141
[PGP]adobe-source-han-serif-otc-fonts-1.001-4-any.pkg.tar.zst.sig2021-03-29 06:19 141
[PGP]adobe-source-han-serif-tw-fonts-1.001-4-any.pkg.tar.zst.sig2021-03-29 06:20 141
[PGP]almanah-0.12.3-2-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]caribou-0.4.21+66+g14f5428-3-x86_64.pkg.tar.zst.sig2021-01-17 02:37 141
[PGP]cdemu-client-3.2.4-2-any.pkg.tar.zst.sig2021-03-13 05:13 141
[PGP]cdemu-client-3.2.5-1-any.pkg.tar.zst.sig2021-04-20 06:13 141
[PGP]cdemu-daemon-3.2.5-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 141
[PGP]deepin-mutter-3.20.38-5-x86_64.pkg.tar.zst.sig2021-04-02 06:13 141
[PGP]dina-font-2.92-10-any.pkg.tar.zst.sig2021-03-29 06:20 141
[PGP]dvdstyler-3.1.2-3-x86_64.pkg.tar.zst.sig2021-02-02 05:26 141
[PGP]evolution-rss-0.3.96-4-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]fractal-4.4.0-2-x86_64.pkg.tar.zst.sig2020-10-03 06:13 141
[PGP]glabels-3.4.1-8-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]gnome-applets-3.40.0-1-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]gnome-code-assistance-2:3.16.1+14+gaad6437-1-x86_64.pkg.tar.zst.sig2021-02-25 05:18 141
[PGP]gnome-games-40.0-1-x86_64.pkg.tar.zst.sig2021-03-26 05:13 141
[PGP]gnome-initial-setup-40.0-1-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]gnome-latex-3.38.0+13+g703c2c9-1-x86_64.pkg.tar.zst.sig2021-03-26 05:13 141
[PGP]gnome-panel-3.40.0-1-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]gnome-phone-manager-0.69-16-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]jruby-9.2.17.0-1-any.pkg.tar.zst.sig2021-03-31 06:14 141
[PGP]lib32-cairo-1.17.4-5-x86_64.pkg.tar.zst.sig2021-03-17 05:17 141
[PGP]lib32-colord-1.4.5-2-x86_64.pkg.tar.zst.sig2021-03-17 05:17 141
[PGP]lib32-dbus-1.12.20-1-x86_64.pkg.tar.zst.sig2020-07-09 09:44 141
[PGP]lib32-fontconfig-2:2.13.93-4-x86_64.pkg.tar.zst.sig2021-03-25 05:15 141
[PGP]lib32-freetype2-2.10.4-1-x86_64.pkg.tar.zst.sig2020-10-21 06:13 141
[PGP]lib32-fribidi-1.0.10-1-x86_64.pkg.tar.zst.sig2020-07-09 09:44 141
[PGP]lib32-gdk-pixbuf2-2.42.6-1-x86_64.pkg.tar.zst.sig2021-04-10 06:14 141
[PGP]lib32-glib2-2.68.1-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 141
[PGP]lib32-gtk3-3.24.27-2-x86_64.pkg.tar.zst.sig2021-03-18 05:17 141
[PGP]lib32-json-c-0.15-1-x86_64.pkg.tar.zst.sig2020-07-30 06:14 141
[PGP]lib32-libcaca-0.99.beta19-4-x86_64.pkg.tar.zst.sig2021-03-19 05:23 141
[PGP]lib32-libepoxy-1.5.5-1-x86_64.pkg.tar.zst.sig2020-12-23 05:15 141
[PGP]lib32-libpulse-14.2-2-x86_64.pkg.tar.zst.sig2021-01-21 05:13 141
[PGP]lib32-librsvg-2.50.4-1-x86_64.pkg.tar.zst.sig2021-04-14 06:15 141
[PGP]lib32-libvorbis-1.3.7-1-x86_64.pkg.tar.zst.sig2020-07-09 09:44 141
[PGP]lib32-libwebp-1.2.0-1-x86_64.pkg.tar.zst.sig2021-02-04 05:16 141
[PGP]lib32-nspr-4.30-1-x86_64.pkg.tar.zst.sig2021-03-18 05:17 141
[PGP]lib32-nss-3.64-1-x86_64.pkg.tar.zst.sig2021-04-17 06:16 141
[PGP]lib32-openal-1.21.1-1-x86_64.pkg.tar.zst.sig2021-02-26 05:16 141
[PGP]lib32-p11-kit-0.23.22-1-x86_64.pkg.tar.zst.sig2020-12-13 05:20 141
[PGP]lib32-pango-1:1.48.4-1-x86_64.pkg.tar.zst.sig2021-03-28 06:16 141
[PGP]libavif-0.9.0-2-x86_64.pkg.tar.zst.sig2021-04-07 06:15 141
[PGP]libgda-5.2.10-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 141
[PGP]libgda-firebird-5.2.10-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 141
[PGP]libgda-jdbc-5.2.10-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 141
[PGP]libgda-mysql-5.2.10-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 141
[PGP]libgda-postgres-5.2.10-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 141
[PGP]libgexiv2-0.12.2-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 141
[PGP]libmirage-3.2.5-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 141
[PGP]mutter6-3.36.8-2-x86_64.pkg.tar.zst.sig2021-04-02 06:13 141
[PGP]netfilter-fullconenat-r73.0cf3b48-107-x86_64.pkg.tar.zst.sig2021-04-17 06:15 141
[PGP]pantheon-calendar-5.1.1-3-x86_64.pkg.tar.zst.sig2021-04-02 06:14 141
[PGP]powerline-2.8.2-2-x86_64.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]powerline-common-2.8.2-2-x86_64.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]powerline-fonts-2.8.2-2-x86_64.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]powerline-vim-2.8.2-2-x86_64.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]python-powerline-2.8.2-2-x86_64.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]retro-gtk-1.0.2-1-x86_64.pkg.tar.zst.sig2021-03-25 05:15 141
[PGP]rtl-sdr-1:0.8.0-3-x86_64.pkg.tar.zst.sig2021-02-24 05:14 141
[PGP]sbxkb-0.7.6-5-x86_64.pkg.tar.zst.sig2020-11-10 05:13 141
[PGP]sdl_mixer-1.2.12-9-x86_64.pkg.tar.zst.sig2021-02-27 05:13 141
[PGP]simple-scan-40.0-1-x86_64.pkg.tar.zst.sig2021-03-26 05:15 141
[PGP]terminus-font-4.49.1-2-any.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]transcode-1.1.7-37-x86_64.pkg.tar.zst.sig2021-02-02 05:28 141
[PGP]ttf-droid-20121017-10-any.pkg.tar.zst.sig2021-03-26 05:15 141
[PGP]ttf-inconsolata-1:3.000-3-any.pkg.tar.zst.sig2021-03-29 06:23 141
[PGP]valabind-1.8.0-1-x86_64.pkg.tar.zst.sig2021-03-18 05:17 141
[PGP]wine-mono-6.1.1-1-any.pkg.tar.zst.sig2021-04-11 06:15 141
[PGP]wqy-bitmapfont-1.0.0RC1-5-any.pkg.tar.zst.sig2021-03-29 06:24 141
[PGP]wqy-microhei-0.2.0_beta-11-any.pkg.tar.zst.sig2021-03-29 06:24 141
[PGP]wqy-zenhei-0.9.45-9-any.pkg.tar.zst.sig2021-03-29 06:24 141
[PGP]xine-lib-1.2.11-4-x86_64.pkg.tar.zst.sig2021-04-07 06:15 141
[PGP]alltray-0.7.5.1dev-6-x86_64.pkg.tar.zst.sig2020-10-07 06:13 215
[PGP]ansible-lint-5.0.0-1-any.pkg.tar.zst.sig2021-02-10 05:14 215
[PGP]ansible-lint-5.0.7-2-any.pkg.tar.zst.sig2021-04-09 06:13 215
[PGP]at-3.2.1-3-x86_64.pkg.tar.zst.sig2020-10-07 06:13 215
[PGP]ctop-0.7.5-3-x86_64.pkg.tar.zst.sig2021-02-22 05:13 215
[PGP]datamash-1.7-1-x86_64.pkg.tar.zst.sig2020-10-18 06:13 215
[PGP]ecb-2.40.1pre-12-any.pkg.tar.zst.sig2020-10-08 06:13 215
[PGP]exfatprogs-1.1.0-1-x86_64.pkg.tar.zst.sig2021-02-10 05:14 215
[PGP]fcgiwrap-1.1.0-8-x86_64.pkg.tar.zst.sig2020-10-07 06:13 215
[PGP]fetchmail-6.4.18-1-x86_64.pkg.tar.zst.sig2021-03-28 06:13 215
[PGP]i3status-rust-0.14.7-1-x86_64.pkg.tar.zst.sig2021-02-16 05:14 215
[PGP]imapsync-1.977-1-any.pkg.tar.zst.sig2020-11-30 05:13 215
[PGP]intel-undervolt-1.7-2-x86_64.pkg.tar.zst.sig2020-07-09 09:40 215
[PGP]ispin-6.5.0-2-any.pkg.tar.zst.sig2020-07-09 09:40 215
[PGP]libaxc-0.3.4-2-x86_64.pkg.tar.zst.sig2021-02-14 05:17 215
[PGP]libkeccak-1.2-2-x86_64.pkg.tar.zst.sig2020-07-09 09:40 215
[PGP]libomemo-0.7.1-3-x86_64.pkg.tar.zst.sig2021-04-08 06:14 215
[PGP]libopenraw-0.3.0-1-x86_64.pkg.tar.zst.sig2020-12-19 05:16 215
[PGP]libpurple-lurch-0.7.0-1-x86_64.pkg.tar.zst.sig2021-02-14 05:18 215
[PGP]lxappearance-0.6.3-4-x86_64.pkg.tar.zst.sig2020-10-07 06:14 215
[PGP]lxappearance-gtk3-0.6.3-4-x86_64.pkg.tar.zst.sig2020-10-07 06:14 215
[PGP]otf-hermit-2.0-2-any.pkg.tar.zst.sig2020-07-09 09:40 215
[PGP]perl-encode-imaputf7-1.05-4-any.pkg.tar.zst.sig2020-11-30 05:13 215
[PGP]perl-json-webtoken-0.10-5-any.pkg.tar.zst.sig2020-10-31 05:13 215
[PGP]perl-mail-imapclient-3.43-1-any.pkg.tar.zst.sig2021-02-17 05:15 215
[PGP]perl-ntlm-1.09-5-any.pkg.tar.zst.sig2020-10-31 05:13 215
[PGP]perl-par-1.017-1-any.pkg.tar.zst.sig2021-01-17 02:52 215
[PGP]perl-par-packer-1.052-2-x86_64.pkg.tar.zst.sig2021-02-16 05:14 215
[PGP]perl-sys-meminfo-0.99-2-x86_64.pkg.tar.zst.sig2020-10-31 05:13 215
[PGP]perl-test-mock-guard-0.10-3-any.pkg.tar.zst.sig2020-10-31 05:13 215
[PGP]perl-unicode-string-2.10-4-x86_64.pkg.tar.zst.sig2020-10-31 05:13 215
[PGP]python-bracex-2.1.1-1-any.pkg.tar.zst.sig2021-02-10 05:13 215
[PGP]python-rich-10.0.1-1-any.pkg.tar.zst.sig2021-03-31 06:15 215
[PGP]python-rich-10.1.0-2-any.pkg.tar.zst.sig2021-04-09 06:14 215
[PGP]python-wcmatch-8.1.2-1-any.pkg.tar.zst.sig2021-03-12 05:14 215
[PGP]qpdfview-0.4.18-2-x86_64.pkg.tar.zst.sig2020-09-15 06:13 215
[PGP]raw-thumbnailer-0.2.1-7-x86_64.pkg.tar.zst.sig2020-12-19 05:16 215
[PGP]redis-6.2.1-2-x86_64.pkg.tar.zst.sig2021-03-12 05:14 215
[PGP]redis-6.2.2-1-x86_64.pkg.tar.zst.sig2021-04-21 06:13 215
[PGP]rust-libslirp-4.3.0-1-x86_64.pkg.tar.zst.sig2020-10-28 05:13 215
[PGP]sha3sum-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-19 05:15 215
[PGP]spin-6.5.2-4-x86_64.pkg.tar.zst.sig2020-07-09 09:41 215
[PGP]spotifyd-0.3.2-1-x86_64.pkg.tar.zst.sig2021-03-05 05:16 215
[PGP]sslstrip-0.9-9-any.pkg.tar.zst.sig2020-10-07 06:14 215
[PGP]supermin-5.2.0-3-x86_64.pkg.tar.zst.sig2020-09-14 06:13 215
[PGP]termite-15-3-x86_64.pkg.tar.zst.sig2020-10-08 06:13 215
[PGP]termite-terminfo-15-3-x86_64.pkg.tar.zst.sig2020-10-08 06:13 215
[PGP]thermald-2.4.4-1-x86_64.pkg.tar.zst.sig2021-04-04 06:20 215
[PGP]tinyproxy-1.10.0-3-x86_64.pkg.tar.zst.sig2020-10-07 06:14 215
[PGP]ttf-eurof-1.0-2-any.pkg.tar.zst.sig2020-07-09 09:41 215
[PGP]ttf-monofur-1.0-7-any.pkg.tar.zst.sig2020-07-09 09:41 215
[PGP]vbam-sdl-2.1.4-3-x86_64.pkg.tar.zst.sig2020-09-14 06:13 215
[PGP]vbam-wx-2.1.4-3-x86_64.pkg.tar.zst.sig2020-09-14 06:13 215
[PGP]vim-syntastic-3.10.0-2-any.pkg.tar.zst.sig2020-09-15 06:13 215
[PGP]virt-manager-3.1.0-1-any.pkg.tar.zst.sig2020-10-12 06:13 215
[PGP]virt-viewer-9.0-1-x86_64.pkg.tar.zst.sig2020-11-19 05:13 215
[PGP]xss-lock-0.3.0.g1e158fb20108-4-x86_64.pkg.tar.zst.sig2020-09-14 06:13 215
[PGP]gedit-code-assistance-3.16.0+4+gd19b879-1-x86_64.pkg.tar.xz.sig2018-01-26 13:31 287
[PGP]lout-3.40-1-x86_64.pkg.tar.xz.sig2013-07-15 09:03 287
[PGP]dkimproxy-1.4.1-8-any.pkg.tar.xz.sig2018-11-10 05:16 309
[PGP]gnome-pie-0.7.2-1-x86_64.pkg.tar.xz.sig2018-11-28 05:13 309
[PGP]gpodder-3.10.19-3-any.pkg.tar.zst.sig2021-04-21 06:13 309
[PGP]hiawatha-10.11-3-x86_64.pkg.tar.zst.sig2021-01-17 02:44 309
[PGP]parole-4.16.0-1-x86_64.pkg.tar.zst.sig2021-01-23 05:14 309
[PGP]perl-cache-memcached-1.30-3-any.pkg.tar.xz.sig2018-11-10 05:19 309
[PGP]pstreams-1.0.1-1-any.pkg.tar.xz.sig2018-02-19 20:38 309
[PGP]python-csscompressor-0.9.5-3-any.pkg.tar.zst.sig2020-11-13 05:18 309
[PGP]python-dpcontracts-0.6.0-7-any.pkg.tar.zst.sig2020-11-13 05:18 309
[PGP]python-mediafile-0.6.0.r12.d7bea5e-1-any.pkg.tar.zst.sig2021-01-17 02:52 309
[PGP]python-rpy2-3.1.0-2-any.pkg.tar.xz.sig2019-09-02 06:13 309
[PGP]python-sympy-1.6.2-3-any.pkg.tar.zst.sig2020-11-13 05:20 309
[PGP]python2-beautifulsoup4-4.9.3-3-any.pkg.tar.zst.sig2020-11-12 05:14 309
[PGP]python2-extras-1.0.0-5-any.pkg.tar.xz.sig2019-11-01 05:13 309
[PGP]python2-flake8-debugger-3.2.1-1-any.pkg.tar.xz.sig2019-11-07 05:13 309
[PGP]ruby-rspec-support-3.8.0-4-any.pkg.tar.zst.sig2021-03-20 05:18 309
[PGP]tesseract-data-hrv-1:4.0.0-1-any.pkg.tar.xz.sig2018-11-12 05:15 309
[PGP]zsnes-1.51-22-x86_64.pkg.tar.zst.sig2021-01-17 02:58 309
[PGP]abcde-2.9.3-3-any.pkg.tar.zst.sig2020-09-14 06:13 310
[PGP]absl-py-0.11.0-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]acme-2020.08.26-2-x86_64.pkg.tar.zst.sig2021-01-17 02:36 310
[PGP]acpi-1.7-3-x86_64.pkg.tar.zst.sig2020-05-07 06:13 310
[PGP]acpica-20210105-1-x86_64.pkg.tar.zst.sig2021-01-17 02:36 310
[PGP]acsccid-1.1.8-1-x86_64.pkg.tar.zst.sig2020-01-18 05:13 310
[PGP]activity-log-manager-0.9.7-8-x86_64.pkg.tar.zst.sig2020-03-17 05:13 310
[PGP]adapta-gtk-theme-3.95.0.11-1-any.pkg.tar.xz.sig2018-11-15 05:13 310
[PGP]adapta-kde-20180828-1-any.pkg.tar.xz.sig2018-09-20 06:13 310
[PGP]adlplug-1.0.2-2-x86_64.pkg.tar.zst.sig2020-10-29 05:13 310
[PGP]adobe-source-han-sans-cn-fonts-1.004-3-any.pkg.tar.xz.sig2018-11-10 05:15 310
[PGP]adobe-source-han-sans-jp-fonts-1.004-3-any.pkg.tar.xz.sig2018-11-10 05:15 310
[PGP]adobe-source-han-sans-kr-fonts-1.004-3-any.pkg.tar.xz.sig2018-11-10 05:15 310
[PGP]adobe-source-han-sans-otc-fonts-1.004-3-any.pkg.tar.xz.sig2018-11-10 05:15 310
[PGP]adobe-source-han-sans-tw-fonts-1.004-3-any.pkg.tar.xz.sig2018-11-10 05:15 310
[PGP]adriconf-2.4.1-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]aegisub-3.2.2-45-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]afl-2.57b-5-x86_64.pkg.tar.zst.sig2021-02-18 05:14 310
[PGP]allegro-5.2.7.0-1-x86_64.pkg.tar.zst.sig2021-03-10 05:14 310
[PGP]allegro4-4.4.3.1-3-x86_64.pkg.tar.zst.sig2020-05-30 06:13 310
[PGP]alleyoop-0.9.8-7-x86_64.pkg.tar.xz.sig2019-03-28 05:13 310
[PGP]alot-0.9.1-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]amfora-1.8.0-2-x86_64.pkg.tar.zst.sig2021-02-22 05:13 310
[PGP]aml-0.2.0-2-x86_64.pkg.tar.zst.sig2021-04-11 06:13 310
[PGP]amule-1:2.3.3-1-x86_64.pkg.tar.zst.sig2021-02-14 05:16 310
[PGP]anjuta-3.34.0-7-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]anjuta-extras-3.26.0+13+g8248f12-2-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]anki-2.1.35-3-x86_64.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]ansible-bender-0.8.1-3-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]apache-orc-1.6.7-2-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]apitrace-9.0-4-x86_64.pkg.tar.zst.sig2020-02-12 05:13 310
[PGP]apm-2.6.1-3-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]apper-1.0.0-4-x86_64.pkg.tar.zst.sig2020-03-14 05:13 310
[PGP]appmenu-gtk-module-0.7.6-1-x86_64.pkg.tar.zst.sig2020-10-29 05:13 310
[PGP]appstream-generator-0.8.4-1-x86_64.pkg.tar.zst.sig2021-03-03 05:13 310
[PGP]arandr-0.1.10-5-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]arb-2.19.0-2-x86_64.pkg.tar.zst.sig2020-12-19 05:15 310
[PGP]arc-icon-theme-20161122-3-any.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]arc-kde-20180614-3-any.pkg.tar.xz.sig2019-06-15 06:13 310
[PGP]arcus-4.8.0-3-x86_64.pkg.tar.zst.sig2021-03-14 05:15 310
[PGP]argyllcms-2.1.2-1-x86_64.pkg.tar.zst.sig2020-01-20 05:13 310
[PGP]arm-1.4.5.0-5-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]arm-none-eabi-gdb-10.1-2-x86_64.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]armagetronad-0.2.9.1.0-1-x86_64.pkg.tar.zst.sig2020-12-09 05:13 310
[PGP]arpack-3.8.0-1-x86_64.pkg.tar.zst.sig2020-12-18 05:13 310
[PGP]arrow-3.0.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]asar-2.0.1-1-any.pkg.tar.xz.sig2019-05-02 06:13 310
[PGP]asciinema-2.0.2-5-any.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]asoundconf-1:1.2-6-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]aspell-hu-0.99.4.2-6-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]aspell-it-2.4_20070901-1-any.pkg.tar.zst.sig2020-06-15 06:13 310
[PGP]aspell-nn-0.50.1-4-any.pkg.tar.xz.sig2019-06-10 06:13 310
[PGP]aspnet-runtime-3.1-3.1.14.sdk114-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]aspnet-runtime-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]aspnet-targeting-pack-3.1-3.1.14.sdk114-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]aspnet-targeting-pack-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]atril-1.24.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]auctex-12.1-1-any.pkg.tar.xz.sig2017-12-12 00:02 310
[PGP]audaspace-1.3.0-5-x86_64.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]autoconf-archive-1:2019.01.06-4-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]autocutsel-0.10.0-3-x86_64.pkg.tar.zst.sig2020-05-08 06:13 310
[PGP]autofs-5.1.7-1-x86_64.pkg.tar.zst.sig2021-03-13 05:13 310
[PGP]autopep8-1:1.5.4-3-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]avisynthplus-3.7.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]avr-libc-2.0.0-3-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]avr-libc-2.0.0-4-any.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]avrdude-1:6.3-7-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]awesome-terminal-fonts-1.1.0-2-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]aws-cli-1.18.173-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]aws-cli-1.19.49-1-any.pkg.tar.zst.sig2021-04-11 06:13 310
[PGP]axel-2.17.10-1-x86_64.pkg.tar.zst.sig2020-11-23 05:13 310
[PGP]bamf-0.5.5-1-x86_64.pkg.tar.zst.sig2021-03-18 05:13 310
[PGP]bandit-1.7.0-2-any.pkg.tar.zst.sig2021-02-14 05:16 310
[PGP]barcode-0.99-5-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]bash-bats-support-0.3.0-2-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]bat-0.18.0-2-x86_64.pkg.tar.zst.sig2021-03-04 05:13 310
[PGP]bctoolbox-4.5.3-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]bcunit-3.0.2+12+g3c720fb-1-x86_64.pkg.tar.xz.sig2019-12-10 05:13 310
[PGP]beaver-0.4.1-5-x86_64.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]beets-1.4.9-5-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]beets-1.4.9.r1031.cbc045f1c-1-any.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]benzene-20130630-2-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]birdfont-2.29.4-1-x86_64.pkg.tar.zst.sig2021-04-18 06:13 310
[PGP]bleachbit-4.2.0-1-any.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]bliss-graphs-0.73-4-x86_64.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]blosc-1.21.0-1-x86_64.pkg.tar.zst.sig2021-01-18 05:13 310
[PGP]blueberry-1.4.2-1-any.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]bonnie++-1.98-1-x86_64.pkg.tar.zst.sig2020-08-03 06:13 310
[PGP]bonzomatic-1.0.20200306-1-x86_64.pkg.tar.zst.sig2020-04-01 06:13 310
[PGP]bpython-0.20-3-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]bpython-0.21-1-any.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]brial-1.2.10-2-x86_64.pkg.tar.zst.sig2020-11-04 05:13 310
[PGP]bsd-games-3.1-1-x86_64.pkg.tar.zst.sig2021-02-07 05:13 310
[PGP]bsdiff-4.3-10-x86_64.pkg.tar.zst.sig2020-03-26 05:13 310
[PGP]bspwm-0.9.10-1-x86_64.pkg.tar.zst.sig2020-08-07 06:13 310
[PGP]bt747-2.1.3-4-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]bti-034-4-x86_64.pkg.tar.zst.sig2020-04-26 06:13 310
[PGP]buckygen-1.1-1-x86_64.pkg.tar.xz.sig2019-11-06 05:13 310
[PGP]budgie-desktop-10.5.2+24+g7a5dcfda-1-x86_64.pkg.tar.zst.sig2021-04-14 06:13 310
[PGP]budgie-desktop-view-1.1.1-1-x86_64.pkg.tar.zst.sig2021-04-14 06:13 310
[PGP]buho-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:13 310
[PGP]bwm-ng-0.6.3-1-x86_64.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]byobu-5.133-2-any.pkg.tar.zst.sig2020-03-03 05:13 310
[PGP]byuu-4-1-x86_64.pkg.tar.zst.sig2020-03-23 05:13 310
[PGP]bzflag-2.4.22-1-x86_64.pkg.tar.zst.sig2021-03-27 05:13 310
[PGP]bzrtp-4.5.3-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]c-xsc-2.5.4-2-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]caja-1.24.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]caja-extensions-common-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]caja-image-converter-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]caja-open-terminal-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]caja-sendto-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]caja-share-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]caja-wallpaper-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]caja-xattr-tags-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]calf-0.90.3-4-x86_64.pkg.tar.zst.sig2020-12-26 05:13 310
[PGP]cantata-2.4.2-1-x86_64.pkg.tar.zst.sig2020-09-21 06:13 310
[PGP]canto-curses-0.9.9-3-x86_64.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]canto-daemon-0.9.7-4-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]capnet-assist-2.2.5-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]cargo-c-0.8.0-1-x86_64.pkg.tar.zst.sig2021-04-03 06:13 310
[PGP]cargo-tarpaulin-0.17.0-1-x86_64.pkg.tar.zst.sig2020-11-13 05:13 310
[PGP]cataclysm-dda-0.E.3-2-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]cataclysm-dda-tiles-0.E.3-2-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]catfish-1.4.13-4-any.pkg.tar.zst.sig2020-12-01 05:14 310
[PGP]catfish-4.16.0-3-any.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]cawbird-1.3.2-1-x86_64.pkg.tar.zst.sig2021-01-23 05:13 310
[PGP]ccgo-0.3.6.5-5-x86_64.pkg.tar.xz.sig2019-02-20 05:13 310
[PGP]cclive-0.9.3-23-x86_64.pkg.tar.zst.sig2020-12-13 05:14 310
[PGP]cddb_get-2.28-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]cddlib-1:0.94m-1-x86_64.pkg.tar.zst.sig2020-12-09 05:13 310
[PGP]celluloid-0.21-1-x86_64.pkg.tar.zst.sig2021-03-23 05:13 310
[PGP]cerbere-2.5.1-1-x86_64.pkg.tar.zst.sig2020-03-04 05:13 310
[PGP]cereal-1.3.0-1-any.pkg.tar.xz.sig2019-10-30 05:13 310
[PGP]cern-vdt-0.4.3-5-x86_64.pkg.tar.zst.sig2020-05-26 06:13 310
[PGP]certbot-1.9.0-3-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-1.14.0-2-any.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]certbot-dns-cloudflare-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-cloudxns-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-digitalocean-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-dnsimple-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-dnsmadeeasy-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-luadns-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-ovh-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]certbot-dns-sakuracloud-1.9.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]cgal-4.14.3-1-x86_64.pkg.tar.zst.sig2020-12-25 05:13 310
[PGP]cgasm-1.0.0-2-x86_64.pkg.tar.zst.sig2021-02-22 05:13 310
[PGP]cgns-4.1.2-1-x86_64.pkg.tar.zst.sig2021-03-14 05:13 310
[PGP]chafa-1.4.1-2-x86_64.pkg.tar.zst.sig2021-01-31 05:13 310
[PGP]cherrytree-0.38.8-1-any.pkg.tar.xz.sig2019-03-09 05:13 310
[PGP]chicken-5.2.0-1-x86_64.pkg.tar.zst.sig2020-03-07 05:13 310
[PGP]choqok-1.7.0-3-x86_64.pkg.tar.zst.sig2020-09-06 03:13 310
[PGP]chromium-bsu-0.9.16.1-1-x86_64.pkg.tar.zst.sig2020-04-24 06:13 310
[PGP]chuck-1.4.0.1-1-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]cjson-1.7.14-1-x86_64.pkg.tar.zst.sig2021-01-17 02:37 310
[PGP]cksfv-1.3.14-5-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]classpath-0.99-4-x86_64.pkg.tar.xz.sig2018-09-20 06:13 310
[PGP]clinfo-3.0.21.02.21-1-x86_64.pkg.tar.zst.sig2021-03-08 05:13 310
[PGP]clingo-5.3.0-2-x86_64.pkg.tar.xz.sig2018-09-20 06:13 310
[PGP]clipgrab-3.9.6-1-x86_64.pkg.tar.zst.sig2020-12-17 05:13 310
[PGP]cliquer-1.22-1-x86_64.pkg.tar.zst.sig2020-09-14 06:13 310
[PGP]cloc-1.88-1-any.pkg.tar.zst.sig2020-09-14 06:13 310
[PGP]cloud-init-20.2-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]cmake-fedora-2.9.3-4-any.pkg.tar.zst.sig2021-03-24 05:21 310
[PGP]cmatrix-2.0-2-x86_64.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]cmst-2020.11.01-1-x86_64.pkg.tar.zst.sig2020-11-18 05:13 310
[PGP]cmus-2.9.1-1-x86_64.pkg.tar.zst.sig2021-04-09 06:13 310
[PGP]cockatrice-2.8.0-2-x86_64.pkg.tar.zst.sig2021-03-14 05:15 310
[PGP]codeblocks-20.03-1-x86_64.pkg.tar.zst.sig2020-05-28 06:13 310
[PGP]codespell-1.17.1-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]coin-4.0.0.f4e446-2-x86_64.pkg.tar.zst.sig2021-02-10 05:13 310
[PGP]coin-or-asl-1.4.3-1-x86_64.pkg.tar.zst.sig2020-04-09 06:13 310
[PGP]coin-or-cbc-2.10.5-4-x86_64.pkg.tar.zst.sig2020-04-09 06:13 310
[PGP]coin-or-cgl-0.60.3-1-x86_64.pkg.tar.zst.sig2020-02-02 05:13 310
[PGP]coin-or-clp-1.17.6-1-x86_64.pkg.tar.zst.sig2020-04-13 06:13 310
[PGP]coin-or-coinutils-2.11.4-1-x86_64.pkg.tar.zst.sig2020-02-02 05:13 310
[PGP]coin-or-csdp-6.2.0-3-x86_64.pkg.tar.xz.sig2019-11-07 05:13 310
[PGP]coin-or-osi-0.108.6-1-x86_64.pkg.tar.zst.sig2020-02-02 05:13 310
[PGP]collectd-5.12.0-3-x86_64.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]colordiff-1.0.18-3-any.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]colorhug-client-0.2.8-2-x86_64.pkg.tar.zst.sig2020-05-13 06:13 310
[PGP]communicator-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:13 310
[PGP]comtool-1.7.9-3-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]converseen-0.9.9.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]coolreader-3.2.55-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]copyq-4.0.0-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]cor-0.1.17-3-x86_64.pkg.tar.xz.sig2018-06-04 21:19 310
[PGP]corrade-2020.06-1-x86_64.pkg.tar.zst.sig2020-08-07 06:13 310
[PGP]couchdb-2.3.1-4-x86_64.pkg.tar.zst.sig2020-04-28 06:13 310
[PGP]couchdb-3.1.1-3-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]cowfortune-0.1.2-6-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]coxeter-git.20180226-3-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]cozy-desktop-3.23.0-1-any.pkg.tar.zst.sig2020-10-09 06:13 310
[PGP]cozy-desktop-3.26.1-2-any.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]cozy-stack-1:1.4.19-1-x86_64.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]cozy-stack-1:1.4.29-1-x86_64.pkg.tar.zst.sig2021-04-05 06:13 310
[PGP]cpanminus-1.7044-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]cpanminus-1.7044-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]cppcheck-2.4.1-1-x86_64.pkg.tar.zst.sig2021-04-01 06:13 310
[PGP]cryfs-0.10.3-1-x86_64.pkg.tar.zst.sig2021-04-04 06:13 310
[PGP]crypto++-8.5.0-1-x86_64.pkg.tar.zst.sig2021-03-18 05:14 310
[PGP]cryptominisat5-5.8.0-5-x86_64.pkg.tar.zst.sig2021-04-18 06:13 310
[PGP]ctwm-4.0.3-1-x86_64.pkg.tar.zst.sig2020-09-30 06:13 310
[PGP]cura-4.7.1-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]cura-4.8.0-1-any.pkg.tar.zst.sig2021-01-17 02:39 310
[PGP]cura-binary-data-4.4.0-1-any.pkg.tar.xz.sig2019-12-13 05:13 310
[PGP]cura-binary-data-4.8.0-1-any.pkg.tar.zst.sig2021-01-17 02:39 310
[PGP]cura-resources-materials-4.4.0-1-any.pkg.tar.xz.sig2019-12-13 05:13 310
[PGP]cura-resources-materials-4.8.0-1-any.pkg.tar.zst.sig2021-01-17 02:39 310
[PGP]cython-0.28.5-1-x86_64.pkg.tar.xz.sig2018-09-20 06:13 310
[PGP]cython-0.29.23-1-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]cython2-0.28.5-1-x86_64.pkg.tar.xz.sig2018-09-20 06:13 310
[PGP]cython2-0.29.23-1-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]darktable-2:3.4.1-2-x86_64.pkg.tar.zst.sig2021-03-09 05:13 310
[PGP]dblatex-0.3.12-1-any.pkg.tar.zst.sig2021-02-14 05:16 310
[PGP]dcraw-9.28.0-2-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]deepin-album-5.8.0.40-1-x86_64.pkg.tar.zst.sig2021-03-24 05:14 310
[PGP]deepin-clipboard-5.3.0.5-2-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]deepin-compressor-5.8.0.9-3-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]deepin-draw-5.8.0.20-2-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]deepin-menu-5.0.1-4-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]deepin-music-6.0.1.91-4-x86_64.pkg.tar.zst.sig2021-04-18 06:13 310
[PGP]deepin-system-monitor-5.8.0.4-2-x86_64.pkg.tar.zst.sig2021-04-18 06:13 310
[PGP]deepin-system-monitor-5.8.0.27-2-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]deja-dup-42.7-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]devede-4.16.0-2-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]devil-1.8.0-5-x86_64.pkg.tar.zst.sig2021-03-21 05:13 310
[PGP]dg-1.1.0.20160916-4-any.pkg.tar.zst.sig2020-11-13 05:14 310
[PGP]diffstat-1.64-1-x86_64.pkg.tar.zst.sig2021-04-11 06:13 310
[PGP]diffuse-0.6.0-1-any.pkg.tar.zst.sig2020-12-03 05:13 310
[PGP]dillo-3.0.5-10-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]dina-font-2.92-7-any.pkg.tar.xz.sig2018-11-11 05:14 310
[PGP]disorderfs-0.5.11-1-x86_64.pkg.tar.zst.sig2021-01-24 05:13 310
[PGP]displaycal-3.8.9.3-1-x86_64.pkg.tar.xz.sig2019-12-16 05:13 310
[PGP]distcc-3.3.5-3-x86_64.pkg.tar.zst.sig2021-03-27 05:13 310
[PGP]dns-lexicon-3.5.0-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]dnssec-tools-2.2.3-6-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]dnstracer-1.10-1-x86_64.pkg.tar.zst.sig2021-03-12 05:13 310
[PGP]docbook2x-0.8.8-18-x86_64.pkg.tar.zst.sig2021-04-02 06:13 310
[PGP]docker-compose-1.27.4-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]docker-compose-1.29.1-1-any.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]docopt-0.6.2-2-x86_64.pkg.tar.zst.sig2020-05-30 06:13 310
[PGP]dokuwiki-20200729-3-any.pkg.tar.zst.sig2021-01-24 05:14 310
[PGP]dolphin-emu-1:5.0.r13869.a45a0a2066-1-x86_64.pkg.tar.zst.sig2021-03-18 05:14 310
[PGP]dopewars-1.6.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]dot2tex-2.11.3-3-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]dotnet-host-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]dotnet-runtime-3.1-3.1.14.sdk114-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]dotnet-runtime-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]dotnet-sdk-3.1-3.1.14.sdk114-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]dotnet-sdk-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]dotnet-targeting-pack-3.1-3.1.14.sdk114-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]dotnet-targeting-pack-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]dovecot-2.3.14-2-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]drawing-0.6.5-1-any.pkg.tar.zst.sig2021-02-28 05:14 310
[PGP]driconf-0.9.1-14-any.pkg.tar.xz.sig2018-12-31 05:13 310
[PGP]dropbear-2020.81-2-x86_64.pkg.tar.zst.sig2020-11-02 05:13 310
[PGP]dropbear-scp-2020.81-2-x86_64.pkg.tar.zst.sig2020-11-02 05:13 310
[PGP]drupal-9.0.6-2-any.pkg.tar.zst.sig2021-01-24 05:14 310
[PGP]dtc-1.6.0-3-x86_64.pkg.tar.zst.sig2020-11-14 05:14 310
[PGP]dtkwm-2.0.12-10-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]duktape-2.6.0-1-x86_64.pkg.tar.zst.sig2020-10-15 06:13 310
[PGP]duperemove-0.11.2-1-x86_64.pkg.tar.zst.sig2020-12-08 05:13 310
[PGP]duplicity-0.8.18-2-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]dvdauthor-0.7.2-10-x86_64.pkg.tar.zst.sig2021-01-31 05:13 310
[PGP]dvdbackup-0.4.2-6-x86_64.pkg.tar.zst.sig2020-04-06 06:13 310
[PGP]dwdiff-2.1.4-2-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]e-antic-0.1.9-1-x86_64.pkg.tar.zst.sig2021-02-25 05:18 310
[PGP]ecb-2.40.1pre-10-any.pkg.tar.xz.sig2018-11-10 05:16 310
[PGP]echoping-6.0.2-9-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]eclib-20210415-1-x86_64.pkg.tar.zst.sig2021-04-16 06:13 310
[PGP]ecryptfs-utils-111-4-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]edbrowse-3.7.6-2-x86_64.pkg.tar.zst.sig2020-10-15 06:13 310
[PGP]electron11-11.4.3-2-x86_64.pkg.tar.zst.sig2021-04-17 06:15 310
[PGP]element-web-1.7.24-1-x86_64.pkg.tar.zst.sig2021-04-05 06:13 310
[PGP]elementary-icon-theme-5.3.1-1-any.pkg.tar.zst.sig2020-05-12 06:13 310
[PGP]elementary-wallpapers-5.5.0-1-any.pkg.tar.xz.sig2019-11-27 05:13 310
[PGP]elfkickers-3.1.a-1-x86_64.pkg.tar.xz.sig2019-11-30 05:13 310
[PGP]elinks-0.14.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:40 310
[PGP]embree-3.12.2-1-x86_64.pkg.tar.zst.sig2021-01-28 05:13 310
[PGP]emovix-0.9.0-8-any.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]enlightenment-0.24.2-1-x86_64.pkg.tar.zst.sig2021-01-20 05:13 310
[PGP]entityx-1.3.0-1-x86_64.pkg.tar.xz.sig2018-11-16 05:13 310
[PGP]eolie-0.9.100-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]eolie-0.9.101-2-any.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]eom-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]eric-20.9-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]eric-common-19.11-2-any.pkg.tar.xz.sig2019-11-10 05:13 310
[PGP]eric-common-20.04-1-any.pkg.tar.zst.sig2020-04-06 06:13 310
[PGP]eric-i18n-de-20.6-1-any.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]eric-i18n-en-20.6-1-any.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]eric-i18n-es-20.6-1-any.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]eric-i18n-ru-20.6-1-any.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]erlang-23.3.1-1-x86_64.pkg.tar.zst.sig2021-04-07 06:13 310
[PGP]erlang-docs-23.3-1-any.pkg.tar.zst.sig2021-04-07 06:13 310
[PGP]erlang-nox-23.3.1-1-x86_64.pkg.tar.zst.sig2021-04-07 06:13 310
[PGP]erlang-sdl-1.3.1-4-x86_64.pkg.tar.xz.sig2019-02-20 05:13 310
[PGP]erlang-unixodbc-23.3.1-1-x86_64.pkg.tar.zst.sig2021-04-07 06:13 310
[PGP]erlang22-nox-22.3.4.11-1-x86_64.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]esptool-3.0-1-any.pkg.tar.zst.sig2020-12-03 05:13 310
[PGP]etherape-0.9.19-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]etl-1.4.0-1-any.pkg.tar.zst.sig2020-12-26 05:13 310
[PGP]evemu-2.7.0-7-x86_64.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]evtest-1.34-2-x86_64.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]exa-0.8.0-1-x86_64.pkg.tar.xz.sig2017-10-02 14:42 310
[PGP]exa-0.10.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]exfalso-4.4.0-1-any.pkg.tar.zst.sig2021-03-09 05:13 310
[PGP]extremetuxracer-0.8.0-1-x86_64.pkg.tar.zst.sig2020-03-12 05:13 310
[PGP]facter-3.14.16-2-x86_64.pkg.tar.zst.sig2021-03-20 05:17 310
[PGP]fatresize-1.1.0-1-x86_64.pkg.tar.zst.sig2020-04-06 06:13 310
[PGP]fbgrab-1.4-1-x86_64.pkg.tar.zst.sig2020-11-03 05:13 310
[PGP]fbida-2.14-3-x86_64.pkg.tar.zst.sig2021-03-25 05:13 310
[PGP]fceux-2.3.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:40 310
[PGP]fcitx-qt5-1.2.5-3-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]fcron-3.2.1-4-x86_64.pkg.tar.xz.sig2019-01-14 05:14 310
[PGP]fdkaac-1.0.1-1-x86_64.pkg.tar.zst.sig2020-10-01 06:14 310
[PGP]feathernotes-0.9.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]featherpad-0.18.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]feeluown-kuwo-0.1.2-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]feeluown-local-0.2.1-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]feeluown-xiami-0.2.4-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]fff-2.2-1-any.pkg.tar.zst.sig2020-09-24 06:13 310
[PGP]ffmpeg2theora-0.30-6-x86_64.pkg.tar.zst.sig2020-05-31 06:13 310
[PGP]ffms2-2.40-1-x86_64.pkg.tar.zst.sig2020-09-14 06:13 310
[PGP]ffnvcodec-headers8.1-8.1.24.11-1-any.pkg.tar.zst.sig2020-04-14 06:13 310
[PGP]filemanager-actions-3.4-5-x86_64.pkg.tar.zst.sig2020-03-12 05:13 310
[PGP]firefox-developer-edition-i18n-bn-69.0b16-1-any.pkg.tar.xz.sig2019-08-24 06:13 310
[PGP]firefox-developer-edition-i18n-ca-valencia-77.0b9-1-any.pkg.tar.zst.sig2020-05-23 06:13 310
[PGP]firefox-developer-edition-i18n-en-ca-69.0b16-1-any.pkg.tar.xz.sig2019-08-24 06:13 310
[PGP]firefox-developer-edition-i18n-oc-69.0b16-1-any.pkg.tar.xz.sig2019-08-24 06:13 310
[PGP]firefox-developer-edition-i18n-tl-77.0b9-1-any.pkg.tar.zst.sig2020-05-23 06:13 310
[PGP]firefox-developer-edition-i18n-trs-77.0b9-1-any.pkg.tar.zst.sig2020-05-23 06:13 310
[PGP]firetools-0.9.64-1-x86_64.pkg.tar.zst.sig2021-01-17 02:40 310
[PGP]firewalld-0.9.3-3-any.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]flashrom-1.2-2-x86_64.pkg.tar.zst.sig2020-05-12 06:13 310
[PGP]flatbuffers-1.12.0-3-x86_64.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]flickcurl-1.26-11-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]flint-2.7.1-1-x86_64.pkg.tar.zst.sig2021-01-19 05:13 310
[PGP]flite-2.2-1-x86_64.pkg.tar.zst.sig2021-02-11 05:13 310
[PGP]flowblade-2.8.0.2-1-any.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]focuswriter-1.7.6-2-x86_64.pkg.tar.zst.sig2020-07-09 09:39 310
[PGP]fortune-mod-2.12.0-1-x86_64.pkg.tar.zst.sig2020-01-15 05:13 310
[PGP]fplll-5.4.0-1-x86_64.pkg.tar.zst.sig2020-12-05 05:17 310
[PGP]fragments-1.5-1-x86_64.pkg.tar.zst.sig2020-10-25 05:13 310
[PGP]freecad-0.19.1-2-x86_64.pkg.tar.zst.sig2021-03-29 06:21 310
[PGP]freemind-1.0.1-5-any.pkg.tar.zst.sig2020-06-29 06:13 310
[PGP]freeradius-3.0.21-6-x86_64.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]frei0r-plugins-1.7.0-1-x86_64.pkg.tar.xz.sig2019-12-16 05:13 310
[PGP]frescobaldi-3.1.3-3-any.pkg.tar.zst.sig2021-03-18 05:15 310
[PGP]fs-uae-3.0.5-1-x86_64.pkg.tar.zst.sig2020-05-06 06:13 310
[PGP]fs-uae-launcher-3.0.5-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]fstrm-0.6.1-1-x86_64.pkg.tar.zst.sig2021-04-11 06:13 310
[PGP]fuse-zip-0.7.1-1-x86_64.pkg.tar.zst.sig2020-08-17 06:13 310
[PGP]fvextra-1.2.1-2-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]fvextra-1.4-1-any.pkg.tar.xz.sig2019-11-07 05:13 310
[PGP]fwbuilder-5.3.7-9-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]fwknop-2.6.10-2-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]gajim-1.2.2-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]gala-3.3.2.r134.c74298b4-1-x86_64.pkg.tar.zst.sig2021-04-07 06:15 310
[PGP]gambas3-devel-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-args-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-cairo-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-chart-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-clipper-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-complex-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-compress-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-crypt-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-data-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-db-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-db-form-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-db-mysql-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-db-odbc-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-db-postgresql-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-db-sqlite3-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-dbus-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-desktop-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-desktop-gnome-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-desktop-x11-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-eval-highlight-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-form-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-form-dialog-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-form-editor-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-form-mdi-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-form-stock-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-form-terminal-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-gmp-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-gsl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-gtk3-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-httpd-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-image-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-image-effect-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-image-imlib-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-image-io-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-inotify-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-libxml-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-logging-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-map-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-markdown-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-media-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-media-form-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-memcached-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-mime-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-mysql-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-ncurses-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-net-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-net-curl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-net-pop3-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-net-smtp-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-openal-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-opengl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-opengl-glsl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-opengl-glu-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-opengl-sge-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-openssl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-option-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-pcre-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-pdf-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-poppler-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-qt5-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-qt5-opengl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-qt5-webkit-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-report-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-scanner-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-sdl-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-sdl-sound-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-sdl2-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-sdl2-audio-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-settings-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-signal-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-term-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-util-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-util-web-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-v4l-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-vb-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-web-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-web-feed-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-web-form-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-web-gui-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-xml-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-xml-html-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-xml-rpc-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-gb-xml-xslt-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-ide-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-runtime-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gambas3-script-3.15.2-9-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]gameconqueror-0.17-4-x86_64.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]gamemode-1.6.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:13 310
[PGP]gammaray-2.11.2-1-x86_64.pkg.tar.zst.sig2020-09-22 06:13 310
[PGP]gap-4.11.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:14 310
[PGP]gap-doc-4.11.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:14 310
[PGP]gap-packages-4.11.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:14 310
[PGP]gauche-0.9.10-2-x86_64.pkg.tar.zst.sig2020-12-26 05:15 310
[PGP]gaupol-1.9-1-any.pkg.tar.zst.sig2021-01-17 02:41 310
[PGP]gavl-1.4.0-4-x86_64.pkg.tar.zst.sig2020-05-28 06:13 310
[PGP]gbrainy-1:2.4.3-1-any.pkg.tar.zst.sig2021-01-17 02:41 310
[PGP]gcolor3-2.4.0-2-x86_64.pkg.tar.zst.sig2020-10-26 05:13 310
[PGP]gcompris-qt-1.0-1-x86_64.pkg.tar.zst.sig2020-11-21 05:14 310
[PGP]gdal-3.0.4-23-x86_64.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]gdal-3.2.2-1-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]geany-1.37.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:41 310
[PGP]geany-plugins-1.37-3-x86_64.pkg.tar.zst.sig2021-01-17 02:41 310
[PGP]geary-1:3.38.2-1-x86_64.pkg.tar.zst.sig2021-03-06 05:13 310
[PGP]geckodriver-0.26.0-1-x86_64.pkg.tar.zst.sig2020-01-20 05:13 310
[PGP]geda-gaf-1.10.0-1-x86_64.pkg.tar.xz.sig2019-10-24 06:13 310
[PGP]gendesk-1.0.8-1-x86_64.pkg.tar.zst.sig2021-02-22 05:13 310
[PGP]gens-gs-2.16.7-8-x86_64.pkg.tar.xz.sig2019-08-21 06:13 310
[PGP]geotag-0.103-2-any.pkg.tar.xz.sig2019-03-13 05:13 310
[PGP]gf2x-1.3.0-1-x86_64.pkg.tar.xz.sig2019-12-11 05:13 310
[PGP]gfan-0.6.2-2-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]gfeeds-0.16.2-3-any.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]gftp-2.7.0b-1-x86_64.pkg.tar.zst.sig2021-04-13 06:13 310
[PGP]gifsicle-1.92-2-x86_64.pkg.tar.zst.sig2020-10-08 06:13 310
[PGP]gimagereader-common-3.3.1-3-x86_64.pkg.tar.zst.sig2021-01-17 02:56 310
[PGP]gimagereader-gtk-3.3.1-3-x86_64.pkg.tar.zst.sig2021-01-17 02:56 310
[PGP]gimagereader-qt-3.3.1-3-x86_64.pkg.tar.zst.sig2021-01-17 02:56 310
[PGP]gimp-help-ca-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-da-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-de-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-el-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-en-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-en_gb-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-es-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-fr-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-it-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-ja-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-ko-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-nl-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-nn-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-pt_br-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-ru-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-sl-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:17 310
[PGP]gimp-help-sv-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]gimp-help-zh_cn-2.8.2-6-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]gimp-plugin-gmic-2.9.7-1-x86_64.pkg.tar.zst.sig2021-04-08 06:13 310
[PGP]gio-sharp-0.3-3-any.pkg.tar.xz.sig2017-10-18 16:04 310
[PGP]git-filter-repo-2.27.1-2-any.pkg.tar.zst.sig2020-11-13 05:15 310
[PGP]gitea-1.13.7-1-x86_64.pkg.tar.zst.sig2021-04-11 06:13 310
[PGP]gkeyfile-sharp-0.1-4-any.pkg.tar.xz.sig2017-10-18 16:04 310
[PGP]glances-3.1.5-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]glew-wayland-2.2.0-1-x86_64.pkg.tar.zst.sig2020-05-11 06:13 310
[PGP]glewlwyd-2.5.2-2-x86_64.pkg.tar.zst.sig2021-03-19 05:15 310
[PGP]global-6.6.5-1-x86_64.pkg.tar.zst.sig2020-09-06 03:14 310
[PGP]glom-1.32.0-5-x86_64.pkg.tar.zst.sig2020-12-13 05:16 310
[PGP]gmic-2.9.7-1-x86_64.pkg.tar.zst.sig2021-04-08 06:13 310
[PGP]gmt-6.1.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gmt-doc-6.1.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gmtp-1.3.11-2-x86_64.pkg.tar.zst.sig2020-05-31 06:13 310
[PGP]gnac-0.2.4.1-10-x86_64.pkg.tar.zst.sig2020-07-11 06:13 310
[PGP]gnome-activity-journal-0.8.0-12-any.pkg.tar.xz.sig2018-12-30 05:14 310
[PGP]gnome-break-timer-2.0.3-2-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]gnome-connections-40.0.1-3-x86_64.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]gnome-firmware-3.36.0-2-x86_64.pkg.tar.zst.sig2020-09-06 03:14 310
[PGP]gnome-flashback-3.38.0-1-x86_64.pkg.tar.zst.sig2020-10-23 06:13 310
[PGP]gnome-flashback-3.40.0-1-x86_64.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]gnome-games-40.0-2-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]gnome-initial-setup-40.0-2-x86_64.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]gnome-passwordsafe-5.0-1-any.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]gnome-podcasts-0.4.9-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]gnome-recipes-2.0.4-1-x86_64.pkg.tar.zst.sig2020-03-09 05:13 310
[PGP]gnome-recipes-2.0.4-2-x86_64.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]gnome-schedule-2.3.0-2-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]gnome-screensaver-3.6.1-17-x86_64.pkg.tar.zst.sig2020-03-09 05:13 310
[PGP]gnome-subtitles-1.6-2-x86_64.pkg.tar.zst.sig2020-05-29 06:13 310
[PGP]gnome-tour-40.0-1-x86_64.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]gnomon-1.5.0-3-any.pkg.tar.zst.sig2021-02-07 05:14 310
[PGP]gnu-apl-1.8-2-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]gnubg-1.06.002-5-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]gnubiff-2.2.17-9-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]gnuchess-6.2.7-1-x86_64.pkg.tar.zst.sig2020-06-07 21:38 310
[PGP]gnunet-0.14.1-1-x86_64.pkg.tar.zst.sig2021-04-06 06:13 310
[PGP]gnuradio-3.8.2.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gnuradio-companion-3.8.2.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gnuradio-fcdproplus-3.8.0-9-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gnuradio-iqbal-0.38.1-4-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gnuradio-osmosdr-0.2.3-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gnurl-7.72.0-1-x86_64.pkg.tar.zst.sig2020-09-20 06:13 310
[PGP]gnustep-make-2.8.0-1-x86_64.pkg.tar.zst.sig2020-05-03 06:13 310
[PGP]go-ethereum-1.10.2-1-x86_64.pkg.tar.zst.sig2021-04-10 06:13 310
[PGP]gocr-0.52-2-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]godot-3.2.3-2-x86_64.pkg.tar.zst.sig2021-03-20 05:14 310
[PGP]goocanvas-3.0.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]goocanvasmm-1.90.11-5-x86_64.pkg.tar.zst.sig2021-03-16 05:13 310
[PGP]googlemaps-20180602-15-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]gourmet-0.17.4-8-any.pkg.tar.xz.sig2018-12-28 05:13 310
[PGP]gpac-1:1.0.1-1-x86_64.pkg.tar.zst.sig2020-09-14 06:13 310
[PGP]gpodder-3.10.19-2-any.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]gprename-20160905-2-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]gpsbabel-1.7.0-2-x86_64.pkg.tar.zst.sig2020-07-14 06:13 310
[PGP]gpscorrelate-2.0-1-x86_64.pkg.tar.xz.sig2019-12-11 05:13 310
[PGP]gpsd-3.22-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gpsprune-20.3-1-any.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]gpxsee-8.9-1-x86_64.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]gqrx-2.14.4-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]grafana-7.5.4-1-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]grafx2-2.7-3-x86_64.pkg.tar.zst.sig2020-07-09 09:44 310
[PGP]grammalecte-2.1.1-1-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]granite-6.0.0-1-x86_64.pkg.tar.zst.sig2021-03-25 05:15 310
[PGP]griffith-0.17-1-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]grim-1.3.2-1-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]grsync-1.3.0-1-x86_64.pkg.tar.zst.sig2020-12-26 05:14 310
[PGP]gsignond-1.2.0-3-x86_64.pkg.tar.zst.sig2020-02-06 05:13 310
[PGP]gsimplecal-2.2-1-x86_64.pkg.tar.zst.sig2021-03-21 05:13 310
[PGP]gst-editing-services-1.18.4-1-x86_64.pkg.tar.zst.sig2021-03-23 05:13 310
[PGP]gtk-sharp-3-2.99.3-2-x86_64.pkg.tar.xz.sig2018-11-28 05:13 310
[PGP]gtk-theme-elementary-5.4.2-1-any.pkg.tar.zst.sig2020-04-03 06:13 310
[PGP]gtkspell3-3.0.10-2-x86_64.pkg.tar.xz.sig2019-12-11 05:13 310
[PGP]gtkwave-3.3.108-1-x86_64.pkg.tar.zst.sig2021-01-17 02:43 310
[PGP]gufw-20.04.1-3-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]gummi-2:0.8.1-2-x86_64.pkg.tar.zst.sig2020-11-21 05:14 310
[PGP]gutenpy-0.3.0-11-any.pkg.tar.xz.sig2018-06-07 22:04 310
[PGP]gvm-libs-10.0.2-1-x86_64.pkg.tar.zst.sig2020-08-09 06:13 310
[PGP]gwakeonlan-0.7.0-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]gwget-1.0.4-17-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]hacburn-0.3.5-7-any.pkg.tar.xz.sig2018-06-07 22:05 310
[PGP]hamlib-3.3-9-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]hardinfo-0.5.1.816.g877ea2b-2-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]haskell-citeproc-0.3.0.9-12-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]hatari-2.3.1-1-x86_64.pkg.tar.zst.sig2021-02-15 05:13 310
[PGP]haxe-4.2.1-1-x86_64.pkg.tar.zst.sig2021-02-28 05:14 310
[PGP]hdf5-1.12.0-2-x86_64.pkg.tar.zst.sig2020-04-25 06:13 310
[PGP]hdf5-openmpi-1.12.0-2-x86_64.pkg.tar.zst.sig2020-04-25 06:13 310
[PGP]hedgedoc-1.7.2-2-any.pkg.tar.zst.sig2021-03-03 05:15 310
[PGP]hepmc-2.06.10-7-x86_64.pkg.tar.zst.sig2020-05-26 06:13 310
[PGP]hepmc2-2.06.11-1-x86_64.pkg.tar.zst.sig2020-06-12 06:13 310
[PGP]herbstluftwm-0.9.2-1-x86_64.pkg.tar.zst.sig2021-03-06 05:13 310
[PGP]hey-0.1.4-4-x86_64.pkg.tar.zst.sig2021-02-22 05:14 310
[PGP]hgview-1.10.2-4-any.pkg.tar.xz.sig2019-02-11 05:13 310
[PGP]hid-tools-0.2-6-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]hiera-3.6.0-2-any.pkg.tar.zst.sig2021-03-20 05:17 310
[PGP]higan-110-1-x86_64.pkg.tar.zst.sig2020-03-24 05:13 310
[PGP]hiredis-1.0.0-1-x86_64.pkg.tar.zst.sig2020-08-09 06:13 310
[PGP]hivex-1.3.19-4-x86_64.pkg.tar.zst.sig2021-03-22 05:20 310
[PGP]hm-16.20-1-x86_64.pkg.tar.xz.sig2019-10-02 06:13 310
[PGP]hm-16.22-1-x86_64.pkg.tar.zst.sig2020-12-05 05:14 310
[PGP]hoel-1.4.17-3-x86_64.pkg.tar.zst.sig2021-03-19 05:16 310
[PGP]home-assistant-0.117.6-1-any.pkg.tar.zst.sig2020-11-18 05:14 310
[PGP]home-assistant-2021.4.4-2-any.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]htmldoc-1.9.11-1-x86_64.pkg.tar.zst.sig2020-12-26 05:15 310
[PGP]httpie-2.4.0-1-any.pkg.tar.zst.sig2021-02-07 05:14 310
[PGP]httrack-3.49.2-3-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]hugin-2020.0.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:45 310
[PGP]hunspell-el-0.9-6-any.pkg.tar.zst.sig2020-11-18 05:13 310
[PGP]hunspell-fr-7.0-1-any.pkg.tar.zst.sig2020-12-20 05:13 310
[PGP]hunspell-hu-1.7-2-any.pkg.tar.xz.sig2019-10-05 06:13 310
[PGP]hunspell-nl-2.20.19-1-any.pkg.tar.zst.sig2021-02-13 05:13 310
[PGP]hwinfo-21.73-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]hypercorn-0.11.1-3-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]hypercorn-0.11.2-1-any.pkg.tar.zst.sig2021-01-17 02:45 310
[PGP]hyperkitty-1.3.3-5-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]hyperscan-5.4.0-1-x86_64.pkg.tar.zst.sig2021-01-19 05:14 310
[PGP]hyphen-fr-3.0-5-any.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]hyphen-hu-20110815-1-any.pkg.tar.xz.sig2018-12-25 01:59 310
[PGP]hyphen-pl-20081206-3-any.pkg.tar.xz.sig2018-05-31 09:15 310
[PGP]hyphen-ro-3.3.6-5-any.pkg.tar.xz.sig2018-05-31 09:22 310
[PGP]i2pd-2.37.0-2-x86_64.pkg.tar.zst.sig2021-03-27 05:17 310
[PGP]i3-wm-4.19.2-1-x86_64.pkg.tar.zst.sig2021-02-28 05:15 310
[PGP]i3lock-2.13-1-x86_64.pkg.tar.zst.sig2020-11-14 05:13 310
[PGP]i810-dri-7.11.2-11-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]ibus-sunpinyin-3.0.0rc1+32+gf39c195-1-x86_64.pkg.tar.zst.sig2020-03-17 05:13 310
[PGP]ibus-table-1.12.1-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]icewm-2.3.2-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]icmake-9.03.01-1-x86_64.pkg.tar.zst.sig2020-08-11 06:13 310
[PGP]icoutils-0.32.3-3-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]iddawc-0.9.9-1-x86_64.pkg.tar.zst.sig2021-04-09 06:14 310
[PGP]igraph-0.9.2-1-x86_64.pkg.tar.zst.sig2021-04-15 06:14 310
[PGP]imagescan-3.65.0-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]imv-4.2.0-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]in-toto-0.5.0-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]index-fm-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]intel-compute-runtime-20.48.18558-1-x86_64.pkg.tar.zst.sig2020-12-06 05:15 310
[PGP]intel-gmmlib-21.1.1-1-x86_64.pkg.tar.zst.sig2021-04-05 06:13 310
[PGP]intel-gpu-tools-1.25-2-x86_64.pkg.tar.zst.sig2020-04-26 06:13 310
[PGP]intel-graphics-compiler-1:1.0.5435-1-x86_64.pkg.tar.zst.sig2020-11-15 05:13 310
[PGP]intel-media-driver-21.1.3-1-x86_64.pkg.tar.zst.sig2021-04-05 06:13 310
[PGP]intel-media-sdk-20.5.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:45 310
[PGP]intel-opencl-clang-11.0.0-2-x86_64.pkg.tar.zst.sig2021-02-18 05:14 310
[PGP]io-2017.09.06-2-x86_64.pkg.tar.zst.sig2020-11-26 05:15 310
[PGP]iodine-0.7.0-4-x86_64.pkg.tar.xz.sig2018-06-09 08:15 310
[PGP]iotop-0.6-8-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]iptstate-2.2.6-4-x86_64.pkg.tar.zst.sig2020-07-09 09:42 310
[PGP]ipython-7.19.0-3-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]ipython2-5.9.0-1-any.pkg.tar.zst.sig2020-02-03 05:13 310
[PGP]isomd5sum-1.2.3-5-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]ispc-1.15.0-2-x86_64.pkg.tar.zst.sig2021-02-18 05:14 310
[PGP]ivy-2.5.0-1-any.pkg.tar.xz.sig2019-12-11 05:13 310
[PGP]iwd-1.13-1-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]jami-daemon-20210308-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]jami-gnome-20210308-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]jansson-2.13.1-1-x86_64.pkg.tar.zst.sig2020-05-17 06:13 310
[PGP]java-rxtx-2.2pre2-7-x86_64.pkg.tar.zst.sig2020-05-29 06:13 310
[PGP]jedi-language-server-0.21.0-3-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]john-1.8.0.jumbo1-9-x86_64.pkg.tar.xz.sig2017-09-11 20:35 310
[PGP]joyutils-1.7.1-2-x86_64.pkg.tar.zst.sig2021-04-10 06:13 310
[PGP]jpegoptim-1.4.6-2-x86_64.pkg.tar.zst.sig2020-04-24 06:13 310
[PGP]js185-1.0.0-9-x86_64.pkg.tar.zst.sig2020-04-09 06:13 310
[PGP]jsmol-14.31.36-1-any.pkg.tar.zst.sig2021-04-07 06:13 310
[PGP]julia-2:1.6.0-7-x86_64.pkg.tar.zst.sig2021-04-01 06:13 310
[PGP]jupyter-4.6.3-2-any.pkg.tar.zst.sig2021-01-19 05:14 310
[PGP]jupyter-jsmol-2021.3.0-1-any.pkg.tar.zst.sig2021-03-12 05:14 310
[PGP]jupyter-nbclassic-0.2.7-1-any.pkg.tar.zst.sig2021-04-09 06:14 310
[PGP]jupyter-nbclient-0.5.3-1-any.pkg.tar.zst.sig2021-03-27 05:15 310
[PGP]jupyter-nbconvert-6.0.7-3-any.pkg.tar.zst.sig2021-03-27 05:15 310
[PGP]jupyter-nbformat-5.1.2-2-any.pkg.tar.zst.sig2021-03-28 06:13 310
[PGP]jupyter-notebook-6.1.4-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]jupyter-notebook-6.2.0-1-any.pkg.tar.zst.sig2021-01-19 05:14 310
[PGP]jupyter-server-1.6.2-1-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]jupyter-server-mathjax-0.2.2-1-any.pkg.tar.zst.sig2021-04-12 06:13 310
[PGP]jupyter-widgetsnbextension-1:3.5.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]jupyter_console-6.2.0-3-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]jupyterlab-2.2.9-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]jupyterlab-3.0.14-1-any.pkg.tar.zst.sig2021-04-13 06:13 310
[PGP]jupyterlab-widgets-1.0.0-1-any.pkg.tar.zst.sig2020-12-25 05:14 310
[PGP]jupyterlab_server-1.2.0-3-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]kashmir-20150805-3-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]kbfs-5.6.1-2-x86_64.pkg.tar.zst.sig2021-04-02 06:13 310
[PGP]kdbg-3.0.1-1-x86_64.pkg.tar.zst.sig2020-01-12 05:14 310
[PGP]keepassxc-2.6.4-1-x86_64.pkg.tar.zst.sig2021-02-07 05:14 310
[PGP]keepnote-0.7.8-4-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]keybase-5.6.1-2-x86_64.pkg.tar.zst.sig2021-04-02 06:13 310
[PGP]keycloak-metrics-spi-2.2.0-1-any.pkg.tar.zst.sig2021-03-26 05:14 310
[PGP]keycloak-metrics-spi-2.3.0-1-any.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]keycloak-metrics-spi-2.3.1-1-any.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]keynav-0.20180821.0-1-x86_64.pkg.tar.zst.sig2020-05-03 06:13 310
[PGP]khard-0.17.0-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]kicad-5.1.9-1-x86_64.pkg.tar.zst.sig2020-12-23 05:13 310
[PGP]kicad-library-3d-5.1.9-1-any.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]kicad-library-5.1.9-1-any.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]kid3-3.8.6-1-x86_64.pkg.tar.zst.sig2021-03-21 05:13 310
[PGP]kid3-common-3.8.6-1-x86_64.pkg.tar.zst.sig2021-03-21 05:14 310
[PGP]kid3-qt-3.8.6-1-x86_64.pkg.tar.zst.sig2021-03-21 05:14 310
[PGP]kim4-0.9.5-7-any.pkg.tar.xz.sig2018-01-18 18:17 310
[PGP]kio-fuse-5.0.1-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]kiwix-lib-9.4.1-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]kjots-5.1.0-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]klavaro-3.11-1-x86_64.pkg.tar.zst.sig2020-11-06 05:13 310
[PGP]klayout-0.26.11-2-x86_64.pkg.tar.zst.sig2021-03-20 05:17 310
[PGP]kmymoney-5.1.1-2-x86_64.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]knot-3.0.5-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 310
[PGP]kotlin-1.4.32-1-any.pkg.tar.zst.sig2021-04-03 06:13 310
[PGP]kpeoplevcard-0.1-1-x86_64.pkg.tar.xz.sig2019-12-10 05:13 310
[PGP]kphotoalbum-5.7.0-3-x86_64.pkg.tar.zst.sig2020-10-15 06:13 310
[PGP]kquickimageeditor-0.1.3-1-x86_64.pkg.tar.zst.sig2021-01-27 05:13 310
[PGP]krename-5.0.1-2-x86_64.pkg.tar.zst.sig2021-01-17 02:56 310
[PGP]kresus-0.16.0-1-x86_64.pkg.tar.zst.sig2020-09-27 06:13 310
[PGP]krita-plugin-gmic-2.9.7-1-x86_64.pkg.tar.zst.sig2021-04-08 06:13 310
[PGP]kshutdown-5.2-1-x86_64.pkg.tar.zst.sig2020-01-12 05:14 310
[PGP]kstars-1:3.5.2-1-x86_64.pkg.tar.zst.sig2021-03-01 05:14 310
[PGP]ktikz-0.13.1-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 310
[PGP]ktimetracker-5.0.1-1-x86_64.pkg.tar.xz.sig2019-12-22 05:13 310
[PGP]ktoblzcheck-1.52-3-x86_64.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]kup-0.8.0-3-x86_64.pkg.tar.zst.sig2020-10-16 06:13 310
[PGP]kupfer-320-2-any.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]kvantum-qt5-0.19.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]kvantum-theme-adapta-20180828-1-any.pkg.tar.xz.sig2018-09-20 06:17 310
[PGP]kvantum-theme-arc-20180614-3-any.pkg.tar.xz.sig2019-06-15 06:13 310
[PGP]kvantum-theme-materia-20210410-1-any.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]kvazaar-2.0.0-1-x86_64.pkg.tar.zst.sig2020-04-24 06:13 310
[PGP]kvirc-5.0.0-3-x86_64.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]l3afpad-0.8.18.1.11-5-x86_64.pkg.tar.zst.sig2020-05-29 06:13 310
[PGP]labplot-2.8.2-1-x86_64.pkg.tar.zst.sig2021-03-27 05:15 310
[PGP]labyrinth-0.6-4-any.pkg.tar.xz.sig2018-09-20 06:17 310
[PGP]languagetool-5.3-1-any.pkg.tar.zst.sig2021-04-08 06:14 310
[PGP]laszip2-2.2.0-1-x86_64.pkg.tar.zst.sig2020-10-14 06:13 310
[PGP]lat-1.2.4-5-any.pkg.tar.xz.sig2018-12-30 05:14 310
[PGP]latte-dock-0.9.11-1-x86_64.pkg.tar.zst.sig2020-04-12 06:13 310
[PGP]latte-integrale-1.7.6-1-x86_64.pkg.tar.zst.sig2021-03-19 05:16 310
[PGP]lcalc-1.23-21-x86_64.pkg.tar.zst.sig2020-10-20 06:13 310
[PGP]ledger-3.2.1-6-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]leiningen-2.9.5-1-any.pkg.tar.zst.sig2020-12-19 05:14 310
[PGP]leptonica-1.80.0-1-x86_64.pkg.tar.zst.sig2020-08-02 06:13 310
[PGP]level-zero-headers-1.0.22-1-x86_64.pkg.tar.zst.sig2020-12-20 05:13 310
[PGP]level-zero-loader-1.0.22-1-x86_64.pkg.tar.zst.sig2020-12-20 05:13 310
[PGP]leveldb-1.23-2-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]lhapdf-6.3.0-3-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]lhasa-0.3.1-3-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]lib32-amdvlk-2021.Q2.1-1-x86_64.pkg.tar.zst.sig2021-04-08 06:14 310
[PGP]lib32-apitrace-9.0-2-x86_64.pkg.tar.zst.sig2020-04-18 06:13 310
[PGP]lib32-at-spi2-atk-2.38.0-1-x86_64.pkg.tar.zst.sig2020-10-20 06:13 310
[PGP]lib32-at-spi2-core-2.40.0-1-x86_64.pkg.tar.zst.sig2021-03-24 05:22 310
[PGP]lib32-atk-2.36.0-2-x86_64.pkg.tar.zst.sig2021-03-14 05:17 310
[PGP]lib32-brotli-1.0.9-1-x86_64.pkg.tar.zst.sig2020-09-21 06:13 310
[PGP]lib32-bzip2-1.0.8-2-x86_64.pkg.tar.xz.sig2019-07-16 06:13 310
[PGP]lib32-celt-0.11.3-4-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]lib32-clang-11.1.0-1-x86_64.pkg.tar.zst.sig2021-02-18 05:15 310
[PGP]lib32-cracklib-2.9.7-1-x86_64.pkg.tar.xz.sig2019-04-24 06:16 310
[PGP]lib32-db-5.3.28-4-x86_64.pkg.tar.xz.sig2018-06-03 11:51 310
[PGP]lib32-dconf-0.40.0-1-x86_64.pkg.tar.zst.sig2021-03-24 05:22 310
[PGP]lib32-e2fsprogs-1.46.2-2-x86_64.pkg.tar.zst.sig2021-03-03 05:17 310
[PGP]lib32-flac-1.3.3-1-x86_64.pkg.tar.xz.sig2019-08-21 06:13 310
[PGP]lib32-flex-2.6.4-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-freeglut-3.2.1-1-x86_64.pkg.tar.xz.sig2019-10-01 06:13 310
[PGP]lib32-gamemode-1.6.1-1-x86_64.pkg.tar.zst.sig2021-03-03 05:17 310
[PGP]lib32-glew-2.2.0-1-x86_64.pkg.tar.zst.sig2020-04-26 06:14 310
[PGP]lib32-glew1.10-1.10.0-4-x86_64.pkg.tar.xz.sig2019-02-07 05:13 310
[PGP]lib32-glib-networking-2.68.0-1-x86_64.pkg.tar.zst.sig2021-03-24 05:22 310
[PGP]lib32-glu-9.0.1-1-x86_64.pkg.tar.xz.sig2019-08-01 06:14 310
[PGP]lib32-gmp-6.2.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]lib32-gnutls-3.7.1-1-x86_64.pkg.tar.zst.sig2021-03-13 05:14 310
[PGP]lib32-gpm-1.20.7-2-x86_64.pkg.tar.xz.sig2018-06-09 08:32 310
[PGP]lib32-gst-plugins-base-1.18.4-1-x86_64.pkg.tar.zst.sig2021-03-22 05:20 310
[PGP]lib32-gst-plugins-base-libs-1.18.4-1-x86_64.pkg.tar.zst.sig2021-03-22 05:20 310
[PGP]lib32-gst-plugins-good-1.18.4-1-x86_64.pkg.tar.zst.sig2021-03-22 05:20 310
[PGP]lib32-gstreamer-1.18.4-1-x86_64.pkg.tar.zst.sig2021-03-22 05:20 310
[PGP]lib32-gtk2-2.24.33-1-x86_64.pkg.tar.zst.sig2021-01-30 05:15 310
[PGP]lib32-icu-69.1-1-x86_64.pkg.tar.zst.sig2021-04-16 06:18 310
[PGP]lib32-imlib2-1.7.1-1-x86_64.pkg.tar.zst.sig2020-12-20 05:17 310
[PGP]lib32-jansson-2.13.1-1-x86_64.pkg.tar.zst.sig2020-06-14 06:13 310
[PGP]lib32-json-glib-1.6.2-1-x86_64.pkg.tar.zst.sig2021-03-08 05:15 310
[PGP]lib32-lcms2-2.12-1-x86_64.pkg.tar.zst.sig2021-02-09 05:20 310
[PGP]lib32-libaio-0.3.112-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libappindicator-gtk2-12.10.0-12-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]lib32-libappindicator-gtk3-12.10.0-12-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]lib32-libavc1394-0.5.4-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libcanberra-0.30+2+gc0620e4-3-x86_64.pkg.tar.zst.sig2020-05-08 06:13 310
[PGP]lib32-libcanberra-gstreamer-0.30+2+gc0620e4-3-x86_64.pkg.tar.zst.sig2020-05-08 06:13 310
[PGP]lib32-libcanberra-pulse-0.30+2+gc0620e4-3-x86_64.pkg.tar.zst.sig2020-05-08 06:13 310
[PGP]lib32-libcroco-0.6.13-1-x86_64.pkg.tar.xz.sig2019-11-09 05:13 310
[PGP]lib32-libcups-2.3.3-1-x86_64.pkg.tar.zst.sig2020-05-03 06:13 310
[PGP]lib32-libdaemon-0.14-6-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libdatrie-0.2.13-1-x86_64.pkg.tar.zst.sig2021-03-08 05:15 310
[PGP]lib32-libdbusmenu-glib-16.04.0-4-x86_64.pkg.tar.zst.sig2020-03-18 05:13 310
[PGP]lib32-libdbusmenu-gtk2-16.04.0-4-x86_64.pkg.tar.zst.sig2020-03-18 05:13 310
[PGP]lib32-libdbusmenu-gtk3-16.04.0-4-x86_64.pkg.tar.zst.sig2020-03-18 05:13 310
[PGP]lib32-libdrm-2.4.105-1-x86_64.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]lib32-libffi-3.3-2-x86_64.pkg.tar.zst.sig2020-04-09 06:13 310
[PGP]lib32-libgcrypt-1.9.2-1-x86_64.pkg.tar.zst.sig2021-02-21 05:14 310
[PGP]lib32-libgcrypt15-1.5.6-5-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libgpg-error-1.42-1-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]lib32-libgudev-236-1-x86_64.pkg.tar.zst.sig2021-03-24 05:22 310
[PGP]lib32-libgusb-0.3.6-1-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]lib32-libice-1.0.10-1-x86_64.pkg.tar.xz.sig2019-11-09 05:13 310
[PGP]lib32-libid3tag-0.15.1b-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libidn2-2.3.0-1-x86_64.pkg.tar.zst.sig2020-02-08 05:13 310
[PGP]lib32-libidn11-1.33-1-x86_64.pkg.tar.xz.sig2018-10-17 06:13 310
[PGP]lib32-libindicator-gtk2-12.10.1-8-x86_64.pkg.tar.zst.sig2020-03-18 05:13 310
[PGP]lib32-libindicator-gtk3-12.10.1-8-x86_64.pkg.tar.zst.sig2020-03-18 05:13 310
[PGP]lib32-libldap-2.4.58-1-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]lib32-libltdl-2.4.6+42+gb88cebd5-1-x86_64.pkg.tar.xz.sig2019-02-16 05:14 310
[PGP]lib32-libmikmod-3.3.11.1-4-x86_64.pkg.tar.zst.sig2020-01-12 05:16 310
[PGP]lib32-libmodplug-0.8.9.0-3-x86_64.pkg.tar.xz.sig2019-03-12 05:15 310
[PGP]lib32-libndp-1.7-1-x86_64.pkg.tar.xz.sig2018-10-01 06:14 310
[PGP]lib32-libnewt-0.52.21-1-x86_64.pkg.tar.xz.sig2019-06-04 06:14 310
[PGP]lib32-libnm-glib-1.18.5dev+12+ga8746f48ca-1-x86_64.pkg.tar.xz.sig2019-12-23 05:13 310
[PGP]lib32-libogg-1.3.4-2-x86_64.pkg.tar.zst.sig2020-05-09 06:13 310
[PGP]lib32-libpciaccess-0.16-1-x86_64.pkg.tar.xz.sig2019-07-21 06:14 310
[PGP]lib32-libpgm-5.3.128-2-x86_64.pkg.tar.zst.sig2020-12-06 05:18 310
[PGP]lib32-libproxy-0.4.17-1-x86_64.pkg.tar.zst.sig2021-01-20 05:15 310
[PGP]lib32-libpsl-0.21.1-1-x86_64.pkg.tar.zst.sig2020-09-06 03:17 310
[PGP]lib32-libraw1394-2.1.2-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-librtmp0-2.4-4-x86_64.pkg.tar.zst.sig2020-05-06 06:13 310
[PGP]lib32-libshout-2.4.5-1-x86_64.pkg.tar.zst.sig2021-01-30 05:15 310
[PGP]lib32-libsodium-1.0.18-1-x86_64.pkg.tar.xz.sig2019-06-04 06:14 310
[PGP]lib32-libsoup-2.72.0-1-x86_64.pkg.tar.zst.sig2020-10-08 06:13 310
[PGP]lib32-libssh2-1.9.0-1-x86_64.pkg.tar.xz.sig2019-11-09 05:13 310
[PGP]lib32-libtasn1-4.16.0-2-x86_64.pkg.tar.zst.sig2021-03-03 05:17 310
[PGP]lib32-libteam-1.31-1-x86_64.pkg.tar.zst.sig2020-07-31 06:13 310
[PGP]lib32-libthai-0.1.28-1-x86_64.pkg.tar.xz.sig2018-11-18 05:14 310
[PGP]lib32-libtheora-1.1.1-12-x86_64.pkg.tar.xz.sig2019-03-12 05:15 310
[PGP]lib32-libtiff4-3.9.7-4-x86_64.pkg.tar.xz.sig2019-04-07 06:13 310
[PGP]lib32-libtirpc-1.3.1-1-x86_64.pkg.tar.zst.sig2020-12-17 05:15 310
[PGP]lib32-libudev0-shim-1-4-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libunwind-1.5.0-1-x86_64.pkg.tar.zst.sig2021-03-01 05:14 310
[PGP]lib32-libva-2.11.0-1-x86_64.pkg.tar.zst.sig2021-03-25 05:15 310
[PGP]lib32-libva-mesa-driver-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-libvdpau-1.4-1-x86_64.pkg.tar.zst.sig2020-05-12 06:13 310
[PGP]lib32-libvpx-1.10.0-1-x86_64.pkg.tar.zst.sig2021-03-26 05:16 310
[PGP]lib32-libvpx1.3-1.3.0-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libwrap-7.6.31-1-x86_64.pkg.tar.zst.sig2021-03-19 05:23 310
[PGP]lib32-libx11-1.7.0-1-x86_64.pkg.tar.zst.sig2020-11-22 05:15 310
[PGP]lib32-libxau-1.0.9-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxcomposite-0.4.5-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxcursor-1.2.0-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxdamage-1.1.5-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxdmcp-1.1.3-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxext-1.3.4-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxfixes-5.0.3-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-libxft-2.3.3-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxkbcommon-1.2.1-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-libxkbcommon-x11-1.2.1-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-libxmu-1.1.3-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxrandr-1.5.2-1-x86_64.pkg.tar.xz.sig2019-04-28 06:14 310
[PGP]lib32-libxslt-1.1.34-1-x86_64.pkg.tar.xz.sig2019-11-22 05:13 310
[PGP]lib32-libxt-1.2.1-1-x86_64.pkg.tar.zst.sig2021-01-30 05:15 310
[PGP]lib32-libxvmc-1.0.12-1-x86_64.pkg.tar.xz.sig2019-11-09 05:13 310
[PGP]lib32-llvm-11.1.0-1-x86_64.pkg.tar.zst.sig2021-02-18 05:15 310
[PGP]lib32-llvm-libs-11.1.0-1-x86_64.pkg.tar.zst.sig2021-02-18 05:15 310
[PGP]lib32-lm_sensors-1:3.6.0.r41.g31d1f125-1-x86_64.pkg.tar.zst.sig2021-02-19 05:17 310
[PGP]lib32-mesa-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-mesa-vdpau-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-mpg123-1.26.5-1-x86_64.pkg.tar.zst.sig2021-03-24 05:22 310
[PGP]lib32-nettle-3.7.2-1-x86_64.pkg.tar.zst.sig2021-03-28 06:16 310
[PGP]lib32-ocl-icd-2.2.14-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]lib32-opencl-mesa-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-openssl-1.0-1.0.2.u-1-x86_64.pkg.tar.zst.sig2020-02-06 05:13 310
[PGP]lib32-openssl-1:1.1.1.k-1-x86_64.pkg.tar.zst.sig2021-03-26 05:16 310
[PGP]lib32-opus-1.3.1-1-x86_64.pkg.tar.xz.sig2019-04-23 06:14 310
[PGP]lib32-orc-0.4.32-1-x86_64.pkg.tar.zst.sig2020-09-14 06:13 310
[PGP]lib32-pam-1.5.1-1-x86_64.pkg.tar.zst.sig2021-01-30 05:15 310
[PGP]lib32-polkit-0.118-1-x86_64.pkg.tar.zst.sig2020-12-06 05:18 310
[PGP]lib32-popt-1.18-1-x86_64.pkg.tar.zst.sig2020-08-07 06:13 310
[PGP]lib32-procps-ng-3.3.17-1-x86_64.pkg.tar.zst.sig2021-02-16 05:17 310
[PGP]lib32-rest-0.8.1-3-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]lib32-sdl2-2.0.14-1-x86_64.pkg.tar.zst.sig2021-01-20 05:15 310
[PGP]lib32-sdl2_image-2.0.5-1-x86_64.pkg.tar.xz.sig2019-07-19 06:16 310
[PGP]lib32-sdl_mixer-1.2.12-3-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-sdl_ttf-2.0.11-5-x86_64.pkg.tar.xz.sig2019-02-16 05:14 310
[PGP]lib32-simplescreenrecorder-0.4.3-1-x86_64.pkg.tar.zst.sig2020-12-27 05:14 310
[PGP]lib32-soundtouch-2.2-1-x86_64.pkg.tar.zst.sig2020-10-17 06:13 310
[PGP]lib32-speex-1.2.0-2-x86_64.pkg.tar.xz.sig2018-11-10 05:23 310
[PGP]lib32-speexdsp-1.2.0-1-x86_64.pkg.tar.xz.sig2019-06-10 06:13 310
[PGP]lib32-sqlite-3.35.4-1-x86_64.pkg.tar.zst.sig2021-04-07 06:15 310
[PGP]lib32-taglib-1.12-1-x86_64.pkg.tar.zst.sig2021-02-21 05:14 310
[PGP]lib32-tcl-8.6.11-1-x86_64.pkg.tar.zst.sig2021-01-21 05:13 310
[PGP]lib32-twolame-0.4.0-2-x86_64.pkg.tar.zst.sig2021-03-04 05:15 310
[PGP]lib32-vulkan-icd-loader-1.2.174-1-x86_64.pkg.tar.zst.sig2021-04-17 06:16 310
[PGP]lib32-vulkan-intel-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-vulkan-mesa-layers-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-vulkan-radeon-21.0.2-1-x86_64.pkg.tar.zst.sig2021-04-09 06:15 310
[PGP]lib32-vulkan-validation-layers-1.2.172-1-x86_64.pkg.tar.zst.sig2021-03-13 05:14 310
[PGP]lib32-wavpack-5.4.0-1-x86_64.pkg.tar.zst.sig2021-01-30 05:15 310
[PGP]lib32-wayland-1.19.0-1-x86_64.pkg.tar.zst.sig2021-02-04 05:16 310
[PGP]lib32-xz-5.2.5-2-x86_64.pkg.tar.zst.sig2021-03-03 05:17 310
[PGP]lib32-zeromq-4.3.3-2-x86_64.pkg.tar.zst.sig2020-12-06 05:18 310
[PGP]lib32-zlib-1.2.11-3-x86_64.pkg.tar.zst.sig2021-03-03 05:17 310
[PGP]libaec-1.0.4-1-x86_64.pkg.tar.xz.sig2019-11-01 05:13 310
[PGP]libafterimage-1.20-5-x86_64.pkg.tar.zst.sig2020-06-07 21:38 310
[PGP]libanjuta-3.34.0-7-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]libappindicator-gtk2-12.10.0.r296-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]libappindicator-gtk3-12.10.0.r296-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]libappletdecoration-0.8.1-3-x86_64.pkg.tar.zst.sig2021-02-17 05:15 310
[PGP]libbraiding-1.1-1-x86_64.pkg.tar.zst.sig2020-09-13 06:13 310
[PGP]libclastfm-0.5-6-x86_64.pkg.tar.xz.sig2019-11-10 05:13 310
[PGP]libdbusmenu-glib-16.04.0-4-x86_64.pkg.tar.zst.sig2020-03-12 05:13 310
[PGP]libdbusmenu-gtk2-16.04.0-4-x86_64.pkg.tar.zst.sig2020-03-12 05:13 310
[PGP]libdbusmenu-gtk3-16.04.0-4-x86_64.pkg.tar.zst.sig2020-03-12 05:13 310
[PGP]libemf-1.0.13-1-x86_64.pkg.tar.zst.sig2020-06-28 06:13 310
[PGP]libev-4.33-1-x86_64.pkg.tar.zst.sig2020-03-23 05:13 310
[PGP]libextractor-1.9-3-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]libfabric-1.11.2-1-x86_64.pkg.tar.zst.sig2020-12-20 05:13 310
[PGP]libfilteraudio-0.0.1-5-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]libfm-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]libfm-extra-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]libfm-gtk2-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]libfm-gtk3-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]libfm-qt-0.16.0-2-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]libftdi-compat-0.20-8-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]libgeotiff-1.6.0-3-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]libgiac-1.7.0.1-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libgovirt-0.3.8-1-x86_64.pkg.tar.zst.sig2021-03-04 05:14 310
[PGP]libgsignon-glib-2.4.1-2-x86_64.pkg.tar.xz.sig2018-11-15 05:14 310
[PGP]libguestfs-1.42.0-5-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]libharu-2.3.0-4-x86_64.pkg.tar.zst.sig2020-08-21 06:13 310
[PGP]libhx-3.25-1-x86_64.pkg.tar.zst.sig2020-05-23 06:13 310
[PGP]libidn11-1.33-2-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]libiio-0.21-4-x86_64.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]libilbc-3.0.4-1-x86_64.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]libindi-1.8.9-1-x86_64.pkg.tar.zst.sig2021-03-01 05:14 310
[PGP]libindicator-gtk2-12.10.1-9-x86_64.pkg.tar.zst.sig2020-03-17 05:13 310
[PGP]libindicator-gtk3-12.10.1-9-x86_64.pkg.tar.zst.sig2020-03-17 05:13 310
[PGP]libinsane-1.0.9-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]libjamiclient-20210301-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]libjcat-0.1.6-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]libkkc-data-0.2.7-2-x86_64.pkg.tar.xz.sig2018-06-09 09:26 310
[PGP]libldm-0.2.5-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libmanette-0.2.6-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]libmatekbd-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]libmatemixer-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]libmateweather-1.24.1-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]libmfx-20.5.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]libmgba-0.9.0-1-x86_64.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]libmodsecurity-1:3.0.4-5-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]libmysofa-1.2-1-x86_64.pkg.tar.zst.sig2021-01-28 05:16 310
[PGP]libnest2d-0.4-1-x86_64.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]libnewt-0.52.21-5-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]libnfc-1.8.0-1-x86_64.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]libnih-1.0.3-4-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]libnm-glib-1.18.5dev+12+ga8746f48ca-1-x86_64.pkg.tar.xz.sig2019-12-23 05:13 310
[PGP]libopenshot-0.2.5-9-x86_64.pkg.tar.zst.sig2021-02-09 05:19 310
[PGP]libperconaserverclient-8.0.22_13-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]libpgm-5.3.128-1-x86_64.pkg.tar.zst.sig2020-09-08 06:13 310
[PGP]libpillowfight-0.3.0-3-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]libqb-1.0.5-2-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]libqtshadowsocks-2.1.0-13-x86_64.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]libqtxdg-3.6.0-2-x86_64.pkg.tar.zst.sig2020-11-21 05:15 310
[PGP]libquotient-0.6.6-1-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]libreoffice-extension-texmaths-0.49-1-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]libretro-beetle-pce-1072-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-beetle-pce-fast-1112-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-beetle-psx-2506-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-beetle-psx-hw-2506-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-beetle-supergrafx-916-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-blastem-1841-1-x86_64.pkg.tar.zst.sig2020-01-24 05:13 310
[PGP]libretro-bsnes-1:1224-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-bsnes-hd-30-1-x86_64.pkg.tar.zst.sig2021-01-23 05:13 310
[PGP]libretro-bsnes2014-1:566-1-x86_64.pkg.tar.zst.sig2020-03-31 06:13 310
[PGP]libretro-citra-6976-1-x86_64.pkg.tar.zst.sig2021-02-04 05:15 310
[PGP]libretro-core-info-1.9.1-1-any.pkg.tar.zst.sig2021-04-07 06:13 310
[PGP]libretro-desmume-6333-1-x86_64.pkg.tar.zst.sig2021-01-23 05:13 310
[PGP]libretro-dolphin-32984-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-duckstation-2105-1-x86_64.pkg.tar.zst.sig2020-09-06 03:15 310
[PGP]libretro-flycast-4417-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-gambatte-891-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-kronos-6598-1-x86_64.pkg.tar.zst.sig2020-05-29 06:13 310
[PGP]libretro-melonds-1801-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-mesen-2903-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]libretro-mesen-s-916-2-x86_64.pkg.tar.zst.sig2020-08-06 06:13 310
[PGP]libretro-mgba-6932-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-mupen64plus-next-1:343-1-x86_64.pkg.tar.zst.sig2020-12-02 05:13 310
[PGP]libretro-nestopia-1:57-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-overlays-175-1-any.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]libretro-parallel-n64-5219-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-picodrive-1263-1-x86_64.pkg.tar.zst.sig2020-03-03 05:14 310
[PGP]libretro-play-6390-1-x86_64.pkg.tar.zst.sig2021-03-24 05:17 310
[PGP]libretro-ppsspp-29055-1-x86_64.pkg.tar.zst.sig2021-02-04 05:15 310
[PGP]libretro-ppsspp-29499-1-x86_64.pkg.tar.zst.sig2021-03-24 05:18 310
[PGP]libretro-retrodream-1104-1-x86_64.pkg.tar.zst.sig2020-06-24 06:13 310
[PGP]libretro-sameboy-1288-1-x86_64.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]libretro-scummvm-93192-1-x86_64.pkg.tar.zst.sig2021-03-24 05:18 310
[PGP]libretro-shaders-glsl-292-1-any.pkg.tar.xz.sig2018-02-11 22:58 310
[PGP]libretro-shaders-slang-796-1-any.pkg.tar.zst.sig2021-03-24 05:18 310
[PGP]libretro-yabause-2953-1-x86_64.pkg.tar.xz.sig2017-12-22 20:27 310
[PGP]libretro-yabause-3303-1-x86_64.pkg.tar.zst.sig2021-03-24 05:18 310
[PGP]librsync-1:2.3.2-1-x86_64.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]librttopo-1.1.0-3-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]libsavitar-4.8.0-2-x86_64.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]libscanmem-0.17-4-x86_64.pkg.tar.zst.sig2020-11-13 05:16 310
[PGP]libsecp256k1-20201021+1209+gac05f61-1-x86_64.pkg.tar.zst.sig2020-10-25 05:13 310
[PGP]libsemigroups-1.3.7-1-x86_64.pkg.tar.zst.sig2021-03-01 05:14 310
[PGP]libsignal-protocol-c-2.3.3-1-x86_64.pkg.tar.zst.sig2020-04-09 06:13 310
[PGP]libsigrokdecode-0.5.3-3-x86_64.pkg.tar.zst.sig2020-12-04 05:13 310
[PGP]libspatialite-5.0.1-1-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]libsvm-3.24-3-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]libu2f-server-1.1.0-4-x86_64.pkg.tar.zst.sig2020-04-26 06:13 310
[PGP]libuhd-4.0.0.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:48 310
[PGP]libuhd-firmware-3.14.1.0-1-any.pkg.tar.xz.sig2019-08-17 06:16 310
[PGP]libuhd-firmware-4.0.0.0-1-any.pkg.tar.zst.sig2021-01-17 02:49 310
[PGP]libutf8proc-2.6.1-1-x86_64.pkg.tar.zst.sig2020-12-22 05:13 310
[PGP]libva-utils-2.11.1-1-x86_64.pkg.tar.zst.sig2021-04-05 06:13 310
[PGP]libvirt-1:7.1.0-3-x86_64.pkg.tar.zst.sig2021-03-22 05:18 310
[PGP]libvirt-glib-4.0.0-1-x86_64.pkg.tar.zst.sig2021-03-22 05:18 310
[PGP]libvirt-python-1:7.1.0-1-x86_64.pkg.tar.zst.sig2021-03-22 05:18 310
[PGP]libvirt-storage-gluster-1:7.1.0-3-x86_64.pkg.tar.zst.sig2021-03-22 05:19 310
[PGP]libvirt-storage-iscsi-direct-1:7.1.0-3-x86_64.pkg.tar.zst.sig2021-03-22 05:19 310
[PGP]libvirt-storage-rbd-1:7.1.0-3-x86_64.pkg.tar.zst.sig2021-03-22 05:19 310
[PGP]libvolk-2.4.1-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 310
[PGP]libwnck-2.31.0-3-x86_64.pkg.tar.xz.sig2019-12-11 05:13 310
[PGP]libwrap-7.6.31-1-x86_64.pkg.tar.zst.sig2021-03-19 05:17 310
[PGP]libx86emu-3.1-1-x86_64.pkg.tar.zst.sig2020-02-07 05:13 310
[PGP]libxml-perl-0.08-7-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]libxmlb-0.3.0-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]libxmlbird-1.2.12-1-x86_64.pkg.tar.zst.sig2020-10-23 06:14 310
[PGP]libxpresent-1.0.0-2-x86_64.pkg.tar.xz.sig2019-12-20 05:13 310
[PGP]libyuv-r2212+dfaf7534-2-x86_64.pkg.tar.zst.sig2020-12-23 05:13 310
[PGP]libzim-6.3.0-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]lifeograph-2.0.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 310
[PGP]light-locker-1.9.0-4-x86_64.pkg.tar.zst.sig2020-12-22 05:13 310
[PGP]lightdm-pantheon-greeter-5.0.4-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]linbox-1.6.3-3-x86_64.pkg.tar.zst.sig2020-05-20 06:13 310
[PGP]liquidshell-1.7.2-1-x86_64.pkg.tar.zst.sig2020-11-05 05:13 310
[PGP]lire-2.1.1-5-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]liteide-37.4-1-x86_64.pkg.tar.zst.sig2021-03-29 06:22 310
[PGP]livewallpaper-0.5.0.333-3-x86_64.pkg.tar.zst.sig2020-04-26 06:13 310
[PGP]lm32-elf-gdb-10.1-2-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]lmms-1.2.2-3-x86_64.pkg.tar.zst.sig2020-12-12 05:13 310
[PGP]lockdev-1.0.3_1.6-6-x86_64.pkg.tar.zst.sig2020-05-08 06:13 310
[PGP]logwatch-7.4.3-4-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]lolcat-100.0.0-3-any.pkg.tar.zst.sig2021-03-20 05:18 310
[PGP]lollypop-1.4.5-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]lollypop-1.4.19-1-any.pkg.tar.zst.sig2021-04-09 06:14 310
[PGP]lollypop-portal-0.9.7-1-any.pkg.tar.xz.sig2018-09-20 06:17 310
[PGP]lout-3.40-2-x86_64.pkg.tar.xz.sig2018-05-31 14:00 310
[PGP]lrcalc-2.1-1-x86_64.pkg.tar.zst.sig2021-02-23 05:13 310
[PGP]lrs-071.a-1-x86_64.pkg.tar.zst.sig2020-10-18 06:13 310
[PGP]ls++-1:0.36-4-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]lsdvd-0.17-4-x86_64.pkg.tar.zst.sig2020-04-06 06:13 310
[PGP]lua-penlight-1.5.4-2-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]lua-sdl2-2.0.5.6.0-3-x86_64.pkg.tar.zst.sig2020-07-17 06:13 310
[PGP]luakit-2.3-1-x86_64.pkg.tar.zst.sig2021-03-26 05:14 310
[PGP]luarocks5.1-2.4.4-1-any.pkg.tar.xz.sig2018-04-01 11:07 310
[PGP]luarocks5.2-2.4.4-1-any.pkg.tar.xz.sig2018-04-01 11:07 310
[PGP]lxde-icon-theme-0.5.1-4-any.pkg.tar.xz.sig2018-11-10 05:18 310
[PGP]lxhotkey-0.1.1-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]lxhotkey-gtk3-0.1.1-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]lxpanel-0.10.1-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]lxpanel-gtk3-0.10.1-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]lxsession-1:0.5.5-1-x86_64.pkg.tar.zst.sig2020-03-08 05:13 310
[PGP]lxsession-gtk3-1:0.5.5-1-x86_64.pkg.tar.zst.sig2020-03-08 05:13 310
[PGP]lxtask-0.1.10-1-x86_64.pkg.tar.zst.sig2020-10-28 05:13 310
[PGP]lxtask-gtk3-0.1.10-1-x86_64.pkg.tar.zst.sig2020-10-28 05:13 310
[PGP]lxterminal-0.4.0-1-x86_64.pkg.tar.zst.sig2021-02-21 05:13 310
[PGP]lynis-2.7.5-2-any.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]m2r-0.2.1-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]m4ri-20200125-1-x86_64.pkg.tar.zst.sig2020-01-26 05:13 310
[PGP]m4rie-20200125-1-x86_64.pkg.tar.zst.sig2020-01-29 05:13 310
[PGP]mach64-dri-7.11.2-11-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]magnum-2020.06-1-x86_64.pkg.tar.zst.sig2020-08-07 06:13 310
[PGP]magnum-plugins-2020.06-1-x86_64.pkg.tar.zst.sig2020-08-07 06:13 310
[PGP]mailman3-3.3.2-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mailnag-2.0.0-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mailnag-2.2.0-2-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mailnag-gnome-shell-3.38.1-2-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]maliit-framework-2.0.0-2-x86_64.pkg.tar.zst.sig2021-04-04 06:14 310
[PGP]maliit-keyboard-2.0.0-2-x86_64.pkg.tar.zst.sig2021-04-04 06:14 310
[PGP]mame-0.230-1-x86_64.pkg.tar.zst.sig2021-04-01 06:13 310
[PGP]mame-tools-0.230-1-x86_64.pkg.tar.zst.sig2021-04-01 06:13 310
[PGP]mandown-0.1.2-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 310
[PGP]manuskript-0.11.0-1-any.pkg.tar.zst.sig2020-08-01 06:13 310
[PGP]marco-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]marker-2020.04.04.2-3-x86_64.pkg.tar.zst.sig2020-07-23 06:13 310
[PGP]massif-visualizer-0.7.0-3-x86_64.pkg.tar.zst.sig2020-05-10 06:13 310
[PGP]mate-applet-dock-0.89-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mate-applet-dock-20.04.0-1-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-applets-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]mate-backgrounds-1.24.2-1-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-calc-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-common-1.24.2-1-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-control-center-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-desktop-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]mate-icon-theme-1.24.0-1-any.pkg.tar.zst.sig2020-02-26 05:13 310
[PGP]mate-media-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]mate-menu-18.04.3-1-any.pkg.tar.xz.sig2018-05-10 08:36 310
[PGP]mate-menus-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]mate-netbook-1.24.0-1-x86_64.pkg.tar.zst.sig2020-02-26 05:13 310
[PGP]mate-notification-daemon-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-panel-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-polkit-1.24.0-1-x86_64.pkg.tar.zst.sig2020-02-26 05:13 310
[PGP]mate-power-manager-1.24.3-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-screensaver-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-session-manager-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-settings-daemon-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-system-monitor-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-terminal-1.24.1-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]mate-themes-3.22.22-1-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mate-user-guide-1.24.0-1-any.pkg.tar.zst.sig2020-02-26 05:13 310
[PGP]mate-user-share-1.24.0-1-x86_64.pkg.tar.zst.sig2020-02-26 05:13 310
[PGP]mate-utils-1.24.0-1-x86_64.pkg.tar.zst.sig2020-02-26 05:13 310
[PGP]materia-gtk-theme-20210322-2-any.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]materia-kde-20210410-1-any.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]mathjax-3.0.0-1-any.pkg.tar.xz.sig2019-09-05 06:15 310
[PGP]mathjax-3.1.2-1-any.pkg.tar.zst.sig2020-09-13 06:13 310
[PGP]mathjax2-2.7.5-1-any.pkg.tar.xz.sig2019-09-05 06:15 310
[PGP]mathjax2-2.7.9-1-any.pkg.tar.zst.sig2020-09-06 03:15 310
[PGP]mathomatic-16.0.5-7-x86_64.pkg.tar.zst.sig2020-01-15 05:13 310
[PGP]matrix-appservice-irc-0.13.0-1-any.pkg.tar.xz.sig2019-09-30 06:13 310
[PGP]matterbridge-1.22.1-1-x86_64.pkg.tar.zst.sig2021-04-05 06:13 310
[PGP]mattermost-5.33.3-1-x86_64.pkg.tar.zst.sig2021-04-05 06:14 310
[PGP]maui-clip-1.1.0-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]maui-nota-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]maui-pix-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]maui-shelf-1.1.0-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]maui-station-1.2.1-2-x86_64.pkg.tar.zst.sig2021-03-29 06:22 310
[PGP]mauikit-1.2.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]maxcso-1.12.0-1-x86_64.pkg.tar.zst.sig2020-05-19 06:13 310
[PGP]mbedtls-2.25.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:49 310
[PGP]mcqd-1.0.0-2-x86_64.pkg.tar.zst.sig2020-05-10 06:13 310
[PGP]mdf2iso-0.3.1-4-x86_64.pkg.tar.zst.sig2021-02-19 05:14 310
[PGP]med-4.1.0-3-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mediastreamer-4.5.3-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]mediawiki-1.35.1-2-any.pkg.tar.zst.sig2021-01-24 05:15 310
[PGP]mediawiki-math-1.35.1-2-any.pkg.tar.zst.sig2021-01-24 05:15 310
[PGP]mednafen-1.26.1-1-x86_64.pkg.tar.zst.sig2020-11-22 05:14 310
[PGP]megaglest-3.13.0-7-x86_64.pkg.tar.zst.sig2020-04-26 06:13 310
[PGP]meilisearch-0.20.0-1-x86_64.pkg.tar.zst.sig2021-04-01 06:13 310
[PGP]memconf-3.15-1-any.pkg.tar.zst.sig2020-05-10 06:13 310
[PGP]menu-cache-1.1.0-2-x86_64.pkg.tar.zst.sig2020-05-28 06:13 310
[PGP]merkaartor-0.18.4-5-x86_64.pkg.tar.zst.sig2021-01-17 02:49 310
[PGP]metacity-3.38.0-1-x86_64.pkg.tar.zst.sig2020-10-23 06:14 310
[PGP]metacity-3.40.0-1-x86_64.pkg.tar.zst.sig2021-04-21 06:13 310
[PGP]mfoc-0.10.7+38+gba072f1-1-x86_64.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]mg-20200723-1-x86_64.pkg.tar.zst.sig2020-12-13 05:14 310
[PGP]mga-dri-7.11.2-11-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]mgard-0.1.0-1-x86_64.pkg.tar.zst.sig2020-10-15 06:13 310
[PGP]mgba-qt-0.9.0-1-x86_64.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]mgba-sdl-0.9.0-1-x86_64.pkg.tar.zst.sig2021-04-11 06:14 310
[PGP]milkytracker-1.03.00-1-x86_64.pkg.tar.zst.sig2020-12-29 05:16 310
[PGP]mimetic-0.9.8-2-x86_64.pkg.tar.zst.sig2020-05-10 06:13 310
[PGP]minetest-5.4.1-1-x86_64.pkg.tar.zst.sig2021-04-13 06:13 310
[PGP]minetest-common-5.4.1-1-x86_64.pkg.tar.zst.sig2021-04-13 06:13 310
[PGP]minetest-server-5.4.1-1-x86_64.pkg.tar.zst.sig2021-04-13 06:13 310
[PGP]ming-0.4.8.r68.g04aee523-2-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]miniupnpc-2.1.20191224-3-x86_64.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]mit-scheme-11.2-1-x86_64.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]mkosi-6-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mksh-59.c-1-x86_64.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]mldonkey-3.1.7-1-x86_64.pkg.tar.zst.sig2020-06-27 06:14 310
[PGP]mlton-20200817-1-x86_64.pkg.tar.zst.sig2020-08-22 06:13 310
[PGP]mmtf-cpp-1.0.0-3-any.pkg.tar.zst.sig2021-03-02 05:13 310
[PGP]modem-manager-gui-0.0.20-1-x86_64.pkg.tar.zst.sig2020-10-23 06:14 310
[PGP]moneymanagerex-1.3.3-3-x86_64.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]monitoring-plugins-2.3-1-x86_64.pkg.tar.zst.sig2021-01-17 02:50 310
[PGP]mono-msbuild-16.8.xamarinxplat.2020.07.30.15.02-2-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]mono-msbuild-sdkresolver-16.8.xamarinxplat.2020.07.30.15.02-2-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]moosefs-3.0.115-1-x86_64.pkg.tar.zst.sig2020-10-11 06:13 310
[PGP]mopidy-3.0.2-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]moserial-3.0.16-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]mosquitto-2.0.10-1-x86_64.pkg.tar.zst.sig2021-04-12 06:13 310
[PGP]mozo-1.24.1-1-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]mps-youtube-0.2.8-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mtpaint-3.50.05-1-x86_64.pkg.tar.zst.sig2021-02-09 05:19 310
[PGP]mujs-1.1.1-1-x86_64.pkg.tar.zst.sig2021-04-15 06:15 310
[PGP]multitail-6.5.0-1-x86_64.pkg.tar.xz.sig2019-11-11 05:13 310
[PGP]mumble-1.3.4-4-x86_64.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]mupen64plus-2.5-18-x86_64.pkg.tar.zst.sig2020-12-13 05:16 310
[PGP]murmur-1.3.4-4-x86_64.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]muse-3.1.1-2-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mutagen-1.41.1-1-any.pkg.tar.xz.sig2018-12-28 05:14 310
[PGP]mutagen-1.42.0-1-any.pkg.tar.xz.sig2019-01-05 05:13 310
[PGP]mutagen-tools-1.42.0-2-any.pkg.tar.xz.sig2019-02-17 05:13 310
[PGP]mypaint-2.0.0-2-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]mypaint-2.0.1-1-x86_64.pkg.tar.zst.sig2021-04-21 06:14 310
[PGP]mythes-fr-2.3-4-any.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]mythes-hu-1:1.0-1-any.pkg.tar.xz.sig2018-12-25 02:00 310
[PGP]mythes-nl-20140818-3-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]mythes-pl-1:0.8.67-1-any.pkg.tar.zst.sig2020-11-03 05:14 310
[PGP]naev-0.7.0-2-x86_64.pkg.tar.xz.sig2018-11-09 05:15 310
[PGP]namazu-2.0.21-4-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]nautilus-terminal-3.5.0-1-any.pkg.tar.zst.sig2021-04-18 06:14 310
[PGP]nauty-27r1-2-x86_64.pkg.tar.zst.sig2021-03-05 05:14 310
[PGP]navit-0.5.6-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]ncdu-1.15.1-2-x86_64.pkg.tar.zst.sig2020-09-06 03:15 310
[PGP]neatvnc-0.4.0-2-x86_64.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]neko-2.3.0-4-x86_64.pkg.tar.zst.sig2021-01-17 02:51 310
[PGP]nemo-qt-components-2.0.15-4-x86_64.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]neochat-1.1.1-1-x86_64.pkg.tar.zst.sig2021-02-24 05:14 310
[PGP]neovim-qt-0.2.16.1-1-x86_64.pkg.tar.zst.sig2020-06-25 06:14 310
[PGP]netcdf-4.7.4-1-x86_64.pkg.tar.zst.sig2020-04-11 06:13 310
[PGP]netcdf-cxx-4.3.1-2-x86_64.pkg.tar.zst.sig2020-04-13 06:13 310
[PGP]netcdf-fortran-4.5.2-2-x86_64.pkg.tar.zst.sig2020-04-13 06:13 310
[PGP]netcdf-fortran-4.5.3-1-x86_64.pkg.tar.zst.sig2020-07-28 06:13 310
[PGP]netcdf-fortran-openmpi-4.5.3-1-x86_64.pkg.tar.zst.sig2020-07-28 06:13 310
[PGP]netcdf-openmpi-4.7.4-1-x86_64.pkg.tar.zst.sig2020-04-12 06:13 310
[PGP]netfilter-fullconenat-r73.0cf3b48-18-any.pkg.tar.zst.sig2020-05-10 06:13 310
[PGP]netfilter-fullconenat-r73.0cf3b48-20-any.pkg.tar.zst.sig2020-05-15 06:13 310
[PGP]nethack-3.6.6-1-x86_64.pkg.tar.xz.sig2020-03-19 05:13 310
[PGP]nethogs-0.8.6-1-x86_64.pkg.tar.zst.sig2020-04-17 06:13 310
[PGP]netstandard-targeting-pack-5.0.5.sdk202-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]netsurf-buildsystem-1.9-1-any.pkg.tar.zst.sig2020-06-21 06:14 310
[PGP]networkmanager-dispatcher-ntpd-1.0-7-any.pkg.tar.xz.sig2018-06-02 15:17 310
[PGP]networkmanager-dispatcher-openntpd-1.0-6-any.pkg.tar.xz.sig2018-06-02 15:22 310
[PGP]networkmanager-dispatcher-sshd-1.0-5-any.pkg.tar.xz.sig2018-06-02 15:25 310
[PGP]networkmanager-fortisslvpn-1.4rc1-3-x86_64.pkg.tar.zst.sig2021-02-06 05:14 310
[PGP]networkmanager-l2tp-1.8.6-4-x86_64.pkg.tar.zst.sig2021-02-09 05:19 310
[PGP]newsflash-1.4.0-3-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]nfoview-1.28-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]ngircd-26-1-x86_64.pkg.tar.zst.sig2020-06-23 06:13 310
[PGP]ngspice-33-1-x86_64.pkg.tar.zst.sig2020-10-23 06:14 310
[PGP]nicotine+-2.1.2-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]nicotine+-3.0.4-1-any.pkg.tar.zst.sig2021-04-09 06:14 310
[PGP]nlopt-2.7.0-1-x86_64.pkg.tar.zst.sig2020-12-20 05:13 310
[PGP]nodejs-emojione-4.5.0-3-any.pkg.tar.zst.sig2021-02-07 05:14 310
[PGP]nodejs-lts-erbium-12.22.0-2-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]nomacs-1:3.17.2206-3-x86_64.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]normaliz-3.8.10-1-x86_64.pkg.tar.zst.sig2021-02-12 05:15 310
[PGP]nota-1.2.0-1-x86_64.pkg.tar.zst.sig2020-11-26 05:14 310
[PGP]notify-sharp-3-3.0.3-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]nrpe-4.0.3-1-x86_64.pkg.tar.zst.sig2020-08-16 06:13 310
[PGP]nsd-4.3.6-1-x86_64.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]nsgenbind-0.8-1-x86_64.pkg.tar.zst.sig2020-06-21 06:14 310
[PGP]nsjail-3.0-2-x86_64.pkg.tar.zst.sig2021-03-14 05:16 310
[PGP]nspluginwrapper-1.4.4-4-x86_64.pkg.tar.xz.sig2018-06-09 13:27 310
[PGP]ntl-11.4.4-1-x86_64.pkg.tar.zst.sig2021-03-06 05:13 310
[PGP]nullmailer-2.2-3-x86_64.pkg.tar.zst.sig2020-10-15 06:13 310
[PGP]numix-gtk-theme-2.6.7-1-any.pkg.tar.xz.sig2017-10-10 20:08 310
[PGP]numix-themes-2.6.6-1-any.pkg.tar.xz.sig2017-02-22 19:22 310
[PGP]nvchecker-2.2-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]nyx-2.1.0-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]obconf-2.0.4-7-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]oblogout-0.2-19-any.pkg.tar.xz.sig2018-01-13 17:31 310
[PGP]obmenu-1.0-12-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]obs-studio-26.1.2-2-x86_64.pkg.tar.zst.sig2021-03-20 05:18 310
[PGP]ocaml-findlib-1.9.1-1-x86_64.pkg.tar.zst.sig2021-04-20 06:13 310
[PGP]ocrfeeder-0.8.3-4-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]octave-6.2.0-1-x86_64.pkg.tar.zst.sig2021-02-28 05:15 310
[PGP]ode-0.16.1-1-x86_64.pkg.tar.zst.sig2020-03-20 05:13 310
[PGP]ogmtools-1.5-9-x86_64.pkg.tar.zst.sig2020-04-06 06:13 310
[PGP]onboard-1.4.1-6-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]opam-2.0.8-1-x86_64.pkg.tar.zst.sig2021-02-12 05:15 310
[PGP]openbve-1.7.2.4-1-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]opencascade-7.5.0-3-x86_64.pkg.tar.zst.sig2020-12-04 05:13 310
[PGP]opencsg-1.4.2-3-x86_64.pkg.tar.zst.sig2020-04-26 06:13 310
[PGP]opendht-1:2.1.10-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]openethereum-3.2.4-1-x86_64.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]openfortivpn-1.16.0-2-x86_64.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]openipmi-2.0.30-1-x86_64.pkg.tar.zst.sig2020-12-26 05:15 310
[PGP]openlibm-0.7.5-1-x86_64.pkg.tar.zst.sig2021-02-18 05:13 310
[PGP]openmotif-2.3.8-3-x86_64.pkg.tar.zst.sig2020-09-28 06:13 310
[PGP]openrct2-0.3.3-3-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]openscad-2021.01-1-x86_64.pkg.tar.zst.sig2021-04-15 06:15 310
[PGP]opensmtpd-6.8.0p2-1-x86_64.pkg.tar.zst.sig2020-12-25 05:14 310
[PGP]opensmtpd-filter-rspamd-0.1.7-2-x86_64.pkg.tar.zst.sig2021-02-22 05:15 310
[PGP]opentimelineio-0.13-1-x86_64.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]opentoonz-1.5.0-1-x86_64.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]opentoonz-1.5.0-2-x86_64.pkg.tar.zst.sig2021-04-21 06:14 310
[PGP]openttd-opengfx-0.6.1-1-any.pkg.tar.zst.sig2021-04-02 06:13 310
[PGP]openvkl-0.12.0-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]openvr-1.16.8-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]openzwave-1.6-4-x86_64.pkg.tar.zst.sig2020-11-03 05:15 310
[PGP]opnplug-1.0.2-2-x86_64.pkg.tar.zst.sig2020-10-29 05:14 310
[PGP]optional-lite-3.4.0-1-any.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]opus-tools-0.2-3-x86_64.pkg.tar.zst.sig2020-08-17 06:13 310
[PGP]opusfile-0.12-1-x86_64.pkg.tar.zst.sig2020-08-17 06:13 310
[PGP]orcania-2.2.0-1-x86_64.pkg.tar.zst.sig2021-03-19 05:21 310
[PGP]ortp-4.5.3-1-x86_64.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]osinfo-db-20210312-1-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]osinfo-db-tools-1.9.0-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]osm-gps-map-1.2.0-1-x86_64.pkg.tar.zst.sig2021-02-08 05:13 310
[PGP]ospray-2.5.0-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]otf-cormorant-3.609-1-any.pkg.tar.zst.sig2020-10-13 06:13 310
[PGP]otf-ipaexfont-004.01-2-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]otf-ipafont-003.03-6-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]otf-ipafont-003.03-8-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]otf-ipamjfont-006.01-2-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]otf-latin-modern-2.004-4-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]otf-latinmodern-math-1.959-4-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]otf-overpass-3.0.4-2-any.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]owncloud-client-2.7.6.3261-1-x86_64.pkg.tar.zst.sig2021-02-10 05:13 310
[PGP]oxipng-4.0.3-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]oxyromon-0.7.0-1-x86_64.pkg.tar.zst.sig2021-04-03 06:13 310
[PGP]packagekit-qt5-1.0.2-1-x86_64.pkg.tar.zst.sig2020-02-22 05:13 310
[PGP]packeth-2.1-2-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]palp-1:2.20-1-x86_64.pkg.tar.zst.sig2020-10-20 06:13 310
[PGP]pam-krb5-4.10-1-x86_64.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]pam_mount-2.18-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]pan-0.146-3-x86_64.pkg.tar.zst.sig2020-12-24 05:14 310
[PGP]pantheon-applications-menu-2.7.1-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-calculator-1.6.0-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-camera-1.0.6-1-x86_64.pkg.tar.zst.sig2020-05-29 06:13 310
[PGP]pantheon-camera-1.0.6-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-code-3.4.1-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-files-4.5.0-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-geoclue2-agent-1.0.4-1-x86_64.pkg.tar.zst.sig2020-04-16 06:13 310
[PGP]pantheon-music-5.0.5-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-photos-2.7.0-3-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-polkit-agent-1.0.3-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-screenshot-1.7.1-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-shortcut-overlay-1.1.2-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-terminal-5.5.2-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]pantheon-videos-2.7.2-2-x86_64.pkg.tar.zst.sig2021-03-30 06:19 310
[PGP]paperwork-2.0.2-1-any.pkg.tar.zst.sig2021-01-23 05:14 310
[PGP]paps-0.7.1-2-x86_64.pkg.tar.zst.sig2020-09-06 03:16 310
[PGP]paraview-5.9.0-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]pari-2.13.1-2-x86_64.pkg.tar.zst.sig2021-03-29 06:23 310
[PGP]pari-elldata-20210301-1-any.pkg.tar.zst.sig2021-03-02 05:13 310
[PGP]pari-galdata-20080411-3-any.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]pari-galpol-20180625-2-any.pkg.tar.zst.sig2020-03-30 06:13 310
[PGP]pari-seadata-20090618-2-any.pkg.tar.zst.sig2020-03-30 06:13 310
[PGP]pari-seadata-small-20090618-3-any.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]parity-1.11.11-1-x86_64.pkg.tar.xz.sig2018-09-20 06:17 310
[PGP]partclone-0.3.17-1-x86_64.pkg.tar.zst.sig2020-11-09 05:13 310
[PGP]partimage-0.6.9-13-x86_64.pkg.tar.zst.sig2020-05-31 06:13 310
[PGP]patchutils-0.4.2-1-x86_64.pkg.tar.zst.sig2020-11-04 05:14 310
[PGP]pax-20201030-1-x86_64.pkg.tar.zst.sig2020-12-19 05:14 310
[PGP]paxtest-0.9.15-3-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]pbzip2-1.1.13-3-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]pcb-1:4.2.2-1-x86_64.pkg.tar.zst.sig2020-06-07 21:39 310
[PGP]pcmanfm-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]pcmanfm-gtk3-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-14 05:17 310
[PGP]pcsc-perl-1.4.14-11-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]pcsx2-1.7.0.r1154.bc477e1ce-1-x86_64.pkg.tar.zst.sig2021-03-25 05:14 310
[PGP]pcurses-5-2-x86_64.pkg.tar.xz.sig2019-10-22 06:13 310
[PGP]pd-gem-0.94-5-x86_64.pkg.tar.zst.sig2021-01-31 05:13 310
[PGP]pdf2djvu-0.9.17.1-8-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]pdfarranger-1.6.2-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pdfarranger-1.7.1-1-any.pkg.tar.zst.sig2021-03-14 05:13 310
[PGP]pdfmixtool-0.6-1-x86_64.pkg.tar.zst.sig2020-05-28 06:13 310
[PGP]pdfmod-0.9.1-11-any.pkg.tar.zst.sig2020-03-11 05:13 310
[PGP]pdfsam-4.2.0-1-any.pkg.tar.zst.sig2020-11-04 05:14 310
[PGP]pdfshuffler-0.6.0-4-any.pkg.tar.xz.sig2017-11-03 23:58 310
[PGP]pdfslicer-1.8.8-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]peda-1.1-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pekwm-0.1.18-1-x86_64.pkg.tar.zst.sig2020-11-28 05:15 310
[PGP]pencil2d-0.6.6-1-x86_64.pkg.tar.zst.sig2021-02-28 05:15 310
[PGP]penguin-subtitle-player-1.3.1-1-x86_64.pkg.tar.zst.sig2020-07-10 06:13 310
[PGP]percona-server-8.0.22_13-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]percona-server-clients-8.0.22_13-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]performous-1.1-28-x86_64.pkg.tar.zst.sig2020-12-13 05:16 310
[PGP]perl-acme-alien-dontpanic-1.03-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-acme-alien-dontpanic-2.1100-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-alien-base-modulebuild-1.06-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-alien-cmake3-0.04-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-alien-sdl-1.446-10-x86_64.pkg.tar.zst.sig2021-02-27 05:13 310
[PGP]perl-anyevent-xmpp-0.55-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-app-borgrestore-3.3.0-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-archive-cpio-0.10-4-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-archive-extract-0.86-2-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-authen-sasl-2.16-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-authen-sasl-2.16-7-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-b-hooks-endofscope-0.24-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-berkeleydb-0.55-9-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-canary-stability-2013-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-canary-stability-2013-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-cgi-4.43-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-cgi-formbuilder-3.10-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-cgi-session-4.48-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-chart-2.4.10-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-class-accessor-chained-0.01-8-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-class-method-modifiers-2.12-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-class-singleton-1.5-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-class-tiny-1.006-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-color-calc-1.074-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-convert-asn1-0.27-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-convert-tnef-0.18-7-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-convert-tnef-0.18-8-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-cpan-changes-0.400002-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-cpan-meta-check-0.014-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-cpan-perl-releases-3.16-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-cpanplus-0.9176-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-cpanplus-dist-arch-1.32-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-crypt-des-2.07-11-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-crypt-simple-0.06-9-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-crypt-smbhash-0.12-7-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-curses-ui-0.9609-7-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-cwd-guard-0.05-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-dump-1.23-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-dump-1.23-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-data-hierarchy-0.34-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-munge-0.097-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-optlist-0.110-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-perl-0.002009-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-section-0.200007-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-data-section-0.200007-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-data-uuid-1.221-8-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-data-validate-ip-0.27-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-datetime-calendar-julian-0.04-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-datetime-cron-simple-0.2-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-datetime-event-ical-0.13-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-datetime-event-recurrence-0.19-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-datetime-format-ical-0.09-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-datetime-format-iso8601-0.08-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-datetime-format-w3cdtf-0.07-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-datetime-set-0.3900-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-dbi-shell-11.95-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-dbi-shell-11.95-9-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-devel-checkbin-0.04-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-devel-checklib-1.13-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-devel-patchperl-1.52-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-devel-stacktrace-2.03-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-device-modem-1.57-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-digest-bubblebabble-0.02-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-digest-bubblebabble-0.02-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-dir-self-0.11-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-dist-checkconflicts-0.11-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-djabberd-0.85-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-djabberd-rosterstorage-sqlite-1.00-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-email-abstract-3.008-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-email-address-xs-1.04-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-email-address-xs-1.04-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-email-reply-1.204-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-eval-closure-0.14-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-exception-class-1.44-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-extutils-cppguess-0.19-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-extutils-helpers-0.026-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-extutils-installpaths-0.012-4-any.pkg.tar.zst.sig2020-07-11 06:13 310
[PGP]perl-extutils-xsbuilder-0.28-8-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-file-find-rule-perl-1.15-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-finder-0.53-6-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-file-next-1.16-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-path-expand-1.02-12-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-path-tiny-0.9-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-sharedir-install-0.13-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-sharedir-projectdistdir-1.000009-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-slurp-tiny-0.004-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-slurp-tiny-0.004-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-file-tail-1.3-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-file-type-0.22-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-filesys-df-0.92-11-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-finance-quote-1.47-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-font-afm-1.20-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-font-ttf-1.06-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-gdgraph-1.54-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-gdtextutil-0.86-6-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-gettext-0.01-9-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-glib-object-introspection-0.047-5-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-gnupg-interface-0.52-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-goocanvas2-0.06-3-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]perl-graphics-colornames-2.11-8-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-graphviz-2.24-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-hook-lexwrap-0.26-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-html-scrubber-0.17-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-html-strip-2.10-8-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-html-tableextract-2.15-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-html-tagfilter-1.03-11-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-html-template-expr-0.07-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-http-lite-2.44-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-http-response-encoding-0.06-5-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-ical-parser-1.21-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-image-info-1.41-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-image-info-1.41-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-image-size-3.300-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-import-into-1.002005-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-import-into-1.002005-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-inline-cpp-0.80-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-inline-filters-0.20-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-io-all-0.87-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-io-bufferedselect-1.0-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-io-digest-0.11-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-io-multiplex-1.16-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-io-multiplex-1.16-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-io-pager-0.40-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-io-pipely-0.005-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-ipc-shareable-0.61-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-json-any-1.39-5-any.pkg.tar.xz.sig2018-09-20 06:18 310
[PGP]perl-json-xs-4.0-4-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-lingua-en-inflect-1.904-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-list-allutils-0.15-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-list-someutils-0.56-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-list-someutils-0.56-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-list-utilsby-0.11-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-list-utilsby-0.11-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-local-lib-2.000024-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-locale-maketext-lexicon-1.00-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-locale-po-0.27-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-log-any-1.707-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-log-any-adapter-log4perl-0.09-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-log-any-adapter-tap-0.003003-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-log-message-simple-0.10-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-mail-box-parser-c-3.008-8-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-mail-sendmail-0.79-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-mail-spf-query-1.999.1-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-math-base85-0.4-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-math-random-isaac-1.004-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-mime-base32-1.303-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-mime-base32-1.303-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-mime-tools-5.509-7-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-module-build-xsutil-0.19-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-module-implementation-0.09-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-module-install-1.19-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-module-manifest-1.08-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-module-scandeps-1.27-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-moo-2.003004-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-moox-handlesvia-0.001008-7-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-moox-late-0.015-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-mro-compat-0.13-4-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-namespace-autoclean-0.28-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-namespace-autoclean-0.29-2-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-namespace-clean-0.27-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-idn-encode-2.500-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-idn-encode-2.500-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-net-imap-simple-1.2207-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-net-ipv4addr-0.10-11-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-ipv6addr-0.2-11-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-jabber-2.0-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-jabber-2.0-11-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-net-ldap-server-0.43-7-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-oauth-0.28-9-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-snmp-6.0.1-7-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-net-xmpp-1.05-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-number-bytes-human-0.11-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-object-accessor-0.48-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-object-event-1.23-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-object-realize-later-0.21-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-package-stash-0.38-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-package-stash-0.38-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-par-dist-0.49-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-parallel-forkmanager-1.20-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-params-validationcompiler-0.30-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-patchreader-0.9.6-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-path-class-0.37-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-path-finddev-0.5.3-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-path-isdev-1.001003-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-path-tiny-0.108-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-pegex-0.70-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-perl-critic-1.134-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-pkgconfig-0.23026-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-pkgconfig-libpkgconf-0.11-2-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-pod-spell-1.20-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-poe-component-client-dns-1.054-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-poe-component-client-http-0.949-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-poe-component-client-keepalive-0.272-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-poe-component-ikc-0.2402-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-poe-component-resolver-0.921-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-ppi-1.269-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-ppix-utilities-1.001000-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-proc-simple-1.32-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-regexp-common-2017060201-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-regexp-common-2017060201-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-regexp-shellish-0.93-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-return-multilevel-0.05-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-role-tiny-2.000006-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-scope-guard-0.21-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sgmls-1:1.1-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-shell-guess-0.09-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-software-license-0.103014-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sort-naturally-1.03-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sort-naturally-1.03-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-sort-versions-1.62-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sort-versions-1.62-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-statistics-descriptive-3.0702-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-strictures-2.000006-2-any.pkg.tar.xz.sig2019-06-02 06:13 310
[PGP]perl-strictures-2.000006-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-sub-exporter-0.987-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sub-exporter-0.987-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-sub-info-0.002-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sub-name-0.26-2-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-sub-uplevel-0.2800-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-switch-2.17-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-sys-syscall-0.25-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-task-weaken-1.06-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-term-animation-2.6-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-term-progressbar-2.22-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-term-read-password-0.11-9-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-term-readline-gnu-1.36-4-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-term-table-0.013-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-term-ui-0.46-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-differences-0.64-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-distmanifest-1.014-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-test-exit-0.11-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-failwarnings-0.008-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-fatal-0.014-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-file-1.443-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-inter-1.09-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-minimumversion-0.101082-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-mocktime-0.17-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-mocktime-0.17-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-test-more-utf8-0.05-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-needs-0.002006-3-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-test-object-0.08-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-output-1.031-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-perltidy-20130104-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-test-requiresinternet-0.05-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-requiresinternet-0.05-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-test-script-1.25-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-spec-0.54-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-subcalls-1.10-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-tester-0.109-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-test-trap-0.3.4-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-utf8-1.01-4-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-test-without-module-0.20-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test-yaml-1.07-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-test2-suite-0.000122-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-text-charwidth-0.04-19-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-text-markdown-1.000031-8-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-text-query-0.09-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-text-template-1.55-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-text-vfile-asdata-0.08-6-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-throwable-0.200013-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-tie-ixhash-1.23-4-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-time-human-1.03-10-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-time-modules-2013.0912-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-tk-tablematrix-1.23-22-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-type-tiny-1.004002-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-types-serialiser-1.0-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-unicode-stringprep-1.105-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-unicode-stringprep-1.105-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-user-identity-0.99-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-variable-magic-0.62-5-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-www-sms-0.09-11-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-x11-protocol-other-30-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-xml-libxml-prettyprint-0.006-4-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-xml-libxml-simple-0.99-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-xml-rss-1.60-3-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-xml-rsslite-0.15-5-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-xml-sax-expat-0.51-6-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]perl-xml-smart-1.79-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-xml-smart-1.79-6-any.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]perl-xml-writer-0.625-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-xml-xpath-1.44-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perl-yaml-tiny-1.73-4-any.pkg.tar.zst.sig2020-07-11 06:13 310
[PGP]perlbrew-0.86-2-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]perlio-via-dynamic-0.14-5-any.pkg.tar.xz.sig2019-05-26 06:13 310
[PGP]permlib-0.2.9-1-any.pkg.tar.xz.sig2019-11-20 05:13 310
[PGP]phodav-2.5-1-x86_64.pkg.tar.zst.sig2020-10-25 05:13 310
[PGP]photoflare-1.6.7-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]phototonic-2.1-2-x86_64.pkg.tar.zst.sig2020-07-10 06:13 310
[PGP]php-geoip-1.1.1-6-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]php-memcache-8.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]php-memcached-3.1.5.r16.gbfb0a66-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]php-mongodb-1.9.1-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]php7-geoip-1.1.1-6-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]php7-memcache-8.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]php7-memcached-3.1.5.r16.gbfb0a66-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]php7-mongodb-1.9.1-3-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]phpldapadmin-1.2.6.2-2-any.pkg.tar.zst.sig2021-01-24 05:15 310
[PGP]phppgadmin-7.13.0-2-any.pkg.tar.zst.sig2021-01-24 05:15 310
[PGP]physfs-3.0.2-2-x86_64.pkg.tar.zst.sig2020-05-23 06:13 310
[PGP]picom-8.2-1-x86_64.pkg.tar.zst.sig2020-10-27 05:14 310
[PGP]pidgin-libnotify-0.14-13-x86_64.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]pidgin-otr-4.0.2-3-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]pidgin-talkfilters-2.7.0-5-x86_64.pkg.tar.zst.sig2020-01-12 05:14 310
[PGP]piep-0.9.2-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pifpaf-3.0.0-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pigar-0.10.0-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pigz-2.6-1-x86_64.pkg.tar.zst.sig2021-03-06 05:14 310
[PGP]pinfo-0.6.13-1-x86_64.pkg.tar.zst.sig2020-07-30 06:14 310
[PGP]pinta-1.6-3-any.pkg.tar.xz.sig2018-11-10 05:19 310
[PGP]pinta-1.7-3-any.pkg.tar.zst.sig2021-03-25 05:14 310
[PGP]piper-0.5.1-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pitivi-2021.01-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]pius-3.0.0-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pix-1.2.0-1-x86_64.pkg.tar.zst.sig2020-11-26 05:14 310
[PGP]pixz-1.0.7-2-x86_64.pkg.tar.zst.sig2020-09-06 03:16 310
[PGP]pkgdiff-1.7.2-3-any.pkg.tar.zst.sig2020-01-12 05:14 310
[PGP]plan9port-20200205-1-x86_64.pkg.tar.zst.sig2020-02-06 05:13 310
[PGP]planarity-3.0.1.0-1-x86_64.pkg.tar.zst.sig2020-09-06 03:16 310
[PGP]plank-0.11.89-3-x86_64.pkg.tar.zst.sig2021-04-15 06:15 310
[PGP]plasma-pass-1.2.0-1-x86_64.pkg.tar.zst.sig2021-02-16 05:14 310
[PGP]plasma5-applets-redshift-control-1.0.18-2-any.pkg.tar.xz.sig2018-09-20 06:18 310
[PGP]plasma5-applets-thermal-monitor-1.3.0-1-any.pkg.tar.zst.sig2020-08-09 06:13 310
[PGP]plasma5-applets-window-buttons-0.8.1-3-x86_64.pkg.tar.zst.sig2021-02-17 05:15 310
[PGP]pluma-1.24.2-1-x86_64.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]pnetcdf-openmpi-1.12.2-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]pocl-1.6-2-x86_64.pkg.tar.zst.sig2021-02-18 05:15 310
[PGP]podman-compose-0.1.5-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]podofo-0.9.7-1-x86_64.pkg.tar.zst.sig2021-01-17 02:57 310
[PGP]poedit-1:2.4.1-5-x86_64.pkg.tar.zst.sig2021-04-16 06:16 310
[PGP]polipo-1.1.1-4-x86_64.pkg.tar.zst.sig2020-05-08 06:13 310
[PGP]polyclipping-6.4.2-4-x86_64.pkg.tar.zst.sig2020-08-04 06:13 310
[PGP]polyml-5.8.1-1-x86_64.pkg.tar.zst.sig2020-08-08 06:13 310
[PGP]ponymix-5-3-x86_64.pkg.tar.zst.sig2020-07-09 09:40 310
[PGP]pork-0.99.8.1-19-x86_64.pkg.tar.zst.sig2020-06-22 06:13 310
[PGP]posterazor-1.9.7-1-x86_64.pkg.tar.xz.sig2018-11-10 05:14 310
[PGP]postorius-1.3.3-6-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pound-3.0-2-x86_64.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]powerdns-4.4.1-2-x86_64.pkg.tar.zst.sig2021-03-14 05:17 310
[PGP]ppc64le-elf-gdb-10.1-2-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]ppl-1.2-4-x86_64.pkg.tar.xz.sig2019-12-17 05:13 310
[PGP]ppsspp-1.10.3-1-x86_64.pkg.tar.zst.sig2020-07-22 06:13 310
[PGP]pptpd-1.4.0-3-x86_64.pkg.tar.zst.sig2020-07-09 09:43 310
[PGP]pqiv-2.12-2-x86_64.pkg.tar.zst.sig2021-01-31 05:13 310
[PGP]pragha-1.3.4-2-x86_64.pkg.tar.xz.sig2019-11-10 05:13 310
[PGP]presage-0.9.1-1-x86_64.pkg.tar.zst.sig2021-04-03 06:14 310
[PGP]primecount-6.4-1-x86_64.pkg.tar.zst.sig2021-03-21 05:14 310
[PGP]primesieve-7.6-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]privoxy-3.0.32-1-x86_64.pkg.tar.zst.sig2021-03-02 05:14 310
[PGP]proj-8.0.0-2-x86_64.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]projectm-3.1.12-1-x86_64.pkg.tar.zst.sig2021-03-27 05:16 310
[PGP]projectm-pulseaudio-3.1.12-1-x86_64.pkg.tar.zst.sig2021-03-27 05:16 310
[PGP]projectm-sdl-3.1.12-1-x86_64.pkg.tar.zst.sig2021-03-27 05:16 310
[PGP]prusa-slicer-2.3.0-1-x86_64.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]ps_mem-3.13-1-any.pkg.tar.zst.sig2020-03-05 05:13 310
[PGP]pugixml-1.11.4-1-x86_64.pkg.tar.zst.sig2020-12-23 05:14 310
[PGP]pulseaudio-equalizer-ladspa-3.0.2-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]purple-facebook-0.9.6-3-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]purple-skypeweb-1.7-2-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]puzzles-20200524-1-x86_64.pkg.tar.xz.sig2020-05-27 06:13 310
[PGP]pwndbg-2020.07.23-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pyannotate-1.2.0-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pybind11-2.6.2-2-any.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]pychess-0.99.3-1-any.pkg.tar.xz.sig2018-10-17 06:13 310
[PGP]pygmentize-2.4.2-3-any.pkg.tar.xz.sig2019-11-01 05:13 310
[PGP]pygmentize-2.5.2-1-any.pkg.tar.xz.sig2019-11-30 05:13 310
[PGP]pylama-7.7.1-6-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]pynac-0.7.27-1-x86_64.pkg.tar.zst.sig2021-01-25 05:14 310
[PGP]pyneighborhood-0.5.4-4-any.pkg.tar.xz.sig2018-04-12 08:09 310
[PGP]pyprof2calltree-1.4.5-4-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]pyrit-0.5.0-4-x86_64.pkg.tar.zst.sig2020-05-31 06:13 310
[PGP]pysolfc-2.10.1-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aaf2-1.4.0-1-any.pkg.tar.zst.sig2021-04-18 06:15 310
[PGP]python-abydos-0.5.0-1-x86_64.pkg.tar.zst.sig2020-12-24 05:14 310
[PGP]python-aiobotocore-1.1.2-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aioconsole-0.2.1-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aiohttp-3.7.4.post0-1-x86_64.pkg.tar.zst.sig2021-04-15 06:15 310
[PGP]python-aiohttp-apispec-2.2.1-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aiohttp-cors-0.7.0-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aiohttp-socks-0.4.2-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aioitertools-0.7.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-aiomysql-0.0.20-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aiorpcx-0.18.4-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aiosmtpd-1.2.2-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-amqp-5.0.2-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-aniso8601-8.0.0-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-ansi2html-1.5.2-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-apispec-4.0.0-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-apispec-webframeworks-0.5.2-3-any.pkg.tar.zst.sig2020-11-14 05:14 310
[PGP]python-apptools-5.1.0-1-any.pkg.tar.zst.sig2021-03-13 05:14 310
[PGP]python-argcomplete-1.12.1-1-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-argparse-1.4.0-9-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-args-0.1.0.20170708-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-arpeggio-1.10.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-arrow-1.0.3-1-any.pkg.tar.zst.sig2021-03-19 05:21 310
[PGP]python-astor-0.8.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-astral-2.2-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-async-timeout-3.0.1-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-async_generator-1.10-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-atom-0.6.0-3-x86_64.pkg.tar.zst.sig2020-12-13 05:14 310
[PGP]python-atpublic-2.1.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-auditwheel-3.1.1-2-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-authheaders-0.13.0-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-authres-1.2.0-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-awesomeversion-21.4.0-1-any.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]python-awkward-0.14.0-3-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-axolotl-0.2.3-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-backports.csv-1.0.7-4-any.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-baron-0.9-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-basemap-1.2.2-2-x86_64.pkg.tar.zst.sig2020-11-13 05:17 310
[PGP]python-basemap-common-1.2.2-2-x86_64.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-basictracer-3.1.0-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-bcrypt-3.2.0-3-x86_64.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-beautifulsoup4-4.9.3-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-betamax-0.8.1-7-any.pkg.tar.zst.sig2020-12-07 05:13 310
[PGP]python-binary-memcached-0.30.1-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-biscuits-0.2.1-5-x86_64.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-bitcoinlib-0.11.0-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-bitvector-3.4.9-4-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-bleach-3.2.1-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-bleach-3.3.0-1-any.pkg.tar.zst.sig2021-02-07 05:14 310
[PGP]python-blessed-1.18.0-1-any.pkg.tar.zst.sig2021-03-19 05:21 310
[PGP]python-blosc-1.10.2-1-x86_64.pkg.tar.zst.sig2021-01-30 05:14 310
[PGP]python-bluepy-1.3.0-4-x86_64.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-boto-2.49.0.20190327-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-boto3-1.17.49-1-any.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]python-botocore-1.20.49-1-any.pkg.tar.zst.sig2021-04-11 06:15 310
[PGP]python-bottle-0.12.19-3-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]python-bowler-0.8.0-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-breathe-4.29.0-1-any.pkg.tar.zst.sig2021-04-10 06:13 310
[PGP]python-browserid-0.14.0-7-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-browserid-0.14.0-9-any.pkg.tar.zst.sig2021-04-17 06:13 310
[PGP]python-bsddb-6.2.9-1-x86_64.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]python-btchip-0.1.30-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-btchip-0.1.32-1-any.pkg.tar.zst.sig2021-04-16 06:14 310
[PGP]python-btrees-4.7.2-3-x86_64.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-build-0.1.0-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-buildbot-pkg-2.5.0-3-any.pkg.tar.xz.sig2019-11-01 05:13 310
[PGP]python-cached-property-1.5.2-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cachetools-4.1.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cairocffi-1.2.0-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-cairosvg-2.5.0-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-calmjs.parse-1.2.5-5-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-calmjs.types-1.0.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-canonicaljson-1.4.0-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-case-1.5.3-6-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-cchardet-2.1.7-2-x86_64.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-celery-5.0.0-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-cerberus-1.3.2-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-certifi-2020.12.5-1-any.pkg.tar.zst.sig2021-03-18 05:17 310
[PGP]python-cfgv-3.2.0-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cftime-1.4.1-1-x86_64.pkg.tar.zst.sig2021-02-07 05:14 310
[PGP]python-chai-1.1.2-5-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-characteristic-14.3.0-11-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cjkwrap-2.2-7-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-click-7.1.2-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-click-didyoumean-0.0.3-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-click-help-colors-0.8-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-click-plugins-1.1.1-7-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-click-repl-0.1.6-4-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-click-threading-0.4.4-9-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-clickclick-20.10.2-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cliff-3.5.0-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-clikit-0.4.2-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-clint-0.5.1-10-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cloudflare-2.8.13-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-cloudpickle-1.6.0-1-any.pkg.tar.zst.sig2020-12-24 05:14 310
[PGP]python-colander-1.8.2-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-collada-0.7.1-1-any.pkg.tar.zst.sig2020-12-07 05:13 310
[PGP]python-colorcet-2.0.5-1-any.pkg.tar.zst.sig2021-01-28 05:16 310
[PGP]python-commonmark-0.9.1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-compiler-1.1-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-configargparse-1.2.3-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-configclass-0.2.0-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-configobj-5.0.6-9-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-confuse-1.4.0-1-any.pkg.tar.zst.sig2021-01-17 02:52 310
[PGP]python-construct-2.10.56-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-contextlib2-0.6.0.post1-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-couchdb-1.2-4-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-covdefaults-1.2.0-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-cppy-1.1.0-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-crc16-0.1.1-6-x86_64.pkg.tar.zst.sig2020-12-13 05:14 310
[PGP]python-cryptography-vectors-3.2.1-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-css-parser-1.0.6-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cssutils-1.0.2-4-any.pkg.tar.xz.sig2019-11-01 05:13 310
[PGP]python-cssutils-1.0.2-5-any.pkg.tar.zst.sig2020-07-12 06:13 310
[PGP]python-curio-1.5-1-any.pkg.tar.zst.sig2021-03-19 05:21 310
[PGP]python-curtsies-0.3.4-3-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-curtsies-0.3.5-1-any.pkg.tar.zst.sig2021-04-15 06:15 310
[PGP]python-cvxopt-1.2.6-1-x86_64.pkg.tar.zst.sig2021-02-19 05:15 310
[PGP]python-cwcwidth-0.1.4-1-x86_64.pkg.tar.zst.sig2021-04-15 06:15 310
[PGP]python-cycler-0.10.0-8-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-cypari2-2.1.2-3-x86_64.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-cysignals-1.10.3-1-x86_64.pkg.tar.zst.sig2021-03-17 05:16 310
[PGP]python-d2to1-0.2.12.post1-9-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-dae-1.0.2-2-any.pkg.tar.xz.sig2018-09-20 06:18 310
[PGP]python-daemonize-2.5.0-4-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-dask-2021.3.0-1-any.pkg.tar.zst.sig2021-03-16 05:14 310
[PGP]python-databases-0.4.0-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-dateparser-1.0.0-2-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-dateutil-2.8.1-6-any.pkg.tar.zst.sig2021-04-19 06:13 310
[PGP]python-dbus-client-gen-0.7-5-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-dbus-signature-pyparsing-0.03-8-any.pkg.tar.zst.sig2020-11-12 05:14 310
[PGP]python-ddt-1.4.1-3-any.pkg.tar.zst.sig2020-11-13 05:18 310
[PGP]python-